3B. A 2 × 3 rectangle is partitioned into 6 congruent numbered squares as shown. A single 1 × 2 rectangle is placed to cover exactly 2 of the numbered squares. The covered numbers are then added together. How many different sums can result?, please

3B. A 2 3 Rectangle Is Partitioned Into 6 Congruent Numbered Squares As Shown. A Single 1 2 Rectangle

Answers

Answer 1

Answer:

4

Step-by-step explanation:

If the rectangle covers 2 squares at a time ; sum of each covered square would be :

1 + 2 = 3

2 +3 = 5

3 + 6 = 9

6 + 5 = 11

5 + 4 = 9

4 + 1 = 5

The sums are :

3, 5, 9, 11, 9.5

The different sums are :

3, 5, 9, 11

Hence, the number of different sums is 4


Related Questions

Explain the approach you would take to verify that the following equation is an identity and why you would choose that approach. Do not actually verify that the equation is an identity.

(sin(x)+cos(x))^2/sin(2x)=csc(2x)+1​

Answers

Answer:

i had done verified only.

☆☆10 points☆☆
BRAINLIEST IF CORRECT ANSWER!​

Answers

Answer:

[tex]this \: paper \: needs \: to \: be \: folded \: \\ \underline{ \boxed{twice \: (2 \: times)}}[/tex]

Step-by-step explanation:

[tex]let \: the \: let \: the \: length \: be \to \: x \\when \: folded : it \: becomes \to \: \frac{x}{2} \\hence : \to \\ 93.5 \times \frac{x}{2} = (93.5 - 1) \\ 93.5x = 2(93.5 - 1) \\ 93.5x = 2 \times 92.5 \\ 93.5x = 185 \\ x = \frac{185}{93.5} \\ \boxed{x = 1.9786096257 }\\ [/tex]

Coach Cranford bought bottled water for the basketball team. The bottles each hold 1 pint of water.
How many gallons of water would be equivalent to 24 bottles of water?

Answers

Answer:

3 gallons of water

Step-by-step explanation:

1 gallon = 8 pints

24 pints of water (bottles) divided by 8 would be 3

therefore 24 pints of water is equivelant to 3 gallons of water.

There are 36 math books and 9 reading books. What is the ratio of the total number of books to the number of math books? Remember to simplify your answer.

Answers

Answer:

[tex]\frac{4}{5}[/tex]

Step-by-step explanation:

so its 36+9 = 45

36/45=4/5

In a local election, 29,000 people voted. This was a decrease of 5% over the last electionHow many people in the last election? Round to the nearest whole number

Answers

Answer:

27850

Step-by-step explanation:

5% of 29,000=1450

2900-1450=27850

Brainliest pls! Help me out

Determine the value of the variable from the image below.

Answers

Answer:

x=29

Step-by-step explanation:

to understand the solving stepsyou need to know about:right angleequationPEMDASto solve:xlet's solve:

a right angle contains 90° (always)

according to the question

x+3+x-1+x+1=90

3x3=90

x=87

x=29

solved

write an equation of the line that passes through (-1, 4) and is perpendicular to the line y=-1/3x+3​

Answers

Answer:

y= 3x + 7                                                                                                            Step-by-step explanation:

y= -1/3x+3 (so, gradient of this line is -1/3).

formula: gradient of line one x gradient of line two= -1 (applies for 2 perpendicular lines only).

So, m1 x -1/3= -1

m1= ([tex]\frac{-1}{\frac{-1} {3} }[/tex])

m1= 3 (gradient of perp line)

y=mx+c

4= 3 x -1 + c

7=c

therefore, y=3x+7 (eqn of the line perp to y=-1/3x+3)

Plz help me solve this

R=200(0.011)/1.011^-1

Thank you

Answers

Answer:

R = 2.2242

Step-by-step explanation:

We can say that this is equal to (200 * 0.011) * 1.011, because (200 * 0.011)/(1/1.011) is equal to (200 * 0.011) * 1.011 (Look below for explanation). Next, we can say that 200 * 0.011 is 2.2 because you move the decimal place by 2 and then you multiply by 2 when you multiply by 2. The answer is 2.2242 because 2.2 * 0.011 is equal to 2.2242.

Whenever you have a negative exponent , it is equal to 1 over that number to that same power but positive (Ex. [tex]y^{-x} = \frac{1}{y^{x}}[/tex]).

9x – 2y = -1
2y = 3x – 5
x =?
y =?

Answers

Answer:

x-45

Step-by-step explanation:

Which of the following lists the sides of triangle DEF in order from shortest to longest? ​

Answers

Answer:
D
Step-by-step explanation:
Since Angle D is 68 degrees side EF would be the longest.
Side DF is the shortest side it is opposite the smallest angle.
Side EF is in the middle since opposite the next biggest angle.
Side EF is again the longest since Angle D is the biggest at 68 degrees.

The volume of a rectangular prism is 128 cubic yards. The base of the prism has an area of 8 square yards. What is the height of the prism?

Answers

Answer:

The height of the prism is 16 yards

Step-by-step explanation:

To get the height of the prism, we simply divide the volume of the prism by its base area

Mathematically, we have this as;

128/8 = 16 yards

Answer:

4

Step-by-step explanation:

HEY! PLEASE HELP ME WITH THIS MATH QUESTION! THE CORRECT ANSWER WILL BE MARKED AS BRAINLIEST AND I WILL ALSO FOLLOW YOU (you will also receive points) THANKS xoxo

Answers

Answer:

The width of the rectangle is 16

Step-by-step explanation:

⇒ 1024 = 4y × y

⇒ 1024 = 4y²

⇒ y² = 1024/4

⇒ y² = 256

⇒ y =

⇒ y = 16

20 points pls help.... Working alone, Ryan can dig a 10 ft. by 10 ft. hole in five hours. Castel can dig the same hole in six hours. How long would it take them if they worked together?

Answers

Answer:

2.72 hours

Step-by-step explanation:

Ryan digs 1/5 hole per hour

Castel digs 1/6 hole per hour

together they dig 1/5+1/6=11/30 holes per hour

11/30/hr divide by 11 to find out 1/30 of a hole per hour

1/30 and multiply by 30 to get a complete hole

1 hole=30/11=2.72 hours

Sorry, I can't move the boxes around

Sarah was raising money for a fundraiser. Her fundraising goal was $40. What would 50% of her fundraising goal be??

Answers

Answer:

$20

Step-by-step explanation:

50% of Fundraising goal= 0.5 x $40

                                        = $20

Francesca had 32 cups of flower she used 3/8 of the flour for a recipe . How much flour did she use ?

Answers

the answer is 12 cups i think

Francesca used 12 cups of flour for a recipe she is making.

What is a fraction?

A fraction is written in the form of p/q, where q ≠ 0.

Fractions are of two types they are proper fractions in which the numerator is smaller than the denominator and improper fractions where the numerator is greater than the denominator.

Given, Francesca had 32 cups of flowers she used 3/8 of the flour for a recipe.

So, To obtain the number of cups of flour she used we have to multiply the total number of cups of flour by the fraction of the amount she used which is,

= 32×(3/8) cups.

= 4×3 cups.

= 12 cups.

learn more about fractions here :

https://brainly.com/question/10354322

#SPJ5

Express each fraction as the sum of two or three equal fractional parts. Rewrite as a multiplication equation 6/9

Answers

Answer:

3/9 + 3/9 ; 2 * (3/9)

2/ 9 + 2/9 + 2/9 ; 3 * (2/9)

Step-by-step explanation:

Rewriting 6/9 as a sum of 2 or 3 equal fractional part :

Rewriting as a sum of 2 equal fractional parts :

6/9 ÷ 2 = (6/9 * 1/2) = 6/ 18 = 3 / 9

Rewriting as a sum :

6 / 9 = 3/9 + 3/9

As multiplication :

2 * (3/9) = 6/9

As a sum of 3 equal fractional parts :

6 / 9 ÷ 3 = (6/9 * 1/3) = 6 / 27 = 2/9

Rewriting as a sum :

6/9 = 2/ 9 + 2/9 + 2/9

Multiplication :

3 * (2/9) = 6/ 9

ñFind the slope from two points MD5
Find the slope of the line that passes through (1, 14) and (8,6).
Simplify your answer and write it as a proper fraction, improper fraction, or integer.
Submit

Answers

Answer:

The slope of line is [tex]-\frac{8}{7}[/tex].

Step-by-step explanation:

Given points are:

(1, 14) and (8, 6)

x1 = 1 and y1 = 14

x2 = 8 and y2 = 6

Slope of a line is given by formula;

[tex]m=\frac{y_2-y_1}{x_2-x_1}[/tex]

[tex]m=\frac{6-14}{8-1}\\\\m=\frac{-8}{7}[/tex]

Therefore,

The slope of line is [tex]-\frac{8}{7}[/tex].

I will give BRAINLIEST for first correct answer!!! PLEASE answer as soon as you can :)

Answers

Answer:

(x+1)(x+2)

Step-by-step explanation:

x^2 + 3x + 2

find what multiples to 2 and adds to 3

Factors of 2 are 1 and 2, 2 + 1 = 3.

so the binomial would be (x+1)(x+2)

and then you would need to do FOIL to check

First: x * x = x^2

Outer: x * 2 = 2x

Inner: x * 1 = x

Last: 1 * 2 = 2

Then simplify: x^2 + 2x + x + 2

                          x^2 + 3x + 2

I need HELP on this question!

Answers

Answer:

m = 20

Linear

Linear

Step-by-step explanation:

m is the slope and we can find the slope by using the equation [tex]\frac{y_{2}-y_{1}}{x_{2}-x_{1}}[/tex].

(45-25)/(1-0) = 20/1 = 20

Since the slope is constant throughout the whole data point (increased by 20 when x is changed by 1), we know that this is linear.

Same with option 3.

Write the equations of the lines below.

Answers

Answer:

The equation of the line is [tex]y = - \frac{1}{2} x + 1[/tex]

Step-by-step explanation:

☆Remember: [tex]slope = \frac{rise}{run} [/tex]

▪Happy To Help <3

Joey decides to empty his piggy bank and count his money. His bank is filled with only nickels and dimes. Joey counted a total of 45 coins that added up to $3.15. How many nickels and how many dimes does Joey have in his piggy bank?

Answers

Answer:

Joey has 18 nickles and 27 dimes in his piggy bank.

Step-by-step explanation:

1 nickle = 5 cents

1 dime = 10 cents

$1 = 100 cents

$3.15 = 135 cents

Let

n represent the number of nickles, n>=0

d represent the number of dimes, d>=0

Joey counted a total of 45 coins that added up to $3.15:

n + d = 45

5n + 10d = 315

n = 18 nickles

d = 27 dimes


Q. Which pair of angles add up to 180 degrees?

Answers

u can put any 2 angles that form a straight line ( example: C & B )

Answer: ya any pair of angles opposite of each other.

Step-by-step explanation:

Helppppppppppppppppp

Answers

Answer:

B

Step-by-step explanation:

You can see B has the points kind of clustered around it.

Find the image of (1,2) after a
reflection about y = x followed by a
reflection about y = -x.
([?], [])
Enter the number that belongs in
the green box.

Answers

Answer: (-1, -2)

Step-by-step explanation:

so at first you have (1, 2)

then you were asked to reflect about y=x which is (x, y) = (y, -x)

(1, 2) = (2, -1)

then followed by y=-x which is (x, y) = (-y, -x)

(2, -1) = (-1, -2)

Raymond invested $3,500 and earned $257.25 in interest over 1 3/4 years. What was the rate?

Answers

4.2% annually. 257.25 is 7.25% of 3500. Then you take 7.35 divided by 7 because is 4/4 + 3/4 = 7/4 so you take 7.35/ 7 and it comes out to 1.05 and then you multiply that by 4 quarters of a year. So the answer is 4.2% annually (yearly)

Are the lines - 6x + 3y = -9 and y + 1 = -3(x + 2) parallel,
perpendicular, or neither?

Answers

Answer:

Neither

Step-by-step explanation:

Given lines:

- 6x + 3y = -9 and y + 1 = -3(x + 2)

To determine the answer we need to compare slopes of the lines.

Parallel lines have same slopes, perpendicular lines have negative-reciprocal slopes.

Let's put them in slope-intercept form:

- 6x + 3y = -9 ⇒ -2x + y = - 3 ⇒ y = 2x - 3y + 1 = -3(x + 2) ⇒ y + 1 = -3x - 6 ⇒ y = -3x - 7

As we see the slopes are 2 and -3, so the lines are neither parallel nor perpendicular

Describe the number of solutions to a system of linear equations when the graphs of the
equations do not intersect, intersect in exactly one point, and intersect at all points.

Answers

Answer:

when the equations do not intersect they have NO solutions and are parallel

When they intersect at one point, they have ONE solution

When they intersect at all points, they have infinite solutions and are the same line/equation.

Step-by-step explanation:

A system of linear equation has no solution, only one solution, and infinite solutions when the graph of the equation do not intersect, intersect in exactly one point and intersect at all points respectively.

What is system of linear equations?

A system of linear equations is a collection of one or more linear equations involving the same variables. A system of linear  equation has

no solution when the graph do not intersect each other. only one solution when the graphs intersect at one point. infinite solutions when the graph of the equations intersect at all points.

Therefore,

From the graph we can see that " the system of linear equations has no solution, only one solution, and infinite solutions when they do not intersect, intersect in one point, and intersect at all point".

Learn more about the system of linear equations here:  

https://brainly.in/question/5130012

#SPJ2

how many millimeters are in 48 cm

Answers

Answer:

48 cm = 480 mm

Step-by-step explanation:

Answer:

The correct answer is 480 millimeters

Step-by-step explanation:

HAVE  A GOOD DAY!

The characteristics in the list below MOST relate to which cell organelle

Answers

Answer:

cell membrane is the answer

the answer is cell membrane!

Please help me ASAP!! Will give Brainliest!!

Answers

First one is the answer

Answer:

A and B are correct AKA C

Step-by-step explanation:

The total of the two shorter lengths should be more than the longest

a)20+21>22

b)8+80>80

c)4+40<50

d)3+3=6

Therefore a and b are correct

Other Questions
why was the justinian code important?A: It gave people new rights and would influence the Magna Carta and Bill of Rights.B: It was secular, meaning that it was a legal code that was not influenced by religious beliefs. C: It was completely original and did not build on previous laws of philosophy.D: It was extremely strict in order to effectively protect the empire. What is the approximate average diameter of the trees Eddie measured in the national park? What is the probability of flipping a coin 12 times and getting heads 4 times?Round your answer to the nearest tenth of a percent. BEG is a triangle ABC And DEF are parellell lines Increasingly, CEOs are building their companies brands through personal online participation, including through wide distribution of blog posts, and in this way they are allowing consumers to gain trust in the person running the business rather than an impersonal brand.a. Trueb. False The following integrals calculate areas of regions in the xy-plane. Say what shape each integral gives the area of. Be specific; for example, if the shape is a rectangle, give the base and height of the rectangle. Include a sketch of the region, showing the variable of integration, an arbitrary slice, and any other relevant quantities.a. 3xdxb. 15-y^2dyc. 81- x^2 dxd. (5- y/7)dy Identify the incorrect verb tense.Whenever we went to the store we always bought milk.We will buy soda for the trip we went on.We were going to buy chips, but we never made it to the store. Write one sentence with the words defy and unequal.And Write another sentence with entitled and outspoken.(Keep it simple and easy for brainliest) Hine was one of the first documentary photographers.Question 3 options: True False which correctly lists three planets that have rings. Read the sentence below. Identify a synonym from the following choices for the underlined word.I am committed to caring for my two dogs Max and Bruiser.a. devotedC. loyalb. dedicatedd. all of the above Can the Ed-You-Swivel chairs capture enough energy to power the school's small electronics What is the energy conversion that takes place during photosynthesis? (1 point)O chemical energy into radiant energyO radiant energy into heat energyO radiant energy into chemical energyO potential energy into kinetic energy Amber buys bottles of lemonade and a bag of cookies at the store. She pays a total of $9.50. The bag of cookies cost $3.25. If she bought 5 bottles of lemonade, how much was each bottle of lemonade?Correct answer get's brainliest helpppppp someone please What is the value of numC at the end of this loop? numC = 12 while numC > 3: numC = numC / 2 numC = Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type What type of figurative language is "a piece of my mind?" *idiomalliterationallusion what is the difference between a dependence disorder and a behavioural addiction Industries in Europe depended on the ________ that the slaves produced in the European colonies in the Americas. a. Raw materials b. Finished products c. Equipment