April is arranging place cards for a wedding reception on a table. The bride's family has 154 cards and the groom's family has 140 cards. She wants the arrangements for the two families to have the same number of cards in each row. What is the greatest number of cards that she can place in a row?

Answers

Answer 1

The greatest number of cards that April can place in a row , so that the two families have same number of cards in each row is  14.

In the question ;

it is given that

number of card that Bride's family has = 154

number of cards that Groom's family has = 140 cards.

So , to find the greatest number of cards that April can place in a row we need to find the GCF(154,140) ,

to find the GCF (154,140)

prime factorization of 154 = 2*7*11

prime factorization of 140 = 2*2*5*7

common factors = 2*7

Hence the GCF(154,140) = 14

Therefore , the greatest number of cards that April can place in a row , so that the two families have same number of cards in each row is  14.

Learn more about Greatest Common Factor here

https://brainly.com/question/11444998

#SPJ1


Related Questions

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Answers

Answer:

Explanation:

Note that:

[tex]\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}[/tex]

Applying the addition formula given above to cos 150:

[tex]\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}[/tex]

An exterior angle of a rectangle polygon cannot have the measure

Answers

The sum of the measures of an exterior angle of a polygon is 360°.

If the given angle divides 360 evenly, then it can be a measure of an exterior angle of a polygon. If otherwise, then it cannot be.

[tex]\begin{gathered} 360\div30=12 \\ 360\div50=7.2 \\ 360\div120=3 \\ 360\div90=4 \\ 360\div40=9 \end{gathered}[/tex]

Out of the given angles, only 50 does not divide 360 evenly. Therefore, a regular polygon cannot have an exterior angle measuring 50°. (Option B)

a company buys equal numbers of two different card forms. it utilizes 4/5 of one kind and 6/7 of the other. what fraction of the total number is unused?

Answers

12/35 fraction of the total number is unused from two different cards.

What is a fraction?

A fraction is written in the form of p/q, where q ≠ 0.

Fractions are of two types they are proper fractions in which the numerator is smaller than the denominator and improper fractions where the numerator is greater than the denominator.

Assuming the total first kind of card form is 1 and the total second kind of card form is also one.

Given, a company buys equal numbers of two different card forms. it utilizes 4/5 of one kind and 6/7 of the other.

∴ The total unused card form is,

= (1 + 1) - (4/5 + 6/7).

= 2 - (28 + 30)/35.

= 2 - 58/35.

= (70 - 58)/35.

= 12/35.

learn more about fractions here :

https://brainly.com/question/10354322

#SPJ1

Which graph represents data used in a linear regression that produces a correlation coefficient closest to -1?

Answers

What does the letter "L" stand for in the simulation?

Answer: d

Step-by-step explanation: ion know man but i looked it up and got it right

Orlando is getting balloons for his grandmother's birthday party. he wants each balloon string to be 6 feet long. at the party store, string is sold by the yard. if orlando wants to get 72 balloons, how many yards of string will he need?

Answers

144 yards of string will need to use balloons for the party.

Given,

The length of balloon string Orlando wanted = 6 feet

Number of balloons = 72

We have to find the total length of strings wanted for 72 balloons in yards.

1 yard = 3 feet

Now,

Total length of strings Orlando needs = length of one string x number of balloons = 6 x 72 = 432 feet

Now convert 432 feet into yard

That is,

432 / 3 = 144 yards

So,

144 yards of string will need to use balloons for the party.

Learn more about length of string here;

https://brainly.com/question/19297704

#SPJ1

just tell me the slope of the line and where to plot the segments on the graph

Answers

Answer:

The slope is 2

Step-by-step explanation:

Take any two points on the line.  I am going to use the points (0,-8) and (4,0)  Points are in the form (x,y)  The y values form the two points is 0 and -8.  The x values are 4 and 0.

The slope is the change in y over the change in x.

[tex]\frac{0- -8}{4-0}[/tex] = [tex]\frac{8}{4}[/tex] = 2

a builder appoints three construction workers akash, sunil and rakesh on one of his sites. they take 20, 30 and 60 days respectively to do a piece of work. how many days will it take akash to complete the entire work if he is assisted by sunil and rakesh every third day?

Answers

It will take 15 days for Akash to complete the entire work if he is assisted by Sunil and Rakesh every third day.

To determine the number of days, we first represent the number of days to do a piece of work by each one of them in fractions as follows;

Fraction of work completed by Akash in 1 day = 1/20

Fraction of work completed by Sunil in 1 day = 1/30

Fraction of work completed by Rakesh in 1 day = 1/60

The total work done in 1 day can be given as;

Total work done by the three in one day = [(1/20) + (1/30) + (1/60)] = 1/10

Work done by Akash in two days = 2 × (1/20) = 2/20 = 1/10

The work done in three days (1 day of all three together + Work done by Akash in two days) = (1/10) + (1/10) = 1/5

Therefore; the total work done in 3 days = 1/5

At this rate, the total number of cycles required to finish the work =

(1) ÷ (1/5) = 5

Since each cycle has three days, the total number of days required to finish the work can be calculated as follows;

5 × 3 = 15 days

To learn more about fractions; click here:

https://brainly.com/question/17220365

#SPJ4

Look at this diagram:If KM and NP are parallel lines and m

Answers

Answer

Angle NOL = 70°

Explanation

Alternate angles are angles that are in opposite positions relative to a transversal intersecting two lines. If the two lines are parallel to each other, then alternate angles are equal.

We can see that Angle MLO and Angle NOL are alternate angles.

And since we have been told that KM and NP are parallel lines,

Angle NOL = Angle MLO = 70°

Hope this Helps!!!

find the value of x in each case

Answers

Answer:

x=23

Step-by-step explanation:

The amount of degrees in a triangle is 180 degrees.

line AC and line DF are straight angles meaning that the opposite angles are equal to each other. That means that angle FBC is also equal to x. Because line AC and EF are parallel we know that FBC and BFE are equal. Therefore, BFE is equal to x. The sum of the values of each angle of the triangle should add up to 180. 5x+65=180

5x=115

x=23

Divide. Enter the correct answer.
17+2=

Answers

17 divided by 2= 8.5

what is the distance between the two points in simplest radical form
(−2,−7) and (5,0)

Answers

The distance between the two points in simplest radical form(−2,−7) and (5,0) is 9.8995

What is the distance?

Distance can be described as the differences that exist between two points and this can be expressed i different form such as the radical form.

We can calculate the distance between the two points by firstly expressed them as :

(−2) - (5) = -7

(-7) - 0 = -7

Then the distance between them can be found as :

Distance = (-7)^2 + (-7)^2 = 49 +49 = 98

Then we will find the square root of the the figure as

= [tex]\sqrt{98}[/tex] = 9.8995

The formula can as well be used to find this by substituting the values of x and y into the formula as :

x1=-2

y1=-7

x2=5

y2=0

[tex]d = \sqrt{ ( x_{2} - x_{1} )^{2} + ( y_{2} - y_{1} )^{2}}[/tex]

then [tex]d = \sqrt{ ( 5 - (-2 )^{2} + ( 0 - (-7) )^{2}}[/tex]

= [tex]\sqrt{ 49^{2} + 49^{2} }[/tex]

= [tex]\sqrt{98}[/tex]

=9.8995

Read more about  distance at:

https://brainly.com/question/20694000

#SPJ1

What is the slope that passes through these points?

(0, -4) and (-5, -5)

Answers

Answer:  m=1/5

Step-by-step explanation:

Using the information found in these tables which of the following statements is true


Please helpppp

Answers

The first one is correct because the age/grade is independent and screen time: games is dependent on the independent

x/5 > 8 solve the inequality for x and simplify your answer as much as possible

Answers

Answer:

x = 40

Step-by-step explanation:

x = 8 x 5

x = 40

that's it

893 is 94% of what amount

Answers

4,700 is correct for this question

Which equations are true for x = –2 and x = 2? Select two options x2 – 4 = 0 x2 = –4 3x2 + 12 = 0 4x2 = 16 2(x – 2)2 = 0

Answers

The two equations that are true when x = -2 and x = 2 are x^2 - 4 = 0 and 4x^2 = 16.

We have given x = 2 and x = -2

Substitute the values in the given equations

Equation 1

x^2 - 4 = 0

Substitute x = 2 in LHS, we get

2^2-4 = 4 - 4 = 0 = RHS

Substitute x = -2 in LHS, we get

(-2)^2-4 = 4 - 4 = 0 = RHS

Equation 2

x^2 = -4

Substitute x = 2 in LHS, we get

2^2 = 4 ≠ RHS

Substitute x = -2 in LHS, we get

(-2)^2 = 4 ≠ RHS

Equation 3

3x^2 + 12 = 0

Substitute x = 2 in LHS, we get

3(2)^2 + 12 = 12 + 12 = 24 ≠ RHS

Substitute x = -2 in LHS, we get

3(-2)^2 + 12 = 12 + 12 = 24 ≠ RHS

Equation 4

4x^2 = 16

Substitute x = 2 in LHS, we get

4(2)^2 = 4(4) = 16 = RHS

Substitute x = -2 in LHS, we get

4(-2)^2 = 4(4) = 16 = RHS

Equation 5

2(x-2)2 = 0

Substitute x = 2 in LHS, we get

2(2-2)2 = 2(0)(2) = 0 = RHS

Substitute x = -2 in LHS, we get

2(-2-2)2 = 2(-4)(2) = 16

Hence, we find that Equation 1 and Equation 2 are true for x = 2 and x = -2

To learn more about equation here

https://brainly.com/question/15707224

#SPJ1

Marques works in a department store selling clothing. He makes a guaranteed salary of $200 per week, but is paid a commision on top of his base salary equal to 10% of his total sales for the week. How much would Marques make in a week in which he made $750 in sales? How much would Marques make in a week if he made x dollars in sales?

Answers

The most appropriate choice for percentage will be given by -

Total salary of Marques in a week = $825

If Marques makes $x in sales, his total salary in a week = $([tex]750 + \frac{x}{10}[/tex])

What is Percentage?

Suppose there is a number and that number has to be expressed as a fraction of 100. The fraction is called percentage. For example 2% means [tex]\frac{2}{100}[/tex]

Here,

Guarantee salary of Marques = $200

Sales made by Marques in a week= $750

Percentage commission on total sales = 10 %

Commission received by Marques = [tex]\frac{10}{100} \times 750\\[/tex]

                                                          = $75

Total salary of Marques in a week = $(750 + 75)

                                                         = $825

If Marques makes $x in sales, his total salary in a week = $([tex]750 + \frac{10}{100}\times x[/tex])

                                                                                            = $([tex]750[/tex] + [tex]\frac{x}{10}[/tex])

To learn more about percentage, refer to the link -

https://brainly.com/question/24304697

#SPJ9

HELP! WILL GIVE BRAINLIEST

Answers

Answer:

second answer

Step-by-step explanation:

Second answer is the answer

Write a linear equation to represent the given problem and then solve the problem.

The perimeter of a rectangle is 150 cm. The length is 15 cm greater than the width. Find the dimensions.

Perimeter = 2 x Length + 2 x Width

Answers

w=L+15

p=(L+w)

150cm=L+L+15

150cm=2L+15

2L=150cm-15

2L=135cm

2L÷2=135cm÷2

L=67.5

w=67.5+15

w=82.5

Which of the following rational functions is graphed below?

Answers

The correct answer is b because the coordinates are the complete opposite making it a obtuse graph

For a particular rectangle, twice the width is 4 meters shorter than the length. The area of the rectangle is 126 square meters. What is the perimeter of the rectangle? ? meters

Answers

Let l be the length of the rectangle and w its width.

Then its area is given by:

a = l*w

Its perimeter is given by:

p = 2l + 2w

We also know that, for this specific triangle, we have:

2w = l - 4

l = 2w + 4

a = 126 m²

Applying this result in the area formula, we have:

w*l = 126

w(2w + 4) = 126

2w² +4w = 126

2w + 4w - 126 = 0

Therefore, w = 7 m and l = 2*7 + 4 = 10 m

Then, the perimeter is given by:

p = 2*18 + 2*7 = 36 + 14 = 50 m

For the function f(x)= x^2+4x-1, what is the range of f (x) for the domain {-2,0,1}?

Answers

The range of the given function is {-5,-1,4} which is the B option.

Given function:-

[tex]f(x) = x^2+4x-1[/tex]

Domain = {-2,0,1}

We have to find the range of the given function for the given domain.

Putting x = -2 in the given function, we get,

[tex]f(-2) = (-2)^2+4(-2)-1[/tex]

f(-2) = 4 - 8 - 1 = -5

Putting x = 0 in the given function, we get,

[tex]f(0) = (0)^2+4(0)-1[/tex]

f(0) = 0 + 0 -1 = -1

Putting x = 1 in the given function, we get,

[tex]f(1) = (1)^2+4(1)-1[/tex]

f(1) = 1 + 4 - 1 = 4

Hence, the range of the given function is {-5,-1,4}.

To learn more about range, here:-

https://brainly.com/question/28135761

#SPJ1

The dot plot shows predictions for the winning time in the​ 200-meter sprint. The winner finished the race in 22.3 seconds. What is the greatest percent error among the​ predictions?

Answers

2.69%, is the required maximum percent error among the predictions.

Given,

The predicted winning time in 200 meter sprint shows in the dot plot

The winner finished the race in 22.3 seconds

We have to find the greatest percent error among the predictions;

Here,

The actual time to complete is 22.3 seconds.

22.9 seconds is the prediction that is the most off.

The difference is, 22.9 - 22.3 = 0.6 seconds

To obtain a prediction, divide this by the actual time value.

= 0.6/22.3 = 0.0269 = 2.69

Therefore, 2.69%, is the required maximum percent error among the predictions.

Learn more about predictions here;

https://brainly.com/question/14946661

#SPJ1

Given f(x)=2x-5, describe how the graph of g compares with the graph of f.
g(x)=2(0.2x)-5

Answers

The graph of g and f have equal intercepts while the slope of the graph of f is 5 times larger than the slope of the graph of g

How to compare the graph of g with the graph of f

Given: f(x) = 2x-5 and g(x)=2(0.2x)-5

To compare the two graphs, we can make use of the equation of a line:

The general form of the equation of a line is y = mx + c

Where m is the slope and c is the intercept

So we will compare two the functions with the equation of a line:

Comparing f(x) = (2x-5) with y = mx + c

The slope(m) of the line = 2 and the intercept(c) = -5

Also, comparing g(x) = 2(0.2x)-5 with y = mx + c

The slope(m) of the line = 2(0.2) = 0.4 and the intercept(c) = -5

Since the slope of f(x) = 2 and the slope of g(x) = 0.4. Thus:

slope of f(x) / slope of g(x)  = 2/0.4 = 5

So we can say the slope of  f(x) is  5 times the slope of g(x)

Therefore, the graph of g and f have the same intercept. But the slope of f(x) is  5 times the slope of g(x)

Learn more about equation of a line on:

brainly.com/question/28722124

#SPJ1

Mason went to the grocery store and bought bottles of soda and bottles of juice. Each bottle of soda has 45 grams of sugar and each bottle of juice has 15 grams of sugar. Mason purchased a total of 11 bottles of juice and soda which collectively contain 285 grams of sugar. Write a system of equations that could be used to determine the number of bottles of soda purchased and the number of bottles of juice purchased. Define the variables that you use to write the system

Answers

The number of soda bottles = 4

The number of sugar bottles = 7

What is an expression?

Mathematical expression is defined as the collection of the numbers variables and functions by using operations like addition, subtraction, multiplication, and division.

Given that;

Weight of each bottle of soda = 45 grams

Weight of each bottle of sugar = 15 grams

Total weight of sugar and soda = 285 grams

Let the number of soda bottle = x

And, The number of sugar bottle = y

Since, Total number of bottles = 11

So, We can formulate;

⇒ x + y = 11    .... (i)

And, Weight of each bottle of soda = 45 grams

Weight of each bottle of sugar = 15 grams

Total weight of sugar and soda = 285 grams

So, We can formulate;

⇒ 45x + 15y = 285   ... (ii)

Multiply by 15 in equation (i) and subtract from (ii), we get;

⇒ 45x + 15y - 15x - 15y = 285 - 165

⇒ 30x = 120

Divide by 30;

⇒ x = 4

Hence,  x + y = 11    

4 + y = 11

y = 11 - 4

y = 7

So, The number of soda bottles = 4

The number of sugar bottles = 7.

Learn more about the linear expression visit:

https://brainly.com/question/4074386

#SPJ1

why is sampling with replacement used? to ensure that the sample size is as small as possible to ensure that individuals cannot be selected twice to ensure that the proportions of subgroups in the sample are exactly the same as their proportions in the population to ensure that the probability of selecting any specific individual stays constant

Answers

To determine  probability with replacement, It uses sampling with replacement. In other words, you want to determine the likelihood of an event in which you choose a ball, card, or other object from a set of options and then swap it out after each choice.

Example:

Consider a scenario in which you wished to sample two people from a population of seven.

Those people are:

John, Jack ,Qiu, Tina, Hatty, Jacques, Des

Their names could be placed in a hat. If you sample with replacement, you would pick one name, put it back in the hat, and then pick a different name. Your two-name sample has the following potential outcomes:

John, John

John, Jack

John, Qui

Jack, Qui

Jack Tina

…and so on.

The two products you sample with replacement are independent. In other words, the outcome of one has no bearing on the other. The odds of picking the first name are 1/7, and the odds of picking the second name are 1/7.

P(John, John) = (1/7) * (1/7) = .02.

P(John, Jack) = (1/7) * (1/7) = .02.

P(John, Qui) = (1/7) * (1/7) = .02.

P(Jack, Qui) = (1/7) * (1/7) = .02.

P(Jack Tina) = (1/7) * (1/7) = .02.

To learn more about probability click here:

brainly.com/question/14210034

#SPJ4

Given v = 60sinθ, what is the instantaneous voltage when θ = 30⁰?Question 11 options:6034.643051.96

Answers

Answer:

30

Explanations:

Given the expression for the instantaneous voltage expressed as:

[tex]v=60\sin \theta[/tex]

Given the following parameter:

θ = 30⁰

Substitute the given parameter into the formula to have:

[tex]\begin{gathered} v=60\sin 30^0 \\ v=60(0.5) \\ v=30 \end{gathered}[/tex]

Therefore the instantaneous voltage when θ = 30⁰ is 30.

Fun times Amusement Park Charges a $7 admission fee plus $1.75 per ride. What is the equation, in intercept form for calculating the total cost, C, of going to the park and riding r rides?1. C = 1.75 + 7r2. C = 1.75r3. C = 7r4. C = 7 + 1.75r

Answers

The general form of an equation in intercetp form is:

[tex]y=mx+b[/tex]

Where m is the change of y in function of x and b is the value of b when x is 0

In this situation you have:

y=C

x=r

m= 1.75 ( C increase 1.75 each r)

b= 7 (When there is not ride r=0 the admission fee is 7)

Then, you have the equation:[tex]C=1.75r+7[/tex]or C = 7 + 1.75r

What is the simple interest rate on an account that earned $56.25 in interest after two and one-half years on a principal balance of $300? please show work

Answers

The rate of interest on the given principal is 7.5%.

Given that, simple interest = $56.25, principal = $300 and time period = [tex]2\frac{1}{2}[/tex] years.

What is the simple interest?

Simple interest is a method to calculate the amount of interest charged on a sum at a given rate and for a given period of time.

Simple interest is calculated with the following formula: S.I. = P × R × T, where P = Principal, R = Rate of Interest in % per annum, and T = Time, usually calculated as the number of years.

Now, 56.26 = (300 × R × 2.5)/100

⇒ 5625 = 750R

⇒ R = 7.5%

Therefore, the rate of interest on the given principal is 7.5%.

To learn more about the simple interest visit:

https://brainly.com/question/25845758.

#SPJ1

Find the slope of the line.
slope =
11
rise
run
5
11
40
30
20
10
O
2
4
6
8
G
G

Answers

to get the slope of any straight line, we simply need two points off of it, let's use the ones from the picture below.

[tex](\stackrel{x_1}{0}~,~\stackrel{y_1}{0})\qquad (\stackrel{x_2}{5}~,~\stackrel{y_2}{20}) ~\hfill \stackrel{slope}{m}\implies \cfrac{\stackrel{rise} {\stackrel{y_2}{20}-\stackrel{y1}{0}}}{\underset{run} {\underset{x_2}{5}-\underset{x_1}{0}}} \implies \cfrac{ 20 }{ 5 } \implies \text{\LARGE 4}[/tex]

Other Questions
cos(alpha + beta) = cos^2 alpha - sin^2 beta Instructions: Fill in the table of values for the exponential function. Insert all answers as fractions, when applicable. One of the major motivations for altering the environment in Mexico City was __________. 7+[9(9x1 to the second power)] The polarity of the covalent bond between two given atoms is determined/estimated byGroup of answer choicesOctet RuleElectronegativity differencesNumber of bonds between the atomsSolubility Brenda purchased a jewelry-making kit to make gifts for her friends. The kit includes material to make 68 bracelets. Brenda completed 17 bracelets. Write and solve an equation to show how many more bracelets she can make from the kit. Calculate the frequency of light that has a wavelength of 16.23 * 10^-9 m. . why do some microbiologists prefer to open and close quickly the culture tube instead of flaming its mouth prior and after transferring bacteria to or from it? multiple choice 3 because it reduces the amount of heat entering the tube because it is more likely to prevent contamination because it prevents spills more effectively because it eliminates the necessity of an open flame A chemist is using 363 milliliters of a solution of acid and water. If 13.6% of the solution is acid, how many milliliters of acid are there? Round your answer to the nearest tenth. Hello, can you please help me solve this question ASAP!!! 2) Katie and Jacob are enlarging pictures in a school yearbook on the copy machine. The ratio of the width to the length of the enlarged photo will be the same as the ratio of the width to the length of the original photo. 25 points One of the photographs that they want to enlarge is a 3" x 4"photo. katie says that she can enlarge the photo to a 9" x 12", but Jacob disagrees. He says it will be 11" x 12". Who is correct? Explain your reasoning in words. * Enlarged Photo Original Photo 3 inches 4 inches What impact did cargo ship refrigeration systems have on the banana industry? Refrigeration slows the rate at which food is being spoiled, refrigeration does not affect speed at which the ship moves, refrigeration does not cause ripening, refrigeration does not control the sugar content of bananas? Solve for x using the quadratic formula.3x^2 +10x+8=3 Hi, I need help on 21 please provide an explanation that a kid would give so my teacher wont be SUS of me What happens when a limited partnership fails to substantially comply with all the requirements of the state statute regarding limited partnerships?. Kiran is solving 2x-3/x-1=2/x(x-1) for x, and he uses these steps.He checks his answer and finds that it isnt a solution to the original equation, so he writes no solutions. Unfortunately, Kiran made a mistake while solving. Find his error and calculate the actual solution(s). Explain how to determine the total number of elements in a chemical formula Ive already done this problem, but Im being told its wrong and I need to simplify but I dont know how to do it with this question. the study of intercultural communication in order to proselytize others without their consent illustrates a(n) issue about the application of intercultural knowledge. Static or declining incomes among a large portion of the u. S. Population is an economic factor that can impact cinnabons marketing activities because