(7/8x - 4) -3 (1/4x+6) = How do I solve this problem?

Answers

Answer 1

Answer:

B

Step-by-step explanation:

You Do MATHS


Related Questions

Mango and her friends are running an 8 mile relay. Each friend will run 1/3 mile. How many friend will run with Mango?

Answers

Answer:

24

Step-by-step explanation:

Danny charges $36 for 3 hours of swimming lessons, Martin charges $90 for 5 hours of swimming lessons. Who offers a better deal?

Answers

Answer:

Step-by-step explanation:

36 divided by 3= 12

90 divided by 5= 18

Therefore Danny's lessons are a better deal.

Help me solve showing work

Answers

Answer:

3x + 8.75 Or 3x + ³⁵⁄₄

Explanation:

I'm going to convert all the fractions into decimals

⁻¹⁄₂x + 9.5 + x - ¾ + 2.5x

= -0.5x + 9.5 + x - 0.75 + 2.5xGroup like terms

-0.5x + x + 2.5x + 9.5 - 0.75

Add similar elements: -0.5x + x + 2.5x = 3x

= 3x + 9.5 - 0.75

Add / subtract: 9.5 - 0.75 = 8.753x + 8.75 Or 3x +³⁵⁄₄

- PNW

Describe how to transform (^6 sqrt x^5)^7 into an expression with a rational exponent. Make sure you respond with complete sentences.

Answers

Answer:

[tex]x^{\frac{36}{5} }[/tex]

Step-by-step explanation:

The transformation is as follows:

As we know that

[tex]a^{\frac{m}{n} } \rightarrow\sqrt[m]{a^{n}} \\\\\sqrt[m]{a^{n}} \rightarrow a^{\frac{m}{n} }\\\\(\sqrt[6]{x^5})^7 \rightarrow (x^{\frac{5}{6} })^7 \rightarrow x^{\frac{5^\times 7}{6} }\\\\x^{\frac{36}{5} }[/tex]

In this way it would be transformed with a rational exponent

plzzzzzzzzzzzzzzzzzzzzz help

Answers

Answer:

i think its 3/8 because if 5/8 are male the rest are female so you de 8/8 - 5/8 and you will get 3/8 but i dunno why it says about the aquariaum when the question is about how many female staff therer are

simplify the 3 problems below
(-2x + 4) + 2(2x + 1)
2(3x + 5) − 4(x − 1)
2(x − 7) + (8x + 20)

Answers

Answer:

sure

Step-by-step explanation:

(-2+4)+2(2x+1)

2x+1 answer for first one

second one is 2x +14

third is 10x+6

Marcus is sharing a bag of chips. He gives 3/5 of his chips to Ryan and 1/10 of chips to Kyle. How much of the bag has he shared?

Answers

Answer:

Marcus is sharing a He gives 3/5 o

Step-by-step explanation:

in any circle, the ratio of the _ to the radius is 2.
a. diameter
b. radius
c. circumference
d. pi
PLEASE HURRY! 15 points

Answers

Answer:

The answer should be C

Step-by-step explanation:

Consider the following sequence:

7, 11, 15, 19, 23, . . .
The common difference is ______
What is the Explicit equation for the sequence?
t(n) = ____n + ______

What is the 20th term?

Answers

Answer:

Common difference= 4, Equation; t(n)=4n+3, 20th= 83

Step-by-step explanation:

d=11-7=4

Equation

Recall, t(n)=a_1+(n-1)d

Replacing a_1 =7 and d=4

t(n)=7+(n-1)4

t(n)=7+4n-4

t(n)=4n+3

20th item

t(20)=4(20)+3=83

I hope that is helpful

Answer:

Step-by-step explanation:

This is an arithmetic progression.

It starts at 7 and keeps on adding 4.

The common difference is 4

The explicit equation is

t_n = a + (n - 1)*d

a =  7

d = 4

t_n = 7 + (n - 1)*4

t_n = 7 + 4n - 4

t_n = 4n + 3

t_20

t_20 = 4*20 + 3

t_20 = 83

Building A is 883 feet tall and contains 70 stories. Building B contains 104 stories. If the two buildings have the same number of feet per floor , approximate the height of building B

Answers

Answer:

1311.88

Step-by-step explanation:

Feet:stories

883:70

x:104

To solve this we need to multiply 883 by 1.48 because this is what we multiplied 70 to get to 104

x=1311.88=1312

2) Key components of financial planning include all of the following except:
A) Write out a detailed plan for accomplishing your goals
B) Replace money myths with money truths
C) Allow your financial planner to make all of your major money decisions
D) Regularly monitor and reassess your financial plan

Answers

Answer:

b

Step-by-step explanation:

i took the test pls mark me the brainliast

8y – 3(y – 2) >2y + 4(2y + 4)

Answers

Answer:

y<-2

Step-by-step explanation:

8y-3y+6>2y+8y+16

-3y-2y>16-6

-5y>10

y<-2

Answer:

y > -2

Step-by-step explanation:

Please look at the attachment:

7321694 is divisible by???????? PLEASE HELP

Answers

Answer:

2 and 3660847 are the only prime factors. Therefore, the number 7321694 is divisible by itself, by 2, by 366-0847 (which is a prime number) , or by the unity.

Step-by-step explanation:

2 and 3660847 are the only prime factors of this number. Therefore, the number 7321694 is divisible by itself, by 2, by 366-0847 (which is a prime number) , or by the unity.

Sarah mixes ⅓ cup of sugar with ½ cup of cream cheese to make a topping for cupcakes. Sarah uses 3/12 cup of the mixture to top each cupcake. How many cupcakes can Sarah top?

Answers

Answer:

thanks for the points

Step-by-step explanation:


Fayyaz bought a mobile phone for £180
He sold it at a profit of 15%

How much money did Fayyaz sell the mobile phone for?

Answers

Answer:

207

Step-by-step explanation:

180+0.15*180=207

Step-by-step explanation:

profit amount =15×£180/100

=£27

Fayyaz sell the mobile phone for=180+27=207

1. The perimeter of a sector of a circle of radius r is 8 metres.
(i) Express θ in terms of r, where is the angle of the sector
in radians, as shown.

Answers

Answer:

Step-by-step explanation:

s and r are the arc length and radius, respectively.

perimeter of sector = s+2r = 8

s = 8-2r

θ = s/r = (8-2r)/r

Nathan nets $680 every other week. How much does
Nathan earn per month on average? To be safe, how much
should Nathan estimate as income in a typical month?
A. Average: $1473.33: Safe: $1360
B. Average: $2946.67; Safe: $1360
C. Average: $2946.67; Safe: $1473.33
D. Average: $2946.67; Safe: $2720

Answers

B. Average $2946.67; Safe $1360

This is because if you multiply $680 x 4( a month) = $2720 which is close to $2946
You now divide 2720/2 yup get $1360

can I get some help with changing the decimal 1.5 to a fraction please​

Answers

Answer:

I do believe that 1.5 as a fraction is 3/2 or 1 and 1/2

Step-by-step explanation:

Hope this helps you:)

Answer:

1 ½ or 3/2

Step-by-step explanation:

Decimals can be written in fraction form. To convert a decimal to a fraction, place the decimal number over its place value. For example, in 0.6, the six is in the tenths place, so we place 6 over 10 to create the equivalent fraction, 6/10. If needed, simplify the fraction. - Khan Academy

Hope this helps :D

1. A field in the form of a parallelogram has one
diagonal of 42 m long and the perpendicular
distance of this diagonal from either of the
outlying vertices is 10 m as shown in the figure.
Find the area of the field.​

Answers

Answer:

420m²

Step-by-step explanation:

Given that:

Length of diagonal = 42m

Lenght of outlying vertice = 10 m

Area of paralellogram = 2 " (area of triangle)

Area of triangle = 1/2 * base * height

Hence,

Area of parallelogram :

Area = 2(0.5 * 42 * 10)

Area = 2 (210)

Area = 420m²

please help me on this​

Answers

The point slope form should be y - 4 = -2 • (x-1). Hope this helps.

In the right triangle, if a = 3 and b = 6, what is the value of c?

a 3 times the square root of 5
b 9
c 9 times the square root of 5
d 45

Answers

Answer:

A

Step-by-step explanation:

Using the pythagorean theorem, [tex]a^{2} +b^{2} =c^{2}[/tex]

we plug the numbers in; [tex]3^{2} + 6^{2} =c^{2}[/tex]

9+36=c^2

45=c^2

sqr root of 45 is [tex]\sqrt{45}[/tex]

next find the positive perfect sqr root of 45 which will be 9.

9 goes into 45 5 times so it will be [tex]\sqrt{9x5}[/tex]

Sqr root of 9 is 3 so it will be [tex]3 \sqrt{5}[/tex]

A I had took the quiz

Using the given diagram, solve for x.
x=

Answers

Step-by-step explanation:

since the whole biggest triangle is a right triangle so ,

[tex] {x}^{2} = {20}^{2} + {18}^{2} \\ {x}^{2} = 400 + 324 \\ {x}^{2} = 724 \\ x = \sqrt{724} = 26.907 = 26.91[/tex]

i really really need help with all of these you don't have to show your work but please help me with at least some or all of them pls i'm giving 50 points!!!!!

Answers

Answer:

Step-by-step explanation:

1. 24+9/2pi, 2. 51 3. 86. 4. 90 5. 56, all of these are done with the addition or subtraction of simple geometric formulas such as those for a rectangle,circle or triangle.

Answer:

Step-by-step explanation:

1. Rectangle + Semi-Circle

[tex]A = a*b + \frac{\pi r^{2}}{2}\\a=6, b=4, r=\frac{a}{2} = 3\\A = 24 + 4.5 \pi = 38.14 in^{2}\\[/tex]

2. Large Rectangle - Small Rectangle

[tex]A = 15 * 5 - 6*3 = 75 - 18 = 57 in^{2}\\[/tex]

3. Rectangle - Trapezoid

[tex]A = a * b - \frac{c+d}{2}h = 20*17 - 6 * \frac{6+12}{2} = 340 - 54 = 286 cm^{2}\\[/tex]

4. The composite figure is a rectangle if the triangle is moved to left and fills the missing part

[tex]A = a * b = 10 * 9 = 90 m^{2}\\[/tex]

5. Square - Triangle

A = [tex]A = a^{2} - \frac{b^{2}}{2} = 8 * 8 - \frac{4 * 4}{2} = 64 - 8 = 56 cm^{2}\\[/tex]

6. Circle - Square

[tex]A = \pi r^{2} - a^{2} = 64 \pi - 12 * 12 = 64 \pi - 144 = 57.06 m^{2}[/tex]

7. Square - Triangle

[tex]A = a^{2} - \frac{b*h}{2} = 15 * 15 - \frac{10 * 8}{2} = 225 - 40 = 185 sq.ft.[/tex]

8. Rectangle + Triangle

[tex]A = a *b + \frac{a*h}{2} = 9.5 * 9 + \frac{9.5*12}{2} = 85.5 + 57 = 142.5 in^{2}\\[/tex]

9. Triangle + Rectangle

[tex]A = \frac{a*b}{2} + c * d = \frac{12*10}{2} + 12 * 6 = 60 + 72 = 132 sq.ft.[/tex]

10. Rectangle + Quarter Circle

[tex]A = r * b + \frac{\pi r^{2}}{4} = 6 * 8 + \frac{36 \pi}{4} = 48 + 9 \pi = 76.27 in^{2}\\[/tex]

11. Square + Rectangle

[tex]A = a^{2} + b * c = 7 * 7 + 9 * 14 = 49 + 126 = 175 m^{2}[/tex]

12. Rectangle - 2 * Square

[tex]A = a * b - 2 * c^{2} = 25 * 18 - 2 * 8 * 8 = 450 - 128 = 322 sq.ft.[/tex]

13. Trapezoid

[tex]A = \frac{a+b}{2} * h = \frac{10+15}{2} * 15 = 12.5 * 15 = 187.5 sq.ft.[/tex]

14. Trapezoid - Rectangle

[tex]A = a * h - c * d = 12 * 7 - 9 * 5 = 84 - 45 = 39 in^{2}[/tex]

15. Rectangle - Triangle

[tex]A = a * b - \frac{a * b}{2} = \frac{a*b}{2} = \frac{10 * 20}{2} = 100 in^{2}[/tex]

16. Square + Trapezoid

[tex]A = a^{2} + \frac{a + b}{2} * h = 25 + \frac{5 + 9.5}{2} * 6 = 25 + 43.5 = 68.5 in^{2}[/tex]

Diego lives 1/2 from school. What is 50% of 1/2 mile?

Answers

Answer:

1/4 or .25

Step-by-step explanation:

1/4 or 0.25

1/2 divided by 2 since 50% is half = 1/4 then when you turn 1/4 into a mixed whole number it is 0.25

Which graph represents the solution set of the system of inequalities? {y≥13x−3y<−3x−3

Answers

Answer:

see below

Step-by-step explanation:

Write the following statement in if-then form
Two opposite rays form a straight line.

Which of the following is the hypothesis?
if two rays are opposite
if a straight line is formed
Othen rays are opposite

Answers

The second part I think, The options are written unclear tho

Caleb wants to buy a package of Skittles. Which is the better value?

A. 8 oz. for $1.60

B. 10 oz. for $1.80

C. 12 oz. for $2.04

D. 15 oz. for $3.50

Answers

Answer:

I think 8 oz. of skittles is better cause it's the same as 10 oz but 8 oz is cheaper

please help. i’ll give brainliest to the correct answer


which number line models the sum of 8 + (-12)

Answers

The answer should be D

Prove: The difference of the cubes of two
successive integers is odd.
(n + 1)3-n3 = [ ? ]n2 + [ ]n + 1
= [ ](n + 1) + 1
= 6m + 1 (since n or n+1 is even)
= odd

Answers

(n + 1)³ - n³ = (n³ + 3n² + 3n + 1) - n³

… = 3n² + 3n + 1

… = 3n (n + 1) + 1

… = 6m + 1

where m is another integer. We can say this because, as the second-to-last step says, either n or n + 1 is even, which makes their product also even, so we can write it as a multiple of 2:

n (n + 1) = 2m

Then 6m is even, and adding 1 to it makes it odd.

Write an equation of the line that passes through the points (0,4) and (2,10).

Answers

Answer:

y = 3x+4

Step-by-step explanation:

Use the coordinates of the points to find the slope of the line passing through them.

slope = Δy/Δx = (10-4)/(2-0) = 6/2 = 3

Point-slope equation for line of slope 3 that passes through (0,4):

y-4 = 3(x-0)

Slope-intercept form of the equation:

y = 3x+4

Other Questions
Can the Ed-You-Swivel chairs capture enough energy to power the school's small electronics What is the energy conversion that takes place during photosynthesis? (1 point)O chemical energy into radiant energyO radiant energy into heat energyO radiant energy into chemical energyO potential energy into kinetic energy Amber buys bottles of lemonade and a bag of cookies at the store. She pays a total of $9.50. The bag of cookies cost $3.25. If she bought 5 bottles of lemonade, how much was each bottle of lemonade?Correct answer get's brainliest helpppppp someone please What is the value of numC at the end of this loop? numC = 12 while numC > 3: numC = numC / 2 numC = Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type What type of figurative language is "a piece of my mind?" *idiomalliterationallusion what is the difference between a dependence disorder and a behavioural addiction Industries in Europe depended on the ________ that the slaves produced in the European colonies in the Americas. a. Raw materials b. Finished products c. Equipment y=2x-4 graph the line for the given problem PLS HELP WILL GIVE BRAINLIESTThe distance, y, in miles, traveled by a car for a certain amount of time, x, in hours, is shown in the graph below: A graph titled Motion of a Car is shown with Time in hours labeled on x-axis and Distance from Starting Point in miles labeled on y-axis. The scale on the x-axis shows the numbers 1, 2, 3, 4, 5, 6, and the scale on the y-axis shows the numbers 0, 13, 26, 39, 52, 65, 78. There are three straight lines in the graph. The first line joins ordered pair 0, 0 with 2, 26. The second straight line joins 2, 26 and 3,26 and the third straight line joins ordered pair 3,26 with the ordered pair 5,52. Which of the following best describes the motion of the car shown? (1 point) It travels for 2 hours, then stops for 3 hours, and finally travels again for 2 hours. It travels for 2 hours, then stops for 3 hours, and finally travels again for 5 hours. It travels for 2 hours, then stops for 1 hour, and finally travels again for 5 hours. It travels for 2 hours, then stops for 1 hour, and finally travels again for 2 hours. A recipe for pancake batter uses 2 cups of flour and makes 10 small pancakes. How many cups of flour are needed to make batter for 25 small pancakes? *A3 B4 C5 D6 Write the equation for a line that passes through the point (-8,2) and is parallel to 5x-4y=4. Enter your equation in slope intercept form with slope written as a fraction What is the most reasonable explanation for the defeat of the Treaty of Versailles?The U.S. Senate was concerned the U.S. was giving up too much of its constitutional power and could be drawn into another war.The U.S. Senate felt the treaty was clearly unfair to Germany and her allies and did not treat all nations involved equally.Since Republicans dominated the Senate, and President Wilson was a Democrat, this group refused to support anything the President proposed.Many senators believed the United States did not enter World War I soon enough and they helped defeat the treaty because only Congress can de A harsh drought killed some of the farm familys corn and several of its cattle. Where on the production possibilities curve could you position a point to reflect theses circumstances a circle with a 12 inch diameter is folded in half and then folded in half again to create a quarter circle. what is the perimeter of this shape? HELP ME PLEASE what does the term "august" most closely mean as it is used in paragraph 2? 12. Janelle is using a globe to model the seasons. If the northern hemisphere istilted TOWARDS the Sun, what season is occurring in Texas?A. SummerB. FallC. WinterD. Spring All living things are made of cells. What are cells made of?A)Organs. B)Tissues. C)Compounds. D)Organ System Which of the following structures will not be found in the nucleus of a cell?A. DNAB. NucleolusC. LysosomeD. Centriole