The statement most air masses form over the polar of tropical regions is false because polar air masses are generally formed over hot or warm regions (question 2), while the statement fronts usually have fair weather is false since they trigger precipitation, thunderstorms, and even tornadoes (question 3).
What is a weather air mass?An air mass is a term used in methodology in order to denote any mass of air that is uniform in regard to different variables associated with such conditions such as for example temperature and or humidity.
Moreover, a front is a mass of air that leads to a climatic process such as precipitation or even more strong phenomena.
Therefore, with this data, we can see that weather air masses are uniform in regard to temperature and also humidity and they are associated with the emergence of different climatologic phenomena.
Learn more about air masses here:
https://brainly.com/question/26209372
#SPJ1
Choose the correct statement below regarding the differences between a strong and a weak acid when titrated with a strong base.
a. The pH at the endpoint for the strong acid is neutral, whereas the pH at the endpoint for the weak acid is lower than neutral.
b. The pH at the endpoint for the strong acid is neutral, whereas the pH at the endpoint for the weak acid is higher than neutral.
c. The pH at the endpoint for the weak acid is neutral, whereas the pH at the endpoint for the strong acid is higher than neutral.
d. The pH at the endpoint for the weak acid is neutral, whereas the pH at the endpoint for the strong acid is lower than neutral.
e. The pH at the endpoint for both the strong acid and weak acid is neutral.
b. The pH at the endpoint for the strong acid is neutral, whereas the pH at the endpoint for the weak acid is higher than neutral. Is the correct statement.
How pH varies from strong to weak acid titration with strong base?At the beginning of a titration, when base is given to acid, the pH rises very slowly. The pH starts to climb quickly as you approach the equivalence point. The equivalency point's pH is 7 if a strong acid and strong base are employed in the titration. After reaching the equivalence point, the pH change rate slows down once more. When the moles of acid and base are equal and the pH equals 7, the strong acid-strong base titration reaches its equivalence point. In a weak acid-strong base titration, the pH is more than 7 at the point of equivalency. In a strong acid-weak base titration, the equivalence point pH is less than 7.
To learn more about titration visit,
https://brainly.com/question/27967138
#SPJ4
Draw the Lewis Structure for BFCl2 . Name the VSEPR Shape. Format > A he ! . 3 2
The inorganic chemical compound comprises two chlorine, and one beryllium atom is beryllium chloride.
What is Lewis Structure for BFCl2?This inorganic compound resembles aluminum chloride because aluminum and beryllium have diagonal relations with each other.Beryllium chloride is an inorganic compound with the formula BeCl2. It is a colourless, hygroscopic solid that dissolves well in many polar solvents. Its properties are similar to those of aluminium chloride, due to beryllium's diagonal relationship with aluminium.Beryllium chloride is prepared by reaction of the metal with chlorine at high temperatures:[2]Be + Cl2 → BeCl2BeCl2 can also be prepared by carbothermal reduction of beryllium oxide in the presence of chlorine.[3] BeCl2 can be prepared by treating beryllium with hydrogen chloride.Two forms (polymorphs) of BeCl2 are known. Both structures consist tetrahedral Be2+ centers interconnected by doubly bridging chloride ligands. One form consist of edge-sharing polytetrahedral. The other form resembles zinc iodide with interconnected adamantane-like cages.[4] In contrast, BeF2 is a 3-dimensional polymer, with a structure akin to that of quartz.To learn more about Lewis Structure refer to:
https://brainly.com/question/29375427
#SPJ4
Users in a data mart obtain data that pertain to a particular business function froma ______.A) data roomB) data centerC) datasheetD) data warehouse.
Users in a data mart obtain data that pertain to a particular business function from data warehouse.
What are data martsData mart is a data storage system that contains specific information for an organization's business units. Data mart contains a small and selected portion of the data stored by the company in a larger storage system. Companies use data marts to analyze department-specific information more efficiently. Data marts provide summary data that key stakeholders can use to make the right decisions quickly.
For example, companies might store data from multiple sources, such as supplier information, orders, sensor data, employee information, and financial records in their data warehouses or data lakes. However, companies store information relevant to, instance, marketing department, such as social media reviews and customer records, in a data mart.
Data warehouseData warehouse is a vast database system that stores information for the entire business. The data warehouse collects raw information from various sources, such as business software and social media feeds, and processes it into structured data that is stored in tabular format. Businesses can connect enterprise data warehouses to business intelligence tools to make smarter decisions.
Learn more about data Mart at https://brainly.com/question/30087825.
#SPJ4
Convert 457 nm to frequency. (In scientific notation)
We obtain 1.369x1020 while converting 457 nanometers to frequency.
Describe the nanoscale.The nanometre, often known as the nanometer, is a length unit that is one billionth of a metre and 1000 picometres in the International System of Units.Hertz (Hz) or its multiples are used to measure frequency. In metres, multiples of metres, or fractions of metres, the wavelength is expressed. If the velocity doesn't change, the wavelength gets shorter as the frequency rises.By multiplying by 10 to the power of 9, you can convert hertz to nanometers by dividing the wave velocity by the frequency.A nanometer (nm), the SI unit for wavelength, is a decimal fraction of a metre.The quantity of recurrences per unit of time determines an event's frequency.1 wavelength equals 2.997x1017 hertz in nanometers [nm]
In this case, 457 nm.
457 nm = 1.369 x 1020 Hz is the result of multiplication.
To learn more about nanometer refer to:
https://brainly.com/question/1251803
#SPJ4
Correct Part C Fe(OH)3(s) + H2SO4(aq) → Fe2(SO4)3(aq) +H2O(l) Express your answer as a chemical equation. Identify all of the phases in your answer. ΑΣφ Submit Request Answer Part D Mg3N2(8) + H2SO.(aq) + MgSo.(aq) + (NH4)2SO4(aq) Express your answer as a chemical equation. Identify all of the phases in your answer.
The balanced chemical equation will be [tex]2Fe(OH)_{3}[/tex] + 3[tex]H_{2} (SO)_{4}[/tex] = [tex]Fe(SO_{4} )_{3}[/tex] + 6[tex]H_{2} O[/tex].
Phases in the reaction:[tex]Fe(OH)_{3}[/tex] is in solid phase, [tex]H_{2}SO_{4}[/tex] is is aqueous phase, [tex]Fe_{2}(SO)_{4}[/tex] is also in aqueous phase whereas water is in liquid phase, since (s) resembles solid phase, (aq) represents aqueous phase and (l) represents liquid phase.
Magnesium and sulfuric acid have what kind of reaction?Magnesium ribbon and diluted sulfuric acid combine in a combination reaction to create hydrogen and magnesium sulphate.
What relevance does the neutralizing reaction have to us?In reality, neutralization reactions take place often. Following are a few instances or uses of neutralization: The hydrochloric acid in the stomach, which is present when a person has gastric issues or gastritis, causes indigestion or stomach pain. Titration is used in practical classes to study neutralization reaction. A conical flask containing the base solution and the indicator is gently filled with an acid solution of a specific concentration using a burette.
To learn more about chemical reaction refer to:
brainly.com/question/25769000
#SPJ4
Are the O-N-O bond angles greater in the nitrite ion (NC2-) or the nitrate ion (NO3-)? Please select the answer that best explains your conclusion. a. Nitrite has the greater bond angle because a trigonal planar bond angle is greater than a tetrahedral bona angle. b. Nitrite has the greater bond angle because a linear bond angle is greater than a trigonal planar bond angle. c. Nitrate has the greater bond angle because nitrite's lone pairs take up more space than bonds. d. Nitrate has the greater bond angle because double bonds take up more space than single bonds.
Nitrate having a greater bond angle because double bonds take up more space than to the single bonds.
The O-N-O bond angles greater in the nitrite ion (NC₂⁻) or the nitrate ion (NO₃⁻) having a greater bond angle because double bonds take more space than to the single bonds.
Incase of NO₃ : Nitrogen having five valence electrons and oxygen having two valency whereas O- having one valency. N=O having 1bp and in N-O also having 1bp.
In nitrate, there is a single center atom that is encircled by the three oxygen atoms that have identical bonds to one another and are positioned at the triangle's angles in the same one-dimensional plane. In essence, nitrate contains no lone pairs and three electron domains. As a result, the NO₃⁻ molecule's are trigonal planar and slightly bent chemical shape. Bond angle is 120 degrees.
To now more about bond angle here
https://brainly.com/question/13751116
#SPJ4
What will be the result if 100 mL of 0.06 M Mg(NO3)2 is added to 50 mL of 0.06 M Na2C204? (Ksp of MgC2O4(s) - 8.6x10-5)
- A precipitate MgC204 will form.
- A precipitate Mg(NO3)2 will form.
- No precipitate will form.
- A precipitate NaNO3 will form.
A precipitate Mg(NO3)2 will form.
To know more about precipitate Mg visit:
https://brainly.com/question/28985933
#SPJ4
At which of the following pH values does the amino acid have the best buffering capacity? The graph below is provided for ease of answering parts (d) and (e). It is a still image of the titration above. What is the pl (isoelectric point)? The graph below represents the titration of an amino acid with NaOH solution. View the titration and answer the questions below (parts a through e). At what pH is the average net charge - 1/2? Where does the amino acid have a net charge of-1? At what point has enough base been added to react with 1/2 of the NH3+ groups?
The pH values at which amino acid have the best buffering capacity are 2.34 and 9.69.
The largest buffering capabilities of monoamino monocarboxylic acids are found in the two pH ranges closest to their pK′ values. Buffer capacity refers to the ability of a solution to resist changes in pH which can be either absorbing or desorbing H+ and OH- ions. It is the moles of an acid or base required to change the pH of a solution by 1, divided by the pH change and the volume of buffer in liters. Buffer capacity is a unitless number. When an acid or base is added to a buffer system, the pH change can be small or large which depends on both the initial pH and the capacity of the buffer to resist change in pH. Hence, a buffer resists changes in pH due to the addition of an acid or base though consumption of the buffer.
Learn more about Buffer capacity:
https://brainly.com/question/24188850
#SPJ4
H2O has a Delta.Hvap = 40.7 kJ/mol. What is the quantity of heat that is released when 27.9 g of H2O condenses? Use q equals n delta H..
H2O has a Delta. Hvap = 40.7 kJ/mol. The quantity of heat that is released when 27.9 g of H2O condenses will be -63.1 kJ
Enthalpy of vaporization of water,
ΔHvap = 40.7 kJ/mol
Mass of water, m = 27.9 g
we have to find out that how much the amount of heat (Q) released
The reaction is:
H2O(g) ↔ H2O(l)
The amount of heat evolved during condensation which involves a phase transition from vapor to liquid is given as:
Q = n × Delta.Hvap
n = number of moles
Since this is a condensation process:
ΔHcond = -ΔHvap
Q =[tex]\frac{27.9}{18}[/tex] × ( - 40.7 kJ/mol)
Q = -63.1 kJ
To look more about quantity of heat click here
brainly.com/question/13946724
#SPJ4
Sulfuric acid in acid rain forms when gaseous sulfur dioxide pollutant reacts with gaseous oxygen and liquid water to form aqueous sulfuric acid.
Sulfuric acid in acid rain forms when gaseous sulfur dioxide pollutant reacts with gaseous oxygen and liquid water to form aqueous sulfuric acid.The chemical reaction is given as:
2SO₂(g) O₂(g) 2H₂O(l) → H₂SO₄(aq)
When sulfur dioxide gas reacts with oxygen gas and liquid water it gives aqueous solution of sulfuric acid.
The chemical reaction is given as:
2SO₂(g) O₂(g) 2H₂O(l) → H₂SO₄(aq)
According to stoichiometry, 2 moles of sulfur dioxide gas reacts with 1 mole of oxygen gas and 2 moles of water to give 2 moles of aqueous sulfuric acid. Stoichiometry involves using relationships between reactants and/or products in a chemical reaction to determine desired quantitative data.
Your question is incomplete most probably your full question was
Sulfuric acid is a component of acid rain formed when gaseous sulfur dioxide pollutant reacts with gaseous oxygen and liquid water to form aqueous sulfuric acid. part a write a balanced chemical equation for this reaction. express your answer as a chemical equation. identify all of the phases in your answer.
To look more about sulphuric acid click here
brainly.com/question/28513840
#SPJ4
is cellulose polar or nonpolar?
Cellulose is a polymer of glucose which is polar as it has many exposed OH groups.
Cellulose has 5 OH groups. It is not soluble in water which is polar as the chain behaves as hydrophobic It is so long it makes a massive closed structure If the chain is cut into smaller chains it reacts extensively and is soluble in water which is polar. Cellulose chains can compromise more than 1000-2000 molecules.
Cellulose polymer is hydrophilic and tends to strongly interact with water. Water molecules interact easily with cellulose chains. At the cellulose chain interface, many hydrogen bonds are broken.
To learn more about Polar
brainly.com/question/3184550
#SPJ4
In the presence of 55.0 moles of oxygen how many moles of iron can be used to produce iron (III) oxide?
In the presence of 55.0 moles of oxygen, 73.3 moles of iron can be used to produce iron (III) oxide.
How to calculate moles using stoichiometry?Stoichiometry refers to the study and calculation of quantitative (measurable) relationships of the reactants and products in chemical reactions (chemical equations).
According to this question, iron reacts with oxygen gas to produce iron(III) oxide as follows:
4Fe + 3O₂ → 2Fe₂O₃
Based on the above equation, 4 moles of iron reacts with 3 moles of oxygen.
This means that if 55 moles of oxygen reacts, 55 × ⁴/3 = 73.3 moles of iron will also react.
Learn more about stoichiometry at: https://brainly.com/question/9743981
#SPJ1
Use Table B in your Student Guide to answer the questions about ion concentrations.
A solution with a pH = 13 has approximately how many moles of OH– ions per liter?
How many moles of H+ would this same solution have per liter?
(Use the decimal form of your answer.)
A different solution with an H+ concentration of 1.0 × 10–4 would have a pH =
.
a) The hydroxide ion concentration is 10 M
b) The number of moles of the hydrogen ions is 1 * 10^- 13 moles
c) The pH of the solution is 4.
What is the pH?
We know that the pH of the solution has to do with the amount of the hydrogen ions that we have in a solution. Looking at the fact that the number of the hydrogen or the hydroxide ions that is in the solution is the basis that we can use to decide whether the solution can be said to be acidic or not.
a) If the pH has been given for the solution as 13 then
Hydrogen ion concentration = Antilog (-13) = 1 * 10^-13 M
It then follows that; [tex][OH^-] [H^+] = 1 * 10^-14[/tex]
Then [tex]OH^-[/tex] = 1 * 10^-14/1 * 10^-13 M
= 10 M
The number of moles per liter of the hydrogen ions would be;
Concentration * volume
= 1 * 10^-13 M * 1 L
= 1 * 10^-13 moles
If the hydrogen ion concentration is 1.0 × 10^–4 then the pH of the solution = - log( 1.0 × 10^–4)
= 4
Learn more about pH:https://brainly.com/question/15289741
#SPJ1
Answer:
Use Table B in your Student Guide to answer the questions about ion concentrations.
A solution with a pH = 13 has approximately how many moles of OH– ions per liter? ⇒ 0.1
How many moles of H+ would this same solution have per liter?
⇒ 0.0000000000001
(Use the decimal form of your answer.)
A different solution with an H+ concentration of 1.0 × 10–4 would have a pH = 4.
Explanation:
he is right on the last question but not the rest
The mussel shells are eroding because the ocean is too acidic. More acidic oceans dissolve caco3 faster and change them into hco3-. There are 3 possible ways to help reduce mussel shell erosion bydisrupting the equilibrium.
It claims that more acidic oceans dissolve calcium carbonate in a faster way and produce hydrogen carbonate ions.
The equations is as follows
a. Lower CO₂; this reduces the H₂CO₃ and increases the pH.
b. Add CO₃²⁻: this will add base and increase its concentration.
c. Add Ca²⁺: this will increase the precipitation rate of calcium carbonate (correct choice).
THe equilibrium equations will be as folows;
CaCO₃(s)⇌ Ca²⁺(aq) + CO₃²⁻(aq)
CO₃²⁻(aq) + H⁺ ⇌ HCO₃⁻ (aq)
CO₂(g) + H₂O(l) ⇌ H₂CO₃(aq)
At first instance, we should recall the equilibrium equations that take place when acidic oceans dissolve calcium carbonate in a faster way
Shifts from equilibrium will be
Where we can see that the first choice is thoroughly discarded as the addition of CO₂ actually increases the ionizable carbonic acid (acidity). Moreover, the addition of CO₃²⁻ may also lead to the formation of more protons-releasing carbonic acid which also contributes to the acidity of the ocean.
The Hypothesis will be as follows;
Thereby, the correct condition that, for sure, contributes to the preservation of mussel shells will be the addition of Ca²⁺ and the hypothesis will be that it shifts the equilibrium towards the formation of more CaCO₃, the active compound in these shells.
Your question is incomplete most probably your full question was
The mussel shells are eroding because the ocean is too acidic. More acidic oceans dissolve CaCO3 faster and change them into HCO3-. There are 3 possible ways to help reduce mussel shell erosion bydisrupting the equilibrium. Choose the condition that you think will reduce mussel shell erosion.
Form a hypothesis and explain how you think this change will help.
To look more about Solubility click here
brainly.com/question/29661360
#SPJ4
what is lewis structure for CH3CH2CHO and CH3CH2COO^(-) and the number of bonding electrons and nonbonding electrons??
The Lewis structure of a compound can be generated by trial and error. We start by writing symbols that contain the correct number of valence electrons for the atoms in the molecule.
What is the Lewis structure of CH3CH2OH?We may determine the amount of nonbonding electrons in the molecule by deducting two electrons from the total number of valence electrons for each link in the skeletal structure since covalent bonds require two electrons to form.
The Lewis structure is created when electrons are combined to create covalent bonds up until the point when all elements (apart from hydrogen atoms) have an octet of valence electrons.
Let's use the method of trial and error to create the Lewis structure of carbon dioxide, or CO2. We begin by counting the valence electrons on each atom using the elemental electron configurations. While oxygen has six valence electrons, carbon only has four.
To learn more about Lewis structure refer to:
https://brainly.com/question/29606276
#SPJ4
What is one possible Lewis structure for C3NOH7?
There is no possible Lewis structure for C3NOH7.
What is a Lewis structure?
A Lewis structure, also known as a Lewis dot diagram, is a way to represent the bonding and non-bonding electrons in a molecule. It is named after Gilbert N. Lewis, who introduced it in 1916. A Lewis structure shows the chemical symbol of each atom in the molecule and the electrons that are involved in the chemical bonds. It is used to predict the molecular geometry, reactivity, and other chemical properties of a molecule.
C3NOH7 is a molecule that does not exist in nature, it is not a stable compound. Nitrogen is not a typical Lewis acid, and it is unlikely that it will form a Lewis structure with 7 hydroxyl groups. It is not possible to draw a Lewis structure for C3NOH7, as the molecule is not stable and it is not a valid chemical compound.
It is important to make sure that the chemical formula is correct and corresponds to a stable and well-characterized compound before attempting to draw a Lewis structure.
Hence, there is no possible way to draw a Lewis structure for C3NOH7.
To learn more about Lewis dot diagram from the given link:
https://brainly.com/question/20300458
#SPJ4
..
O :
|| ..
The H₃C - CH₂ - C - NH₂ is the possible Lewis structure for C3NOH7.
What is Lewis structure?
All valence electrons are represented structurally by Lewis structures, which are used for molecules and polyatomic ions. These structural formulas are also known as Lewis dot structures because valence electrons are frequently depicted as dots in mathematical representations of matter.
What is electron?
An electron can either be unattached to an atom or free. An electron is a subatomic particle that has a negative charge (not bound). An atom is made up of three different sorts of particles: protons, neutrons, and an electron that is connected to an atom. An atom's nucleus is made up of protons, neutrons, and electrons.
..
O :
|| ..
H₃C - CH₂ - C - NH₂
..
O :
|| ..
Therefore, H₃C - CH₂ - C - NH₂ is the possible Lewis structure for C3NOH7.
Learn more about Lewis structure from the given link.
https://brainly.com/question/20300458
#SPJ4
What is the molecular geometry of the ClF4− ion?
Select one:
a. trigonal pyramidal
b. seesaw
c. square planar
d. square pyramidal
e. tetrahedral
The molecular geometry of CLF4- ion is square planar molecular geometry.
An arrangement of four atoms or groups of atoms that form a square shape around a center atom is known as a square planar geometry in chemistry.
Commonly, compounds with a core atom that has four electron pairs in its valence shell will exhibit this geometry. Transition metals are an example of a square planar complex.
In general, bond angles are 90 degrees, and bond distances are comparable. Especially in those with a d8 electronic structure, this molecular geometry is seen in a wide variety of transition metal complexes.
If you need to learn more about Molecular geometry, click here.
https://brainly.com/question/28557524?referrer=searchResults
#SPJ4
a cats heart can beat 220 times in 2minutes nearly twice as fast as a human heart. Assume the number of heartbeats y is the proportional to the number of minutes x. Write and solve an equation to determine how many times a cats heart beats in 5minutes
The heart beat fo the cat in 5 minutes if the cats heart can beat 220 times in 2minutes is 550 minutes.
How to illustrate the equation?An equation simply has to do with the statement that illustrates the variables given. In this case, it is vital to note that two or more components are considered in order to be able to describe the scenario.
Since the cats heart can beat 220 times in 2minutes nearly twice as fast as a human heart. The heart beat in 5 minutes will be:
= 220 / 2 × 5
= 550 minutes
Learn more about equations on
brainly.com/question/2972832
#SPJ1
24. Convert 1.90 x 10^-5 lbs. to grams Your set up and the answer
must include units.
[1Kg = 2.2 lbs]
In a new compound, it is found that the central carbon atom is sp2 hybridized. This implies that: 1. carbon has a tetrahedral electronic geometry. 2. carbon has four lone pairs of electrons. 3. carbon has four sigma bonds. 4. carbon is also involved in a pi bond. 5. carbon has four regions of high electron density
4) The central carbon atom of a new compound is found to be sp2 hybridized. This suggests that a pi bond also involves carbon.
The sp2 hybridized carbon atom forms a bond with?A carbon atom is sp2 hybridized when one s-orbital and two p orbitals bond together. Between the three atoms, there are two single bonds and one double bond.
Can sp2 make bonds with pi?One "extra" p orbital remains on the atomic center because only three of the four atomic orbitals are used to create the sp2 hybrid orbitals. To form a bond, this p orbital can overlap with other p orbitals nearby.
What has the central atom hybridized by sp2?The only possible molecular geometry for sp2 hybridized central atoms is trigonal planar. The shape is also trigonal planar if all of the bonds are in place. The shape becomes bent if there are only two bonds and one single pair of electrons holding a bond in place.
To learn more about carbon atom here:
https://brainly.com/question/13990654
#SPJ1
If the surface area of reactants is larger Select one: a. the reaction rate is generally higher b. the reaction.rate is generally lower. c. the reaction rate is not affected d. the rate-determining step is eliminated.
The reaction rate is generally faster when the surface area of the reactants is larger, because more particles are exposed to the other reactant.
What are the factors that affect the rate of reaction?The reaction rate and otherwise rate of reaction is the rate at which a chemical reaction occurs, defined as proportional to the increase in product concentration per unit time and the decrease in reactant concentration per unit time.The reaction rate is influenced by the four main factors that influence the reaction rate are reactant concentration, physical state of the reactants, surface area, temperature, and the presence of a catalyst.The increased surface area of a reactant exposes more particles to the other reactant. There is a greater likelihood of particles colliding, resulting in more successful collisions per second. The rate of reaction quickens.To learn more about rate of reaction refer to :
https://brainly.com/question/24795637
#SPJ4
1. what is the half-life of a 100.0 g sample of nitrogen-16 that decays to 12.5 g of nitrogen-16 in 21.6 s?
According to the question, the aforementioned sample's half-time is 7.2 seconds, degrading to 12.5 grams of nitrogen-16 after 21.6 seconds.
Is nitrogen bad for people?People lose their lives every year by drinking "air" with insufficient oxygen. Many people believe nitrogen is safe since it makes up 80 per cent of both the air we breathe. Only when nitrogen is combined with the correct amount of oxygen is it safe to breathe, though.
Initial weight No=100 g
Final weight N=12.5 g
Time t=21.6 sec
t12=?
t=n∗t12
NNo=(12)n
12.5100=(12)n
18=(12)n
(12)3=(12)n
Thus,
n=3
t12=tn
t12=21.63
t12=7.2 sec
To know more about nitrogen visit:
https://brainly.com/question/16711904
#SPJ4
What is the hybridization state of the central atom in SO2, assuming you do not expand the octet on the central atom?
A) sp3
B) sp2
C) sp
D) spd
E) spd2
Answer:
B. sp2
Explanation:
We see that there is a pi bond between one of the Oxygens when we draw out the Lewis Structure.
pi bonds are every bond other than a single bond. So double and tripple bonds.
To easily understand this, we can write out "sppp" and cross off however many pi bonds (p) there are. In this example we only have 1 pi bond so the hybridization will be sp2.
What is the formula of Cobalt (II) Nitride?
A) CONO3
B) CON₂
C) Co₂N
D) C03N₂
Answer:D) C03N₂
Explanation:
Which weighs more: 7.65 moles of sulfuric acid (H2SO4) or 7.89 x 1024 formula units of copper (II) chloride (CuCl2)
7.89 x 10^24 formula units of copper (II) chloride (CuCl2) weigh more than 7.65 moles of sulfuric acid (H2SO4).
In order to determine the weight of given chemicals, the molar-mass conversion is used which is given by:
Number of moles = mass/molar mass
Where Molar mass = Atomic mass of element x number of atoms
For 7.65 moles of sulfuric acid (H2SO4)
Molar mass of H2SO4 = 2 x 1.0079 g/mol + 1 x 32.06 g/mol + 4 x 16.00 g/mol = 98.0785 g/mol
Hence, Mass = 7.65 x 98.0785 = 750.3 g or 0.75kg
For 7.89 x 10^24 formula units of copper (II) chloride (CuCl2)
The formula unit is converted to moles and mass is determined. A formula unit refers to the chemical formula of an ionic compound that lists the ions in the lowest ratio that equals a neutral electrical charge. The formula units of any compound are determined by multiplying the moles of the given compound by the Avogadro number. Hence, formula unit is converted to moles by dividing the formula unit of the chemical by Avogadro number i.e., 6.022 × 10^23, hence 7.89 x 10^24/6.022 × 10^23 = 13.1.
Molar mass of CuCl2 is = 1 x 63.546 + 2 x 35.453 = 134.452 g/mole
Hence, Mass = 13.1 x 134.452 = 1761.3 g or 1.76kg
Based on the mass, 7.89 x 10^24 formula units of copper (II) chloride (CuCl2) weigh more than 7.65 moles of sulfuric acid (H2SO4).
Learn more about Formula units:
https://brainly.com/question/26388921
#SPJ4
Two substances, both solids, start at the same temperature. You transfer the same amount of energy into both solids, but substance 1 becomes a liquid before substance 2. Based on this evidence, which substance has a stronger molecular attraction? Explain your answer
Answer:
we get subtract from photography filter paper etc
Answer:
Based on the information provided, substance 1 has a stronger molecular attraction than substance 2. When a substance is heated, the energy that is added is used to overcome the forces that hold the molecules together. If the forces of attraction between the molecules are strong, it will take more energy to separate them and cause the substance to change phase from a solid to a liquid. Therefore, if substance 1 becomes a liquid at a lower temperature than substance 2, it must have weaker forces of attraction between its molecules, indicating that substance 2 has a stronger molecular attraction.
Explanation:
Draw the best Lewis structure for
CH3CH(CH3)CH2C(CH2CH3)2CHO, a neutral molecule.
CH3CH–CH(CH3)–CH2C(=O)–CH(CH2CH3)2 . After all the bonds are in place, check to make sure that all atoms have the correct number of valence electrons (8).
1. Start by drawing the molecular skeleton of the molecule. It consists of 10 atoms: C, H, and O.
2. Count the total number of valence electrons in the molecule. There are 5 C atoms with 4 valence electrons each (20), 7 H atoms with 1 valence electron each (7), and 1 O atom with 6 valence electrons (6). The total number of valence electrons in the molecule is 33.
3. Connect each atom using single bonds.
4. Distribute the remaining valence electrons to form bonds between the atoms and fill in the octet rule for all atoms. This may require double or triple bonds.
5. After all the bonds are in place, check to make sure that all atoms have the correct number of valence electrons (8).
6. Draw the Lewis structure of the molecule:
CH3CH–CH(CH3)–CH2C(=O)–CH(CH2CH3)2
learn more about valence electrons here
https://brainly.com/question/28977387
#SPJ4
Which of the following is true of electrolytes? A) all electrolytes have water as a solvent B) all electrolytes contain cations and anions C) both (a) and (b) are true D) both (a) and (b) are false
Electrolytes have water as a solvent also electrolytes contain cations and anions. Hence, both (a) and (b) .
For an Electrolytes, water is considered as an most important solvent. Electrolytes like sodium, calcium, potassium, chlorine, phosphate, and magnesium is obtained from the food we consume and also from your drinking fluids. Electrolyte levels can vary from small or too high in your body. This is dependent upon the change in amount of water by the body.
Hence , an electrolyte is said to have equal numbers of positive and negative ions in solution. Thus ,after applying electric field , the positive ions present are generally move from the direction of the field and the negative ions move opposite the field.
To learn more about Electrolytes , here
brainly.com/question/29771118
#SPJ4
Draw the Lewis structure of CIBr_3 showing all lone pairs. A CIBr_3 molecule is polar. nonpolar. Identify the molecular geometry of CIBr_3. square planar trigonal pyramidal linear trigonal planar see-saw square pyramidal trigonal bipyramidal bent tetrahedral T-shaped octahedral What are the approximate bond angles in CIBr_3? Select all that apply. 90 degrees 109.5 degrees 120 degrees 180 degrees
The approximate bond angles in CIBr_3 is 90 degree.
What are the CIBr3's approximate bond angles?Square pyramidal trigonal bipyramidal pyramid see-saw tetrahedral square planar bent with a trigonal planar form linear trigonal pyramidal octahedral Incorrect The chemical CIBr3 has polarity.BrCl3 has a T-shape and a dipole moment that doesn't quite cancel out. BrCl3 is hence polar.Due to its asymmetrical structure and the existence of two lone pair electrons, ClF3 is a polar molecule because it has an uneven distribution of charge.Non-polar molecules lack unshared electrons and are symmetrical. Polar molecules are asymmetric, either having atoms with differing electronegativities bound together or having lone pairs of electrons on a core atom.To learn more about bond angles refer to:
https://brainly.com/question/25425872
#SPJ4
Boron has an average atomic mass of 10.81. One isotope of boron has a mass of 10.012938 and a relative abundance of 19.80 percent. The other isotope has a relative abundance of 80.20 percent.
What is the mass of that isotope? Report to two decimal places.
The mass of the other boron isotope is 11.0 u.
What is the mass of the other isotope?We know that isotopes do not have the same mass number but they do have the same atomic number because they come from the same element as we know.
Now we can see that;
Average atomic mass = Sum of the weighted masses of the isotopes.
Let the unknown mass be x
10.81 = (10.012938 * 0.198) + (x * 0.802)
10.81 = 1.98 + 0.80x
x = 10.81 - 1.98/0.80
x = 11.0
Thus the other isotope is found to have a mass of about 11.0 .
Learn more about atomic mass:https://brainly.com/question/17067547
#SPJ1