The compounds that react are labelled as reactants and are written on the left side of the arrow, while the substances created as a result of the reaction are labelled as products and are written on the right side of the arrow. The arrowhead indicates the reaction's direction.
A chemical equation is a mathematical representation of the chemical process, which shows how the reactants generate products. The reactants are written on the left side of an equation, while the products are written on the right side, as shown by one- or two-headed arrows. On the left-hand side of the equation, reactants are listed as beginning ingredients. Products are listed on the right-hand side of the equation as the final outcome of the reaction. The left-hand side of an equation is abbreviated LHS informally. The right-hand side is also referred to as RHS.
Learn more about reactants here:
https://brainly.com/question/17096236
#SPJ4
In the chemistry , The reactants are the substances on the left hand side of the reactions. The products are the substances on the right hand side of the reaction.
The chemical reaction is represented by the the chemical equation . the substances on the left side of the reaction are called as the reactants. the substances on the right side of the chemical reaction are called as the product.
A + B -----> C + D
Reactants products
The balances equation is the chemical equation where the atoms in the reactant side is equals to the atoms in the product side.
To learn more about chemical reaction here
https://brainly.com/question/17096236
#SPJ4
In which circumstance would a researcher need to first establish an operational definition in order to objectively assess its variable?
a.
researching the effects of salt on systolic blood pressure
b.
researching the effects of coffee on energy levels
c.
researching the effects of magnesium on the average number of hours of slept at night
d.
researching the effects of water on the metabolic rate
An operational definition is the statement of procedures the researcher is going to use to measure a specific variable.
Why do researchers use operational definitions of their terms?Researchers can explain in detail what they mean when they use a phrase by using an operational definition. Operational definitions are typically measurable and concrete. This method of defining variables enables others to assess the validity of the study. Operationalization is the procedure in question.
The variables you'll utilize as indicators and the methods you'll employ to observe or measure them are both included in your operational definitions. No matter how solid your conceptual definition may be, you need an operational definition since without one, you cannot measure anything.
Operational variables, also known as operationalizing definitions, describe how you'll quantify and define a particular variable when it's applied to your research. This makes it possible for a different psychologist to duplicate your findings and is crucial in establishing.
To learn more about the operational visit :
https://brainly.com/question/28446221
#SPJ1
what is it called when the mass of atoms found in nature is determined by measuring the masses of the elements combined in chemical compounds, a large number of atoms must be used to make the measurement.
Answer:
This process is called mass spectrometry. In mass spectrometry, a sample is ionized, typically by bombarding it with high-energy electrons, and the resulting ions are separated based on their mass-to-charge ratio. The mass of the ions can be measured using a mass spectrometer, and this allows the determination of the atomic masses of the elements present in the sample. To obtain accurate results, it is generally necessary to measure the masses of a large number of atoms, as the precision of the measurement increases with the number of atoms that are measured
Explanation:
Which question were the students trying
to answer?
"Why do people walk on sidewalks?"
"Why are parking lots so hot?"
"Why do people go to the park on hot days?"
"How are parking lots similar to sidewalks?"
Answer:C it is C
Explanation:
how much energy is absorbed when 2 mol ba(oh) reacts with ammonia in the reaction below
The energy that is taken in by the reaction is; 334 kJ as shown in the calculation below.
What is the enthalpy?We have to have it at the back of our minds that if we are dealing with a chemical change that can also be called a chemical reaction that we are definitely going to have cases in which the energy could be absorbed or evolved in the system.
If the energy of the system is absorbed then we can say that the system is an endothermic system and there is a gain of energy in the system and if there is a loss of energy we would see that the system would heat up.
We can use the stoichiometry of the reaction to see that the energy that has been shown here is for one mole of the reactants. When we have 2 moles of the reactants we would have;
The energy released by one mole = 167 kJ
The energy released by two moles is therefore obtained from;
2 ( 167 kJ) = 334 kJ
Learn more about enthalpy:https://brainly.com/question/13996238
#SPJ1
Answer:
324 kJ
Explanation:
162 kilajoules react with 1 mole of ba(OH)2
we have 2 moles of ba(OH)2 that we're trying to find the number of reactant kilajoules for.
162 x 2 = 324
How would Ra bond wit Bi
Answer:
Polar covalent bond
Explanation:
as Ra only has two extra electrons on another outside ring is does not take much to switch over i believe thats how it works
questions are in the picture
Answer:
A possible element with ns2np4 valence orbital is Oxygen(O)
A element that has the most electronegativity and soft is flourine(F)
for part C, it is scandium (Sc) with the last electron filled in the 3d orbital
2-methylbutan-1-ol is heated with an excess of
concentrated sulphuric acid (H2SO4) in order to cause an
elimination reaction.
i) Write an overall equation (using condensed formula) for this
elimination reaction and name the reactants and products as
part of the equation
ii) Draw the product of this reaction in displayed formula.
iii) Provide a ‘curly arrow’ mechanism (in displayed formula) for
the formation of the product supported with an explanation.
Answer:1. 2methylbutene
Explanation:
i: CH3CH2CH(CH3)CH2OH--H2SO4----------> CH3CH=C(CH3)CH3
2-methyl butane-1-ol undergoes dehydration to form alkene in presence of an excess of concentrated sulphuric acid to form2-methylbut-2-ene
ii: CH3
I
CH3CH2C=Ch2
iii: Shown in attach image
For mole details on dehydration of alcohol in excess of sulphuric acid
https://brainly.com/question/28321840
hi! im struggling with this please help!
[use the ss]
-
-
-
-
Identify which of the following nuclear decays are alpha decay, and write “alpha” on top of or next to the arrow.
The nuclear decays that are alpha decays are given below:
²³⁸₉₂U ---> ²³⁴₉₀Th²³⁴₉₂U ---> ²³⁰₉₀Th²²⁶₈₈Ra ---> ²²²₈₆Rn²²²₈₆Rn ---> ²¹⁸₈₄Po²¹⁸₈₄Po ---> ²¹⁴₈₂Pb²¹⁰₈₄Pb ---> ²⁰⁶₈₂PbWhat is alpha decay in nuclear reactions?Nuclear reactions are reactions that involve changes in the nuclear particles of an atom of an element.
A type of radioactive decay known as "alpha decay" occurs when an atomic nucleus emits an alpha particle as it changes or decays into a new atomic nucleus. Here, the freshly produced atom's atomic mass number will decrease by four, and its atomic number will decrease by two.
Learn more about alpha decay at: https://brainly.com/question/1898040
#SPJ1
If 5.0g of H2 are reacted with excess CO, how many liters of 3.0 M CH3OH solution are produced? Co(g) + 2H2(g) —> CH3OH(1)
Answer:
See attachment for graph.
The function is not continuous.
Step-by-step explanation:
Piecewise functions have multiple pieces of curves/lines where each piece corresponds to its definition over an interval.
Given piecewise function:
\begin{gathered}f(x)=\begin{cases} x-3 \;\;\;\;\: \text{if}\;\;\;x \leq -2\\4x+5 \;\;\; \text{if}\;\; \;x > -2 \end{cases}\end{gathered}
f(x)={
x−3ifx≤−2
4x+5ifx>−2
Therefore, the function has two definitions:
f(x) = x - 3 when x is less than or equal to -2.
f(x) = 4x + 5 when x is greater than -2.
When graphing piecewise functions:
Use an open circle where the value of x is not included in the interval.
Use a closed circle where the value of x is included in the interval.
Use an arrow to show that the function continues indefinitely.
First piece of the function
Substitute x = -2 into the first function:
\implies f(-2)=-2-3=-5⟹f(−2)=−2−3=−5
As the interval for the first equation is x ≤ -2, it includes the value of x = -2. Therefore, place a closed circle at point (-2, -5).
To help graph the line, find another point on the line by inputting another value of x that is less than -2 into the same function:
\implies f(-5)=-5-3=-8⟹f(−5)=−5−3=−8
Plot point (-5, -8) and draw a straight line from the closed circle at (-2, -5) through (-5, -8). Add an arrow at the other endpoint to show it continues indefinitely as x → -∞.
Second piece of the function
Substitute x = -2 into the second function:
\implies f(-2)=4(-2)+5=-3⟹f(−2)=4(−2)+5=−3
As the interval for the second equation is x > -2, it does not include the value of x = -2. Therefore, place an open circle at point (-2, -3).
To help graph the line, find another point on the line by inputting another value of x that is more than -2 into the same function:
\implies f(1)=4(1)+5=9⟹f(1)=4(1)+5=9
Plot point (1, 9) and draw a straight line from the open circle at (-2, -3) through (1, 9). Add an arrow at the other endpoint to show it continues indefinitely as x → ∞.
See attachment for the graph.
\begin{gathered}\boxed{\begin{minipage}{8cm}\underline{Determining if a function is continuous at $x=a$}\\\\Condition 1: $f(a)$ exists\\\\Condition 2: $\displaystyle \lim_{x \to a}f(x)$ exists at $x=a$\\\\Condition 3: $\displaystyle \lim_{x \to a}f(x)=f(a)$\\\end{minipage}}\end{gathered}
If all three conditions are satisfied, the function is continuous at x = a.
If any one of the conditions is not satisfied, the function is not continuous at x = a.
To determine whether or not the given piecewise function is continuous, find if the function is continuous at x = -2.
Condition 1
Does f(-2) exist? Yes → f(-2) = -5
Condition 2
\textsf{Does}\;\;\displaystyle \lim_{x \to -2} f(x)\;\; \sf exist\;at\;\;x=-2?Does
x→−2
lim
f(x)existatx=−2?
To the left of x =- 2, f(x) = x - 3
To the right of x = -2 , f(x) = 4x + 5
Evaluate the left and right limits as x approaches -2:
\displaystyle \lim_{x \to -2^-}f(x)=\lim_{x \to -2^-} -2-3=-5
x→−2
−
lim
f(x)=
x→−2
−
lim
−2−3=−5
\displaystyle \lim_{x \to -2^+}f(x)=\lim_{x \to -2^+} 4(-2)+5=-3
x→−2
+
lim
f(x)=
x→−2
+
lim
4(−2)+5=−3
\textsf{As}\;\;\displaystyle \lim_{x \to -2^-} f(x) \neq \lim_{x \to -2^+} f(x), \;\; \lim_{x \to -2} f(x)\;\; \textsf{does not exist}.As
x→−2
−
lim
f(x)
=
x→−2
+
lim
f(x),
x→−2
lim
f(x)does not exist.
As condition 2 fails, there is no need to proceed to condition 3.
Therefore, the function is not continuous.
Based on what you know about types of reactions, create 3 testable questions that help you determine which type of reaction has occurred in your reaction scenario. For hydraulic acid and magnesium reaction.
The questions for the reaction between hydraulic acid and magnesium are as follows: depending on the reactant and outcome, is it a combo, decomposition, single replacement, triple replacement, or combustion.
What are the byproducts created when magnesium and hydraulic acid are combined?Identification of the by products of component mixing will be aided by the second investigation. Based on the final products created, a reaction can be categorized as synthesis, decomposition, solo replacement, double renewal, or combustion.
What impact does temperature have on the pace at which magnesium and hydraulic acid react?will make it easier to determine how temperature affects reaction pace. We may classify a response as exothermic or absorption of heat based on how temperature affects it.
To know more about Hydraulic acid check out :
https://brainly.com/question/20699665
#SPJ1
What is the number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution?
a. 0.1 mol c. 0.62 mol
b. 0.16 mol d. 1.6 mol
( I have a feeling that the answer choices are I'm given are all incorrect... I am using M=N/V and keep getting 0.05 mol.
The number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution is 0.16.
Option B is correct.
How to calculate?The first step to take is figure out how many moles of magnesium chloride were needed to make this solution.
We use the compound's molar mass, which essentially tells us the mass of one mole of magnesium chloride which is 0.01996 moles MgCl2
Each mole of magnesium chloride will produce 2 moles of chloride anions in solution.
0.01996 x 2 moles Cl− = 0.03992 moles of Cl−
Therefore the number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution is 0.03992/ 250 ml
=0.16 moles of Cl
molarity tells us the number of moles of solute you get per liter of solution, we can conclude that the molarity of the chloride anions will be 0.16
Learn more about moles at: https://brainly.com/question/13314627
#SPJ1
Oxygen is a substance that dissolves in water. Fish absorb oxygen from the water. When dissolved oxygen levels are low, it can be hard for organisms to survive
Oxygen is a molecule that is essential for life. It is a colorless, odorless gas that makes up about 20% of the air we breathe.
What is molecule?A molecule is a group of two or more atoms that are held together by chemical bonds. They are the basic building blocks of all matter, and are composed of protons, neutrons, and electrons.
When oxygen is dissolved in water, it can be absorbed by aquatic organisms such as fish. These aquatic organisms use the oxygen to help them with their metabolic processes. When the levels of oxygen in the water are too low, the organisms are not able to survive and may die. Low oxygen levels can occur naturally due to environmental factors like temperature or seasonality, or they can be caused by human activities such as pollution. It is important to keep oxygen levels in the water high to ensure the health of aquatic ecosystems.
To learn more about molecule
https://brainly.com/question/1078183
#SPJ1
You have three crystal substances (x, y, and z) whose properties are listed in the table below. Identify the types of bonds in each substance and explain your answer.
X contains metallic bond
Y contains ionic bond
Z contains covalent bond
What is the crystal structure?We know that the crystal structure of a compound would have to do with the way that the atoms and the elements that compose the compound could be said to have been arranged. Thus if a compound is said to have a crystal structure then we can say that the compound would be crystalline in nature as we can see from the table that we have in the question here.
The kind of bonds that we have in the compound is about one of things that can be able to determine whether or not the compound has a crystalline structure as we can see.
Looking at the properties of the compounds that have been shown in the bale that has been attached to the answer that we have here, we can be able to make a decision regarding each of the substances shown.
Learn more about crystal substances:https://brainly.com/question/28728101
#SPJ1
A reaction has an enthalpy change of +14 kJ mol-¹
entropy change of +37 J K-¹ mol-¹. At what
temperature does this endothermic reaction become spontaneous?
A reaction has an enthalpy change of +14 kJ mol-¹ entropy change of +37 J K-¹ mol-¹. the temperature is 378105.2284°C.
What is temperature?Generally, To determine the temperature at which an endothermic reaction becomes spontaneous, you need to use the entropy change of the reaction and the enthalpy change of the reaction. This can be done using the equation:
ΔG = ΔH - TΔS
Where
ΔG is the change in Gibbs free energy.ΔH is the change in enthalpy, T is the temperature in Kelvin, and ΔS is the change in entropy.If the ΔG for a reaction is negative, then the reaction is spontaneous. If the ΔG for a reaction is positive, then the reaction is not spontaneous.
In this case, we are given that the enthalpy change for the reaction is +14 kJ/mol and the entropy change for the reaction is +37 J/K*mol.
We can use this information to solve for the temperature at which the reaction becomes spontaneous
ΔG = ΔH - TΔS
0 = +14 kJ/mol - T(+37 J/Kmol)
T = 14000 J/mol / (37 J/Kmol*1/1000)
T = 378378.3784 K
Thus, the temperature at which this endothermic reaction becomes spontaneous is approximately 378378.3784 K, which is approximately 378105.2284°C.
Read more about temperature.
https://brainly.com/question/11464844
#SPJ1
In the image below, the formally charged carbon in molecule 1 has ___hydrogen(s) attached and the formally charged carbon in molecule 2 has___hydrogen(s) attached.
In the image below, the formally charged carbon in molecule 1 has 2 hydrogen(s) attached and the formally charged carbon in molecule 2 has 1 hydrogen(s) attached.
Molecule 1 features a carbon atom with two hydrogen atoms attached, while molecule 2 features a carbon atom with just one hydrogen atom attached.
Both molecules have a formally charged carbon, making them unique among the many types of molecules available. With the difference in hydrogen attachment, both molecules offer distinct characteristics and benefits.
This difference in the number of hydrogen atoms affects the molecules' overall structure and properties.
To learn more about hydrogen, click here:
https://brainly.com/question/24433860
#SPJ4
5. Find the sum of all the valence electrons for NF, (Add how many valence electrons one nitrogen atom has with the
valence electron for three fluorine atoms.)
6. How many valence electrons are in the drawing of NF, above?
7. In CCL, carbon is the "central atom". In NF3 nitrogen is the "central atom". What is meant by "central atom"?
8. In SF₂ sulfur is the central atom. You can tell which atom is the central atom simply by looking at the formula.
What is meant by "central atom"?
9. Identify the central atom in each of the following molecules:
a. CO₂
b. PH3
c. SiO₂
a) There are 26 valance electrons in [tex]NF_{3}[/tex] .
b) The central atom bears all the other atoms
c) CO₂ - Carbon is the central atom
[tex]PH_{3}[/tex] - Phosphorus is the central atom
SiO₂ - Silicon is the central atom.
What are the valence electrons?We have to note that when we talk about the valence electrons, we mean the electrons that tend to occupy the valance shells of the atoms of the elements.
In the case of the compound that has been shown in the question,[tex]NF_{3}[/tex] has about 26 valence electrons and this can be shwn from the Lewis structure of the compound shown.
The term central atom has to do with the atom to which all of the other atoms or groups can be seen to be attached.
Learn more about central atom:https://brainly.com/question/29422259
#SPJ1
17. How many grams of NO2 (46.0 g/mol) will be produced by the reaction of 43.9 g of
NH3 (17.03 g/mol)?
4NH3 (g) +702 (g) → 4NO2 (g) + 6H2O(g)
The mass of [tex]NO_2[/tex], in grams, that would be produced by the reaction will be 118.68 grams.
Stoichiometric problemFirst, let's write out the balanced equation of the reaction:
[tex]4NH_3 (g) +7O_2 (g) -- > 4NO_2 (g) + 6H_2O(g)[/tex]
From the equation, the mole ratio of [tex]NH_3[/tex] and [tex]NO_2[/tex] is 1:1.
Recall that, mole = mass/molar mass.
43.9 g of [tex]NH_3[/tex] = 43.9/17.03
= 2.58 mol
Thus, from the 1:1 mole ratio, the equivalent mole of [tex]NO_2[/tex] produced from the reaction would be 2.58 mol.
Since, mass = mole x molar mass, the mass of 2.58 mol of [tex]NO_2[/tex] can be calculated as:
2.58 x 46.0 = 118.68 grams.
In other words, the amount of [tex]NO_2[/tex] produced by the reaction of 43.9 g of [tex]NH_3[/tex] according to the chemical equation would be 118.68 grams.
More on stoichiometric problems can be found here: https://brainly.com/question/29841194
#SPJ1
If an S wave has a frequency of 2.5Hz and a wavelength of 600 m, what is the speed of the wave?
S waves have a frequency of 2.5Hz, a wavelength of 600 m, and an average speed of 2.5 × 600 = 1500.
How to calculate speed of wave ?Wave speed is the amount of space a wave covers in a certain length of time, such as how many metres it covers in a second. Speed = Wavelength x Frequency is the formula that links wave speed to wavelength and wave frequency. When wavelength and frequency are known, one may use this equation to determine the wave speed.
Frequency equals 600 Hz. Given that the sound speed in air is 340 m/s, the wavelength is calculated as wavelength = speed/frequency = 340/600 = 0.57 m. P19. The wavelength is two hurts into the frequency. After solving, we will obtain a lambda of 1.5 metres. Three metres per second is a velocity of v. So the water waves here move at a 3 metre per second rate. The equation linking wave speed, frequency, and wavelength is v=f since the frequency, f, is 1/T.
To learn more about wave refer to :
https://brainly.com/question/16610625
#SPJ1
A 0.552-g sample of ascorbic acid (vitamin C) was dissolved in water to a total volume of 20.0 mLand titrated with 0.1103 MKOH, and the equivalence point occurred at 28.42 mL. The pHof the solution at 10.0 mL of added base was 3.72.
The molar mass is 176.1 g/mol , and Ka for vitamin C is 1.03 x 10⁻⁴
The equation for the reaction is as shown in the attached diagram below
the reaction of Sodium Hydroxide, NaOH with ascorbic acid, C₆H₈O₆ is similar to the reaction of Potassium Hydroxide, KOH with ascorbic acid as show
C₆H₈O₆ + KOH ⇒ C₆H₇O₅K + H₂O
to produce one mole of potassium ascorbate and water
now,
0.1103 M KOH is contained in 1000mL
x moles is contained in 20mL
cross multiply making x the subject
No of moles of KOH = (0.1103 x 28.42)/1000 = 0.003135 moles
or
Moles of KOH = 0.1103 x 0.02842 L = 0.003135 = moles ascorbic acid
Molar mass = 0.552 g / 0.003135 mol = 176.1 g/mol
Moles of ascorbic acid = 0.552 / 176.1 =0.00313
moles NaOH = 0.0100 L x 0.1103 =0.001103
C₆H₈O₆ + OH⁻ >> C₆H₇O₆⁻ + H2O
Moles ascorbic acid in excess = 0.00313 - 0.001103 = 0.002027
Moles C₆H₇O₆⁻ = 0.001103
total volume = 20 + 10 = 30 mL = 0.030 L
concentration ascorbic acid = 0.002027 / 0.030 =0.0676 M
concentration C₆H₇O₆⁻ = 0.001103 / 0.030 =0.0368 M
pH = pKa + log [C₆H₇O₆⁻] / [C₆H₈O₆]
3.72 = pKa + log 0.0368 / 0.0676
3.72 = pKa - 0.264
pKa =3.984
Ka = 10^-3.984
=1.03 x 10⁻⁴
Your question is incomplete most probably your full question was
A 0.552-g sample of ascorbic acid was dissolved in water to a total volume of 0.20 mL and titrated with 0.1103 M KOH. The equivalence point occurred at 28.42 mL. The pH of the solution at 10.0mL of added base was 3.72. From this data, determine the molar rmass and Ka for vitamin C.
To look more about molar mass click here
brainly.com/question/12127540
#SPJ4
Which is an example of a reduction reaction?
Mg → Mg2+ + 2e
Na → Nat+e¯
AI→ Al³+ + 4e¯ +2e=
S+2e → S²-
An example of a reduction reaction is: S+2e → S²⁻
What is a reduction reaction?In a chemical reaction, when a molecule accepts/gains an electron, it undergoes a reduction reaction. Conversely, a molecule leaving an electron undergoes an oxidation reaction. A molecule undergoing a reduction reaction forms an anion while cations are formed in an oxidation reaction.
In the question, Magnesium leaves 2 electrons and forms an Mg2+ cation. Similarly, Sodium and Aluminum leaves electron to form their respective cations. All of the mentioned molecules are undergoing oxidation reactions and form cations.
Chemical reactions are primarily red-ox coupled. If one molecular species is getting reduced, another molecular species in the reaction will be oxidized.
To learn more about reduction click here:
brainly.com/question/13344072
#SPJ1
A solution of glucose sugar (C6H₁206) labeled 2.89 ppm. What is the molarity of the solution?
The molarity of the solution is 0.00016 M
To determine the molarity of a solution, you need to know:
The mass of the solute (in this case, glucose) The volume of the solvent (in this case, probably water).From the information you provided, the concentration of the solution is given in parts per million (ppm). To convert from ppm to molarity, you need to know:
The molecular weight of the solute The density of the solvent.The molecular weight of glucose is 180.16 g/mol. If the solvent is water, the density is about 1 g/mL. Here is the conversion calculation:
1 ppm = 1 mg/L = (1/180.16 g/mol) / (1 g/mL) = 5.55 x 10^-6 mol/L
So, the molarity of the solution is: 2.89 ppm * 5.55 x 10^-6 mol/L/ppm = 1.60 x 10^-4 mol/L = 0.00016 M
Learn more about Molarity here:
https://brainly.com/question/14469428
Answer:
Explanation:
Before telling the answer remember some terminology
molarity=No. of moles of solute/Volume of the solution in liters
M=n/V
n=Mass of solute(w)/Molecular mass(M)
V=volume of solution(v)/1000
ppm =(parts per million)
ppm of solute=(mass of solute/mass of solution)*10^{6}
2.89gms of solute in 1000000 of solution
5.22gm of solute
5.22in 1000 gms in litre=5220g[tex]L^{-1}[/tex]
2.89 gms are present in 2.59/5220=5.5363*[tex]10^{-4}[/tex]
Hence the molarity of the solution is 5.5363*[tex]10^{-4}[/tex]mol [tex]L^{-1}[/tex]
A sports trainer applies an ice bag to the back of an injured athlete. Calculate the heat in kcal that is absorbed if 165g of ice at 0.0∘C is placed in an ice bag, melts, and rises to body temperature of 37.0∘C. (For water, 80. cal (334 J) is needed to melt 1g of ice or must be removed to freeze 1g of water.)
Express the heat to two significant figures and include the appropriate units.
The heat absorbed by the ice is given by the formula: heat = mass * specific heat capacity * change in temperature.
The mass of the ice is 165g. The specific heat capacity of water is 4.18 J/g°C. The change in temperature is 37.0°C - 0.0°C = 37.0°C.
The heat absorbed by the ice is: 165g * 4.18 J/g°C * 37.0°C = 29,894.5 J
To convert from J to kcal: 1 kcal = 4184 J. Therefore,
29,894.5 J / 4184 J/kcal = 7.13 kcal
The heat absorbed by the ice is 7.13 kcal
the volume required to get to the equivalence point is blank dependent on the concentration and volume of acid or base to be titrated and the base or acid used to do the titration because the equivalence point is blank the stoichiometry of the balanced reaction of the acid and base. the stoichiometry only considers the number of moles involved, blank the strength of the reactants involved.
Equivalence point is dependent on stoichiometry of balanced reaction of acid and base. Stoichiometry only considers number of mols involved, not strength of reactants involved.
To ascertain how much of a specific drug is present in a sample, an experiment called a b is done. A diprotic acid is one that has a two-proton (H+) capacity per molecule. Two equivalence points—points at which the number of moles of acid and base are equal—are present when a diprotic acid is titrated with NaOH. When all of the acids have been neutralised, the first equivalence point is reached; meanwhile, the second equivalence point is reached when the surplus base has been neutralised. The amount of NaOH solution required to go from the first equivalence point to the second equivalence point is twice the amount required to travel from the first equivalence point to the first equivalence point.
Learn more about equivalence point here:
https://brainly.com/question/29999744
#SPJ4
Which one of the following symbols represent an element?
A. CO
B. He
C. HF
D. NO
The symbol that represents that of an element is He. Option B.
Symbols of elementsElements have their respective symbols in chemistry. For example, hydrogen is represented by H, and helium is represented by He. Carbon is represented by C, oxygen by O, fluorine by F, and nitrogen by N.
Thus, CO is a combination of carbon and oxygen, HF is a combination of hydrogen and fluorine, and NO is a combination of nitrogen and oxygen. They are known as carbon monoxide, hydrogen fluoride, and nitrogen oxide respectively.
In other words, the only symbol that represents that of an element is He which symbolizes helium.
More on symbols of elements can be found here: https://brainly.com/question/14678810
#SPJ1
Identify the absolute configuration of the chirality centers in each of the following compounds as R or S. Note: if multiple chirality centers are present, indicate the stereochemical designations as: RR, SS, RS, or SR. (Other terms used for chirality center include chiral center, stereocenter, and stereogenic center.)
The R/S isomer is decided on the basis of the attached group atomic number to chiral atom.
the R/S configuration is the nomenclature used to describe the enantiomer of chiral molecules. The absolute configuration of chiral substances is another name for this arrangement. the atom attached to the chiral centre is marked based on atomic number. Higher atomic number objects will be given lesser numbers. Place the chiral centre so that the atom with the lowest priority is pointed away from the observer. The absolute configuration is R if the arrow moves in a clockwise direction. Additionally, the absolute configuration is S if the arrow is moving anticlockwise. This is followed when the lower priority group are present in a vertical position and reversed is followed in case of the horizontal direction.
Hence, absolute configuration directly influenced by priority group
To know more about Nomenclature.
https://brainly.com/question/14252523
#SPJ4
The connected group atomic number to the chiral atom determines the R/S isomer.
The enantiomer of chiral compounds is designated by the nomenclature R/S configuration. Another name for this configuration is the absolute configuration of chiral compounds. Based on its atomic number, the atom that is joined to the chiral center is identified. Lesser numbers will be assigned to items with higher atomic numbers. Put the chiral center in such a way that the atom with the lowest priority faces the viewer. If the arrow turns clockwise, the absolute configuration is R. Additionally, if the arrow is travelling counterclockwise, the absolute configuration is S. When the lower priority group is present and is positioned vertically, this happens.
Learn more about chiral here-
https://brainly.com/question/13667509
#SPJ4
PLAEASEEEEEEE HELPPPPPP HURRY
Which object in the image will have the smallest change in motion when an equal force is applied? (2 points)
an eight kilogram circle,
five kilogram rectangle,
four kilogram triangle,
six kilogram square
8 kg circle
6 kg square
4 kg triangle
5 kg rectangle
Answer:
The object will have the smallest change in motion when an equal force is applied is 8kg circle.
Explanation:
Answer:8gk is the a 1
Which of the following is a homogeneous mixture?l
Sugar water is a homogeneous mixture. Therefore, option A is correct.
What are the mixtures?A mixture can be described as made up of two or more different substances which are physically combined in a mixture. A mixture of two or more substances can break down into their original components.
The composition of a heterogeneous mixture can not be uniform entire the mixture while the composition of a homogeneous mixture can be always the same.
Pure substances cannot be broken down into simple substances that have only one kind of atom in the entire composition.
A pure substance can be described as made up of two or more elements that are chemically combined together and has a set composition such type of pure substance is called a compound.
As the sugar completely dissolved in water so it is a homogeneous mixture.
Learn more about mixture, here:
brainly.com/question/6243623
#SPJ1
Your question is incomplete, the complete question was,
Which of the following is a homogeneous mixture
A ) sugar solution
B) Mud
C) dirt
D) salsa
Data
Table A. Arrangement of Layers and Description of Rocks
The Description of Rocks are given below
Conglomerate: Conglomerate is a type of sedimentary rock that is made up of large, rounded particles. It is typically formed in high-energy environments, such as riverbeds or at the base of cliffs. The rounded particles in conglomerate are usually made up of a variety of rocks and minerals, and they can range in size from pebbles to boulders.
Ammonite: Ammonite is the fossilized shell of an extinct marine animal called an ammonoid. These animals were closely related to modern-day squid and octopuses, and they lived during the time of the dinosaurs. Ammonite fossils are commonly found in sedimentary rock, and they are often used to help determine the age of the rock layer in which they are found.
Crinoid: Crinoids are a type of invertebrate animal that lived in the ocean during the Paleozoic and Mesozoic eras. They had a stem and a head, and their body was made up of a series of segmented plates. Crinoid fossils are commonly found in sedimentary rock, and they are often used to help determine the age of the rock layer in which they are found.
Trilobite: Trilobites were a group of extinct arthropods that lived in the ocean during the Paleozoic era. They had a hard exoskeleton and were segmented, with a head, thorax, and tail. Trilobite fossils are commonly found in sedimentary rock, and they are often used to help determine the age of the rock layer in which they are found.
What is the rocks about?The conglomerate rock layer is the youngest and the trilobite rock layer is the oldest.
The ammonite and crinoid rock layers are somewhere in between in terms of age. The description of the rocks in the table refers to the types of fossils that are found in each rock layer.
For example, the conglomerate rock layer contains rocks that are composed of large, rounded particles, while the trilobite rock layer contains rocks with trilobite fossils.
Learn more about ammonite from
https://brainly.com/question/465687
#SPJ1
NaOH
a. bromocresol green or methyl red
b. alizarin, bromthymol blue or phenol red
c. erythrosin B or 2,4-dinitrophenol
d. 2,4-dinitrophenol or bromphenol blue
e. o-cresolphthalein or phenolphthalein
The indicator used for the titration of base NaOH with a strong acid is o-cresol phthalein and phenolphthalein due to clear colour intensity variation during titration.
When an o-cresolphtahlein indicator is mixed with the basic solution gives the light red colour to dark red with increased pH values. similarly, phenolphthalein gives reddish-orange colour. Titration is a technique used to evaluate an unknown substance concentration in a solution. It entails adding a known concentration of a solution, known as the titrant, gradually to a known volume of the object being studied, known as the analyte or titrand. The endpoint of the titration is the point at which the two solutions are chemically balanced. Acid-base titrations involve an acid and a base reacting to produce salt and water. Transferring electrons from one species to another is a component of redox titrations.
Hence, titration is neutralization reaction of acid and bases.
To know more about Neutralization.
https://brainly.com/question/27891712
#SPJ4
The addition of 3.15 g of Ba open parentheses OH close parentheses subscript 2 times 8 straight H subscript 2 straight O to a solution of 1.52 g of NH subscript 4 SCN in 100 g of water in a
The heat that is absorbed by the system is 1363 J. Option B
What is the heat absorbed?We know that in a chemical reaction that there could be the absorption or the evolution of heat. We say that there is the evolution of heat when heat has been lost from the system and there is the absorption of heat when heat has been gained by the system.
Number of moles of the barium hydroxide hydrate = 3.15 g/203 g/mol
= 0.015 moles
Number of moles of the ammonium thiocyanate = 1.52/76 g/mol
= 0.02 moles
If 1 mole of barium hydroxide hydrate reacts with 2 moles of ammonium thiocyanate
0.015 moles of barium hydroxide hydrate reacts with 0.015 * 2 moles/1 mole
= 0.03 moles
Hence the limiting reactant is the ammonium thiocyanate.
Now the heat that is absorbed is;
H = mcdT
m = mass of the water
c = Heat capacity
dT = Temperature change
H = 100 * 4.20 * 3.1
H = 1363 J
Learn more about heat capacity:https://brainly.com/question/28302909
#SPJ1
