The 3D object above is sliced parallel to the base. What shape is formed? triangle octagon rectangle hexagon

The 3D Object Above Is Sliced Parallel To The Base. What Shape Is Formed? Triangle Octagon Rectangle

Answers

Answer 1

When a 3D object is sliced such that the top is parallel to the base, then the top and the base formed same shape.

The shape formed at the base;

It is a six-sided shape. A six-sided polygon is called HEXAGON

The 3D Object Above Is Sliced Parallel To The Base. What Shape Is Formed? Triangle Octagon Rectangle

Related Questions

Which describes the product when two fractions greater than 0 and less than 1 are multiplied?

Answers

When you multiply two numbers, one of them greater than 0 and the other one lower than 1. The result is a number that is lower than the first one, that is, a number lower than the number greate than 0.

Select the correct answer from each drop-down menu.
Given: Kite ABDC with diagonals AD and BC intersecting at E
Prove: AD L BC
A
C
E
LU
D
B
Determine the missing reasons in the proof.

Answers

The missing reasons are

ΔCDA ≅ ΔBDA  by SSS [side side side]

ΔCED ≅ ΔBED by SAS [side angle side]

What is Kite?

A kite is a quadrilateral having reflection symmetry across a diagonal in Euclidean geometry. A kite has two equal angles and two pairs of adjacent equal-length sides as a result of its symmetry.

Given,

ABCD is a kite, with the diagonal AD and BC

We have,

               AC = AB

and

               CD = BD                [Property of Kite]

In ΔACD and ΔABD

                AC = AB

and

               CD = BD               [Property of Kite]        

               AD = AD               [Common]

By rule SSS Criteria [Side Side Side ]

              ΔACD ≅ ΔABD

 ∴           ∠CDA = ∠BDA         [CPCT]

Now,

         In ΔCDE and ΔBDA

                 CD = BD

            ∠CDE = ∠BDE

                 DE = DE                [Common]

By rule SAS Criteria [Side Angle Side]  

            ΔCDE ≅ ΔBDA

∴                CE = BE                [CPCT]  

Hence, AD bisects BC into equal parts

The missing reasons are

ΔCDA ≅ ΔBDA  by SSS [side side side]

ΔCED ≅ ΔBED by SAS [side angle side]

To learn more about Kite click on the link

https://brainly.com/question/23279609

#SPJ13

Find the third side in simplest radical form: 25 24

Answers

[tex]\sqrt[]{49\text{ }}\text{ }[/tex]

Here, we want to get the length of the third side

Mathematically, we can get this by the use of Pythagoras' theorem

It states that the square of the length of the hypotenuse equals the sum of the squares of the two other sides

Let the missing side be s

From the diagram, we have the hypotenuse as 25 (the hypotenuse is the longest side and it is the side that faces the right angle

We have this as;

[tex]\begin{gathered} 25^2=s^2+24^2 \\ s^2=25^2-24^2 \\ s^2\text{ = 625-576} \\ s\text{ = }\sqrt[]{49} \\ s\text{ = 7} \end{gathered}[/tex]

Amy's cookie shop had expenses of the following: flour $45.00sugar $92.00butter $53 she earns $12 per dozen. what is her profit,if she sells 9 dozen?what is the total dollar amount for expenses?what is the total dollar amount for earnings or revenue?

Answers

If she earns $12 per dozen, the following will be the profit if she sells 9 dozen:

[tex]9\cdot12=108[/tex]

Profit would be $108.

*The dollar amount of expenses would be:

[tex]e=\frac{190\cdot108}{12}\Rightarrow e=1710[/tex]

The expenses would be $1710 if she were to sell 9 dozen.

*The total amount of revenue would be $108 for the 9 dozen sold.

what is 2.939 radian measure to degree measure

Answers

[tex]\text{ To convert from radian to degree, simply multiply the radian measure by }\frac{180}{\pi}[/tex][tex]\begin{gathered} \text{ To convert 2.939 to degrees, multiply 2.939 by }\frac{180}{\pi} \\ 2.939\text{ rad = 2.939 x }\frac{180}{\pi}\text{ degre}e \\ =\text{ 2.939 x }\frac{180}{3.14} \\ =168.5\text{ degrees} \end{gathered}[/tex]

The answer is 168.5 degrees

The oldest child in a family of four children is three times as old as the youngest. The two middle children are 19 and 23 years old. If the average age of the children is 28.5, how old is the youngest child?

Answers

Answer:

18 years old

Solution:

Let x represent the age of the youngest child.

So the age of the oldest = 3x

If the ages of the two middle children are 19 and 23, and the average age of the four children is 28.5, let's go ahead and find x;

[tex]\begin{gathered} \frac{(x+19+23+3x)}{4}=28.5 \\ 4x+42=114 \end{gathered}[/tex]

Let's go ahead and subtract 42 from both sides;

[tex]4x=72[/tex]

Dividing both sides by 4, we'll have;

[tex]x=\frac{72}{4}=18[/tex]

Therefore, the youngest is 18 years old.

2(3 + v) =

Please help solve this problem and thank you

Answers

Answer:

6 +2v

Step-by-step explanation:

This is distributive property. That means you will multiply each term inside the parentheses by the term on the outside of the parentheses.

2(3 + v)

2(3) + 2(v)

6 +2v

Answer: 6+2v

!!!!!!!!!

Do the side measures 35 mm, 53 mm and 70 mm create a triangle?Yes, there are infinitely many triangles that can be created.No, it is impossible to create a triangle with the given measures.Yes, there is a unique triangle that can be created.Yes, there are two triangles that can be created.

Answers

Hello!

Let's call these sides a, b, and c:

• a = 35mm

,

• b = 53mm

,

• c = 70mm

To be a triangle, it must satisfy the existence condition of triangles, that is:

Let's check each of them:

[tex]\begin{gathered} |b-c|

Answer:

Yes! There are infinitely many triangles that can be created.

What are examples of vertical stretch and compression and horizontal stretch and compression?

Answers

Examples of vertical stretch and compression and also  horizontal stretch/vertical compression are explained below considering x² and

sin(x) function.

What is vertical stretch/vertical compression ?

A vertical stretch is derived if the constant is greater than one while the vertical compression is derived if the constant is between 0 and 1.

Vertical stretch means that the function is taller as a result of it being stretched while vertical compress is shorter due to it being compressed and is therefore the most appropriate answer.

example : If the graph of x² is  is transformed to 2x² Then the function is compressed Vertically.

If the graph of x² is  is transformed to x²/2 Then the function is stretch Vertically.

What is horizontal stretch/vertical compression ?

We know that if f(x) is transformed by the rule f(x+a) then the transformation is either a shift ''a'' units to the left or to the right depending on a is positive or negative respectively this phenomenon is horizontal stretch and compression.

example : If the function y = sin(x) is transformed to y = sin(2x) Then the function is compressed horizontally.

example : If the function y = sin(x) is transformed to y = sin(x/2) Then the function is stretch horizontally.

Read more about vertical stretch/compressed  here:

brainly.com/question/24465194

#SPJ1

John has two apples, he gives Jane 251. How many apples does John have? Please help 2nd grade is so hard.

Answers

-249 ( I just want the points )
249 is the answer (i want points too)

Yoko plans to watch 2 movies each month. Write an equation to represent the total number of movies n that she will watch in m months.

Answers

Answer:

2m because 2 times the months will tell us how many she has watched for example in 2 months she will watch 4 because 2*2 is 4

what is the value of 6 3/4 (-11.5)

Answers

We are given the following expression

[tex]6\frac{3}{4}(-11.5)[/tex]

As you can see, a mixed number is being multiplied with a negative decimal number.

First, convert the mixed number to a simple fraction then multiply with the decimal number

[tex]6\frac{3}{4}=\frac{6\cdot4+3}{4}=\frac{24+3}{4}=\frac{27}{4}[/tex]

Now multiply it with the negative decimal number

[tex]\frac{27}{4}(-11.5)=-\frac{310.5}{4}=-77.625[/tex]

So the resultant decimal number may be written back into the mixed form as

[tex]-77.625=-77\frac{5}{8}[/tex]

Therefore, the result of the given expression is -77 5/8

Find the links of the sides of these special triangles

Answers

From the triangle, we express the tangent of 60° as:

[tex]\tan 60\degree=\frac{Z}{7}[/tex]

But tan(60°) = √(3), then:

[tex]\begin{gathered} \frac{Z}{7}=\sqrt[]{3} \\ \Rightarrow Z=7\sqrt[]{3}\text{ ft} \end{gathered}[/tex]

f(x) = x + 4 and g(x) = x - 1Step 3 of 4: Find (f 3)(x). Simplify your answer.Answer(f)(x) =

Answers

For this problem, we are given two functions, we need to determine the composite between these two expressions.

The two functions are:

[tex]\begin{gathered} f(x)=x+4\\ \\ g(x)=x-1 \end{gathered}[/tex]

This composite is the product of the two functions, therefore we have:

[tex]\begin{gathered} (f\cdot g)(x)=(x+4)\cdot(x-1)\\ \\ (f\cdot g)(x)=x^2-x+4x-4\\ \\ (f\cdot g)(x)=x^2+3x-4 \end{gathered}[/tex]

The answer is x²+3x-4.

I will attach a picture to this question so you can understand it better.

Answers

Here are the given information:

1. 7 red beads for every 4 blue beads

2. total of 44 beads (red and blue)

Find: the number of red beads

Solution:

We can solve this in two ways. We can solve this using proportion or we can solve this by counting.

Let's start counting first. Let's say 7 red beads and 4 blue beads is 1 set. So, for every set, we already have 7 + 4 = 11 beads in total.

First set = 7 red bead + 4 blue beads = 11 beads

Second set = 7 red bead + 4 blue beads = 11 beads

Third set = 7 red bead + 4 blue beads = 11 beads

Fourth set = 7 red bead + 4 blue beads = 11 beads

If we add all the 4 sets, we have a total of 44 beads. If we add all the RED beads only, we get 7 red beads x 4 sets = 28 red beads.

Therefore, Lily used 28 red beads.

Now, using proportion, we can have this equation:

[tex]\frac{7\text{red beads}}{4\text{blue bead}}=\frac{x\text{ red beads}}{(44-x\text{ red)blue beads}}[/tex]

where x = the total number of red beads and we got 44 - x as the number of blue beads.

The next thing that we need to do here is to solve for x.

1. To solve for x, do cross multiplication first.

[tex]7(44-x)=4x[/tex]

2. Multiply 7 to the numbers inside the parenthesis.

[tex]308-7x=4x[/tex]

3. Add 7x on both sides of the equation.

[tex]\begin{gathered} 308-7x+7x=4x+7x \\ 308=11x \end{gathered}[/tex]

4. Lastly, divide both sides by 11.

[tex]\begin{gathered} \frac{308}{11}=\frac{11x}{11} \\ 28=x \end{gathered}[/tex]

As we can see, the value of x = 28. Lily used 28 red beads.

Hello! I need some assistance with this homework question, pleaseQ12

Answers

Answer:

A(-1,4) and B(2,0)

Step-by-step explanation:

The quadratic parabola equation is represented as;

[tex]\begin{gathered} y=a(x-h)^2+k \\ \text{where,} \\ (h,k)\text{ is the vertex of the parabola} \end{gathered}[/tex]

Therefore, if the given vertex (2,-5) and the other given point (-1,-1), substitute into the equation and solve for the constant ''a'':

[tex]\begin{gathered} -1=a(-1-2)^2-5 \\ -1=9a-5 \\ 9a=4 \\ a=\frac{4}{9} \end{gathered}[/tex]

Hence, the equation for the parabola:

[tex]f(x)=\frac{4}{9}(x-2)^2-5[/tex]

Now, for the line since it is a horizontal line, the equation would be:

[tex]g(x)=5[/tex]

Then, for (f+g)(x):

[tex]\begin{gathered} (f+g)(x)=\frac{4}{9}(x-2)^2-5+5 \\ (f+g)(x)=\frac{4}{9}(x-2)^2 \end{gathered}[/tex]

Then, the graph for the composite function and the points that lie on the graph:

A(-1,4) and B(2,0)

Which of the following expressions is equivalent to 2-3?A -2-31B-23C231D- 2-3

Answers

2 - 3

the correct answer is letter C

If we follow the rules of the exponents, the power is negative so we change the negative sign writing the numerator in the denominator,

In the picture below, measure 1 is 5x-14 degrees and measure 3 is 2x+10 degrees. Find measure 2.

Answers

SOLUTION:

Step 1:

In this question, we have the following:

In the picture below, measure 1 is (5x-14) degrees and measure 3 is (2x+10) degrees.

Find the measure of 2.



Step 2:

From the diagram, we can see that angles 1 and 3 are vertically opposite and they are also equal.

Based on this fact, we can see that:

[tex]\begin{gathered} \angle\text{1 = }\angle3 \\ (\text{ 5 x- 14 ) = ( 2x + 10 )} \\ \text{collecting like terms, we have that:} \\ 5x\text{ - 2x = 10 + 14} \\ \text{3 x = 24} \end{gathered}[/tex]

Divide both sides, we have that:

[tex]\begin{gathered} x\text{ =}\frac{24}{3} \\ \text{x = 8 } \end{gathered}[/tex]

Then, we put x = 8 into the equation for Angle 1 , we have that:

[tex]\angle1=(5x-14)=5(8)-14=40-14=26^0[/tex][tex]\angle3=(2x+10)=2(8)+10=16+10=26^0[/tex]

Hence, we can see that Angles 1 and 3 are equal.

Step 3:

From the diagram, we can see that:

we can see that angles 2 and 4 are vertically opposite and they are also equal.

Recall that angles 1 and 3 are also vertically opposite and they are also equal.

Therefore, we can see that:

[tex]\begin{gathered} \angle2\text{ = p} \\ \angle4\text{ = p} \\ \angle1\text{ = }26^0 \\ \angle3=26^0 \\ \text{Then, we have that:} \\ p+p+26^0+26^{\text{ 0 }}=360^0\text{ ( Sum of angles at a point)} \\ 2p+52^0=360^0 \\ 2p=360^0-52^0 \end{gathered}[/tex]

Divide both sides by 2, we have that:

[tex]\begin{gathered} 2p=308^0 \\ p\text{ =}\frac{308^0}{2} \\ p=154^0 \end{gathered}[/tex]

CONCLUSION:

[tex]\begin{gathered} \operatorname{Re}call\text{ that }\angle2\text{ = p} \\ \text{Then, we have that:} \\ \angle2=154^0 \end{gathered}[/tex]

A person invests $9000 at 3% interest compound annually for 4 years and then invests the balance (the $9000 plus the interest earned) in an account at 7% interest for 8 years. find the final value of the investment.

Answers

Answer:

$17,404.5

Explanation:

To calculate the balance after t years, we can use the following equation:

[tex]A=P(1+r)^t[/tex]

Where P is the initial investment and r is the rate.

So, we can calculate the balance after 4 years, replacing t by 4, r by 3%, and P by $9000. Therefore the balance is:

[tex]\begin{gathered} A=9000(1+0.03)^4 \\ A=9000(1.126)_{} \\ A=10129.579 \end{gathered}[/tex]

Now, we can use this quantity to calculate the final value of the investment. So, replacing P by 10129.579, r by 7%, and t by 8 years, we get:

[tex]\begin{gathered} A=10129.579(1+0.07)^8 \\ A=10129.579(1.718) \\ A=17404.503 \end{gathered}[/tex]

Therefore, the final value of the investment is $17,404.5

find the missing lenghts, the triangle in each pair are similar.

Answers

Since the triangles are similar, we have that

[tex]\frac{50}{40}=\frac{x}{52}[/tex]

then

[tex]x=\frac{52\times50}{40}=65[/tex]then the answer will be D) 65

- 2/3 (x+12)+2/3 x=-5/4 x+2

Answers

We will have the following:

[tex]-\frac{2}{3}(x+12)+\frac{2}{3}x=-\frac{5}{4}x+2\Rightarrow-\frac{2}{3}x-8+\frac{2}{3}x=-\frac{5}{4}x+2[/tex][tex]\Rightarrow-\frac{2}{3}x+\frac{2}{3}x+\frac{5}{4}x=2+8\Rightarrow\frac{5}{4}x=10[/tex][tex]\Rightarrow5x=40\Rightarrow x=8[/tex]

So, the value of x is 8.

Which is 56,900,000 in scientific notation?o 5.69 x 10⁷o 56.9 x 10⁷o 5.69 X 10⁶o 56.9 X 10⁶

Answers

Answer:

5.69 x 10⁷

Explanation:

A number is said to be in the scientific notation when it is written as a product of a number between 1 and 10 and a power of 10.

The number 56,900,000 in scientific notation is 5.69 x 10⁷.

The correct choice is A.

Mark is roofing an old gymnasium that measures 270’x390’, and needs to calculate how many “squares “ he will need.(1 “square=100 ft square). The gym’s roof is a standard gable roof with 3’ of overhang on all sides. The roof angle measures 22.55 degrees from horizontal. How many squares of roofing does mark need ?

Answers

First, because of the roof having an inclination, we need to calculate the lenght of the surface we want to roof. The width will be the same.

Let's take a look at the situation:

Since we're on a right triangle, we can say that:

[tex]\cos (22.25)=\frac{G}{R}[/tex]

Solving for R,

[tex]\begin{gathered} \cos (22.25)=\frac{G}{R}\rightarrow R\cos (22.25)=G \\ \\ \Rightarrow R=\frac{G}{\cos (22.25)} \end{gathered}[/tex]

Since we already know that the lenght of the gym's floor is 390',

[tex]\begin{gathered} R=\frac{390^{\prime}}{\cos (22.25)} \\ \\ \Rightarrow R=421.38^{\prime} \end{gathered}[/tex]

We get that the lenght of the surface we want to roof is 421.38'

Now, let's take a look at the surface we want to roof:

Since the roof is a standard gable roof with 3’ of overhang on all sides, we add 6' to each dimension:427

Our total roofing area would be:

[tex]427.38^{\prime}\cdot276^{\prime}=117956.88ft^2[/tex]

We then divide this total area by the area of one of our "squares":

[tex]\frac{117956.88}{100}=1179.56[/tex]

We round to the nearest integer from above, since we can't buy a fraction of a square.

(this is called ceiling a number)

[tex]1179.56\rightarrow1180[/tex]

Therefore, we can conclude that Mark needs 1180 squares of roofing.

The Neckware association of America reported that 3% of ties sold in the United States are bow ties. If 4 customers who purchased a tie randomly selected,find the probability that at least 1 purchased a bow tie

Answers

[tex]Pr(at\text{ least 1 purchased a bow tie) = 0.1147}[/tex]

Explanation:

Pr (people with bow ties) = 3% = 0.03

p = 0.03

Pr (people without bow tie) = 1 - 0.03 = 0.97

q = 0.97

n = 4 customers

[tex]Pr(at\text{ least 1 purchased a bow tie) = 1 - Pr(none purchased a bow tie)}[/tex]

To find the probability that at least 1 purchased a bow tie, we will use a binomial probability formula:

[tex]p(x=^{}X)=^nC_xp^xq^{n\text{ - x}}[/tex][tex]\begin{gathered} \text{Pr(none purchased a bow tie) = p(x = 0)} \\ \text{p(x = 0) = }^4C_0\times p^0\times q^{4\text{ - }0} \\ \text{p(x = 0) = 1 }\times\text{ 1}\times q^4=(0.97)^4 \\ \text{p(x = 0) = }0.8853 \\ \\ \text{Pr(none purchased a bow tie) = }0.8853 \end{gathered}[/tex][tex]\begin{gathered} Pr(at\text{ least 1 purchased a bow tie) = 1 - 0.8853} \\ Pr(at\text{ least 1 purchased a bow tie) = 0.1147} \end{gathered}[/tex]

A rectangle has a diagonal of length 10 cm and a base of length 8 cm . Find its height

Answers

Given:

The length of diagonal of rectangle is d = 10 cm.

The length of base is b = 8 cm.

Explanation:

The relation between length, height and diagonal of rectangle is given by pythagoras theorem. So

[tex]d^2=l^2+h^2[/tex]

Substitute the values in the equation to obtain the value of h.

[tex]\begin{gathered} (10)^2=(8)^2+h^2 \\ 100=64+h^2 \\ h=\sqrt[]{100-64} \\ =\sqrt[]{36} \\ =6 \end{gathered}[/tex]

So the height of rectangle is 6 cm.

Answer: 6 cm

A population of 2000 is decreasing by 4% each year. In how many years the population will be reduced in half?

Answers

the initial amount is 2000

the rate of change is 4%

t=time in years

Therefore we have the next exponential decay function

[tex]\begin{gathered} y=2000(1-0.04)^t \\ y=2000(0.96)t \end{gathered}[/tex]

Half of the population is y=1000 so we need to find find the value of t

[tex]1000=2000(0.96)^t[/tex]

we need to isolate the t

[tex]\frac{1000}{2000}=0.96^t[/tex]

[tex]\frac{1}{2}=0.96^t[/tex]

Using logarithms

[tex]\begin{gathered} \ln (\frac{1}{2})=\ln (0.96^t) \\ \ln (\frac{1}{2})=t\ln (0.96^t) \end{gathered}[/tex][tex]t=\frac{\ln (\frac{1}{2})}{\ln (0.96^{})}=16.98\approx17[/tex]

ANSWER

in 17 years the population will be reduced in half

Determine whether 17y = 3x − 19 is quadratic or not. Explain.No; there is no x2 term, so a = 0.No; there is no x-term, so b = 0.No; there is no constant term, so c = 0.Yes; it can rewritten in the form y = ax2 + bx + c.

Answers

The standard form of quadratic equation is given as,

[tex]ax^2+bx\text{ + c = 0 where a }\ne\text{ 0}[/tex]

The equation is given as,

[tex]17y\text{ = 3x - 19}[/tex]

Therefore,

[tex]\text{From the given equation x}^2\text{ is not present and also a = 0.}[/tex]

Thus the given equation is not a quadratic equation.

21. Juanita is packing a box that is 18 inches long and 9 inches high. The total volume of the box.1,944 cubic inches. Use the formula V = lwh to find the width of the box. Show your work

Answers

Answer:

The width of the box is 12 inches

Explanations:

The formula for calculating the volume of a rectangular box is expressed as:

[tex]V=\text{lwh}[/tex]

where:

• l is the ,length ,of the box

,

• w is the ,width, of the box

,

• h is the ,height ,of the box

Given the following parameters

• length = 18 inches

,

• heigh = 9 inches

,

• volume = 1,944 cubic inches

Substitute the given parameters into the formula to calculate the width of the box as shown:

[tex]\begin{gathered} 1944=18\times w\times9 \\ 1944=162w \end{gathered}[/tex]

Divide both sides by 162 to have:

[tex]\begin{gathered} 162w=1944 \\ \frac{\cancel{162}w}{\cancel{162}}=\frac{1944}{162} \\ w=12\text{inches} \end{gathered}[/tex]

Hence the width of the box is 12 inches

A rectangular parking lot has length that is 3 yards less than twice its width. If the area of the land is 299 square yards, what are the dimensions of the land?The parking lot has a width of square yards.

Answers

Answer:

• Width = 13 yards

,

• Length = 23 yards

Explanation:

Let the width of the parking lot = w yards.

The length is 3 yards less than twice its width.

[tex]\implies\text{Length}=(2w-3)\text{ yards}[/tex]

The area of the land = 299 square yards.

[tex]w(2w-3)=299[/tex]

We then solve the equation above for w.

[tex]\begin{gathered} 2w^2-3w=299 \\ \implies2w^2-3w-299=0 \end{gathered}[/tex]

Factor the resulting quadratic expression.

[tex]\begin{gathered} 2w^2-26w+23w-299=0 \\ 2w(w-13)+23(w-13)=0 \\ (2w+23)(w-13)=0 \end{gathered}[/tex]

Solve for w.

[tex]\begin{gathered} 2w+23=0\text{ or }w-13=0 \\ 2w=-23\text{ or }w=13 \\ w\neq-\frac{23}{2},w=13 \end{gathered}[/tex]

Since w cannot be negative, the parking lot has a width of 13 yards.

Finally, find the length of the parking lot.

[tex]\begin{gathered} 13l=299 \\ l=\frac{299}{13}=23\text{ yards} \end{gathered}[/tex]

The length of the parking lot is 23 yards.

URGENT!! ILL GIVE
BRAINLIEST!!!!! AND 100 POINTS!!!!!

Order the numbers from least to greatest

Answers

Answer:

-1, √4/5, -6/5, √3, 2, -3√9, 2√125

Step-by-step explanation:

Other Questions
Please help me with this question. Write a proportional that relates the corresponding sides. You must use all of the sides for both triangles in your statement. $3.44 at the Farmers market at a grocery store the same oranges cost $8.40 for a bag of 20 find the better deal by calculating the unit rate for both locations how much would be saved per orange by purchasing oranges at the locations with the better deal solve the word problemFarmers market unit rate --------------grocery store unit rate ------------------better deal -------------how much is saved ------------A $0.01/ orangeslB $0.41 / orangeC grocery storeD Farmers marketE $0.43 / orangeF $0.40 / OrangeG $0.10 / Orange find the zeros algebraically: f(x)=x^4-8x^3+5x^2+14x How many grams of CO are produced when 33.0 g of C reacts? Fe2O3(s)+3C(s)2Fe(s)+3CO(g) A normal distribution has a mean of 101 and a standard Deviation of 12. find the probability that a value selected at random is in the following interval.at most 13 Geometry Problem - Given: segment AB is congruent to segment AD and segment FC is perpendicular to segment BD. Conclusion: Triangle AEG is isosceles. (Reference diagram in picture) Evaluate when n=5 4n Explain how stem cells differ from other kinds of cells. Give an example using plantsor animals. a prospective insured completes and signs an application for health insurance but intentionally conceals information about a pre-existing heart condition. the company issues the policy. two months later, the insured suffers a heart attack and submits a claim. while processing the claim, the company discovers the pre-existing condition. in this situation, the company will: Find the median and mean of the data set below:20, 46, 20, 26 I need to double check 15 I got answer B (Combining Equations)What is the result of subtracting the second equation from the first ? -4x - 2y = -2x - 2y = 9 A helicopter pilot sights a landmark an an angle of depression of 34. The altitudeof the helicopter is 1,748 feet. To the nearest foot, what is the horizontal distancefrom the helicopter to the landmark? solve the following system of equations-5x-3y=-16-3x+2y=-21x=y= the nurse is providing safety teaching to the family of an older adult client. which finding in the clients home will the nurse teach the family to address? two angles are a linear pair, and one has twice the measure of the other. Find the smaller angles measure PLEASE HELP ME!!!A)Nuclear fusion releases protons and neutrons, so the total number of protonsand neutrons in a star changes throughout its life.B)Nuclear fusion conserves protons and neutrons, so the total number of protonsand neutrons in a star changes throughout its life.C)Nuclear fusion releases protons and neutrons, so the total number of protonsand neutrons in a star remains the same throughout its life.D)Nuclear fusion conserves protons and neutrons, so the total number of protonsand neutrons in a star remains the same throughout its life. write an equation and solvefour times the complement of an angle is 40 lessthan twice the angles supplement. Find the angle,its complement, and its supplement price discrimination will result in consumers with more elastic demand purchasing more of the good than when a single price is charged to all consumers in the market. group startstrue or false