Answer:
A gentle wind or when the wind blows slowly, it is called a breeze.
Explanation:
Breezes are the result of differences in air temperature. Warm air rises, leaving behind low pressure near the ground. Cold air creates high pressure and sinks to compensate; wind then blows from areas of high pressure to areas of low pressure to try to equalize pressures.
Answer:
under low pressure of air makes wind blow weakly or very little.
are cation often ligand in complex ?
Answer:
To name a coordination compound, no matter whether the complex ion is the cation or the anion.
Explanation:
What part of the underside of a gecko's feet
allows it to stick to surfaces?
O cilia
O heat
O pillars
O webbing
Answer:
it was pillars
Explanation:
i guessed and it was right LOL
Answer:
O pillars
Explanation:
Right on EDGE 2021
11. Which of the following is a characteristic of all chemical changes? *
Answer:
i think A
Explanation:
definitely not c
a new substance is not always formed, like when you burn a piece of paper.
i am stuck between a and b :(
I need help with this question
I will give brainliest if you get it right
The balanced equation :
2HCl + Zn ⇒ ZnCl₂ + H₂
Further explanationGiven
Reaction(unbalanced)
HCl + Zn ⇒ ZnCl₂ + H₂
Required
Balanced equation
Solution
Give a cofficient(the most complex compound=1)
aHCl + bZn ⇒ ZnCl₂ + cH₂
Make an equation
Zn, left = b, right = 1⇒b=1
Cl, left = a, right = 2⇒a=2
H, left = a, right = 2c⇒2c=a⇒2c=2⇒c=1
The equation becomes :
2HCl + Zn ⇒ ZnCl₂ + H₂
What does an electric field
surround?
Answer:
An electric field is the physical field that surrounds each electric charge and exerts force on all other charges in the field, either attracting or repelling them.
Nitrogen forms more oxides than any other element. The percents by mass of N in three different nitrogen oxides are (I) 46.69%; (II) 36.85%; (III) 25.94%. For each compound, determine (a) the simplest whole-number ratio of N to O, and (b) the number of grams of oxygen per 1.00 g of nitrogen.
Answer:
[1]. NO; 1.14 g,
[2]. N₂O₃; 1.71 g,
[3]. N₂O₅; 2.86 g.
Explanation:
[1]. For the first oxide, there is 46.69% of Nitrogen and [100 - 46.69%] of Oxygen, that is 53.31% of oxygen. The simplest whole-number ratio of N to O = [46.69/14.01] ÷ [53.31/ 16] = 3.33/3.33 = 1 : 1.
Hence, Nitrogen =1 and oxygen is 1, the compound = NO.
The number of grams of oxygen per 1.00 g of nitrogen for this compound is calculated as below:
The number of grams of oxygen per 1.00 g of nitrogen for this compound = (1/ 0.4669) - 1 = 2.14 - 1 = 1.14 g.
[2]. For the second oxide, there is 36.85% of Nitrogen and [100 - 36.85%] of Oxygen, that is 63.15% of oxygen. The simplest whole-number ratio of N to O = [36.85/14.01] ÷ [63.15/ 16] = 2.63/3.94 = 1 : 1.5.
Hence, Nitrogen =1 and oxygen is 1.5. There is need to change it to whole number, therefore, when it is multiplied by 2, it gives 2:3. Therefore, the compound = N₂O₃.
The number of grams of oxygen per 1.00 g of nitrogen for this compound is calculated as below:
The number of grams of oxygen per 1.00 g of nitrogen for this compound = (1/ 0.3685) - 1 = 2.71 - 1 = 1.71 g.
(3). For the third oxide, there is 25.94% of Nitrogen and [100 - 25.94%] of Oxygen, that is 74.06% of oxygen. The simplest whole-number ratio of N to O = [25.94/14.01] ÷ [74.06/ 16] = 1.85/4.63= 1 : 2.5.
Hence, Nitrogen =1 and oxygen is 2.5. There is need to change it to whole number, therefore, when it is multiplied by 2, it gives 2:3. Therefore, the compound = N₂O₅.
The number of grams of oxygen per 1.00 g of nitrogen for this compound is calculated as below:
The number of grams of oxygen per 1.00 g of nitrogen for this compound = (1/ 0.2594) - 1 = 3.86 - 1 = 2.86 g
Which belongs in each place
Answer:
1. Oxygen Nitrogen
2. silicon Nitrogen
3. Carbon dioxide
Not sure about the 2nd one
Explanation:
prove me wrong
Read the descriptions below of two substances and an experiment on each. Decide whether the result of the experiment tells you the substance is a pure substance or a mixture, if you can.
Sample A is of a coarse grey powder with a faint unpleasant smell. of the powder is put into a funnel lined with a sheet of thick paper. Distilled water is poured slowly over the powder. Most of the powder disappears, but of a gritty black sand-like material is left on the surface of the paper. Pouring more water over the black material doesn't change how much of it there is.
Sample B is a solid yellow cube with a total mass of 50.0 g. The cube is put into a beaker filled with 250. mL of water. The cube collapses into a small pile of orange powder at the bottom of the beaker. When this powder is filtered out, dried and weighed, it has a total mass of 29.9 g. If the experiment is repeated with 500. mL of water, the powder that's left over has a mass of 10.0 g.
Answer:
Sample A - mixture
Sample B- Mixture
Explanation:
Looking at sample A, we can see that as water was poured over sample A, the sample was separated into its components as the powder disappeared leaving behind a gritty black sand-like material on the surface of the paper. A separation of the mixture has taken place.
In sample B, we can clearly see that it is a mixture because the amount of solid recovered is much less than the total mass of the solid put into the beaker. The sample must have been separated into its components.
Help!! Ilgive brainliest
Isobutyl propionate is the substance that provides the flavour for rum extract. Combustion of a 1.152 g sample of C-H-O compound yields 2.726 g CO2 and 1.116 g H2O. What is the E.F of the compound?
Answer:
C₇H₁₄O₂
Explanation:
From the question given above, the following data were obtained:
Mass of compound = 1.152 g
Mass of CO₂ = 2.726 g
Mass of H₂O = 1.116 g
Empirical formula =?
Next, we shall determine the mass of carbon, hydrogen and oxygen present in the compound. This can be obtained as follow:
For carbon (C):
Mass of CO₂ = 2.726 g
Molar mass of CO₂ = 12 + (2×16)
= 12 + 32
= 44 g/mol
Mass of C = 12/44 × 2.726
Mass of C = 0.743 g
For hydrogen (H):
Mass of H₂O = 1.116 g
Molar mass of H₂O = (2×1) + 16
= 2 + 16
= 18 g/mol
Mass of H = 2/18 × 1.116
Mass of H = 0.124 g
For oxygen (O):
Mass of compound = 1.152 g
Mass of C = 0.743 g
Mass of H = 0.124 g
Mass of O =?
Mass of O = (Mass of compound) – (Mass of C) + (Mass of H)
Mass of O = 1.152 – (0.743 + 0.124)
Mass of O = 1.152 – 0.867
Mass of O = 0.285 g
Finally, we shall determine the empirical formula for the compound as follow:
C = 0.743 g
H = 0.124 g
O = 0.285 g
Divide by their molar mass
C = 0.743 / 12 = 0.062
H = 0.124 / 1 = 0.124
O = 0.285 / 16 = 0.018
Divide by the smallest
C = 0.062 / 0.018 = 3.44
H = 0.124 / 0.018 = 7
O = 0.018 / 0.018 = 1
Multiply by 2 to express in whole number.
C = 3.44 × 2 = 7
H = 7 × 2 = 14
O = 1 × 2 = 2
Empirical formula => C₇H₁₄O₂
Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type
The reaction between Pb(NO₃)₂ (lead(II) nitrate) and K₂CrO₄ (potassium chromate) can be classified as a double displacement or precipitation reaction.
In this reaction, the lead(II) ion (Pb²⁺) from Pb(NO3)2 combines with the chromate ion (CrO₄²⁻) from K₂CrO₄ to form lead(II) chromate (PbCrO₄). Meanwhile, the potassium ion (K⁺) from K₂CrO₄ combines with the nitrate ion (NO₃⁻) from Pb(NO₃)₂ to form potassium nitrate (KNO₃).
The balanced chemical equation for the reaction is:
Pb(NO₃)₂ + K₂CrO₄ → PbCrO₄ + 2KNO₃
In this equation, the subscripts and coefficients are used to balance the number of atoms on each side of the equation to satisfy the law of conservation of mass.
To learn more about the precipitation reaction, follow the link:
https://brainly.com/question/28182226
#SPJ6
13 Elements within the same main groups (1-8)
I WILL GIVE BRAINLTIST THING OR WHATEVER IT'S CALLED
Which of the following objects would have the greatest gravitational attraction between them if they were set 3.0 km apart?
A .20kg object and a 200kg object
A 10kg object and a 100kg object
A 30kg object and a 200,000kg object
A 400,000 kg object and a 100,000,000kg object
Answer:
A 400,000 kg object and a 100,000,000kg object
Explanation:
The objects with the most mass between them will have the greatest gravitational attraction.
This is why the last option is the right choice.
The reason for this is based on the Newton's law of universal gravitation which states that:
"the gravitational force of attraction between two bodies is directly proportional to the product of their masses and inversely proportional to the square of the distance between them".
So, the more the mass, the greater the gravitational attraction between two bodies.
19. Which of the following has 3 significant figures? 0.0730 O 300 4003
Answer:
0.0730
Explanation:
decimal 0s don't count except for ones at the end
NEED HELP!
C=46.67%, H=4.48%, N=31.10%, O=17.76%.
The molecular weight is 180.16g/mol.
Answer:
[tex]C_7H_8N_4O_2[/tex]
Explanation:
Hello!
In this case, since the determination of an empirical formula is covered by first computing the moles of each atom as shown below:
[tex]n_C=\frac{46.47g}{12g/mol}=3.9mol\\\\ n_H=\frac{4.48g}{1g/mol} =4.5mol\\\\n_N=\frac{31.10g}{14g/mol} =2.2mol\\\\n_O=\frac{17.76g}{16g/mol} =1.1mol[/tex]
Now, we divide each moles by the fewest moles (those of oxygen), to obtain the subscripts in the empirical formula:
[tex]C:\frac{3.9}{1.1}=3.5 \\\\H:\frac{4.5}{1.1}=4 \\\\N:\frac{2.2}{1.1} =2\\\\O:\frac{1.1}{1.1} =1[/tex]
Thus, the empirical formula, taken to the nearest whole subscript is:
[tex]C_7H_8N_4O_2[/tex]
Whose molar mass is 180.16, therefore the empirical formula is the same to the molecular one.
Best regards!
After a reaction went to completion, the crude reaction mixture consisted of two compounds, A and B, which were isolated by extraction. After each compound was dried, their masses were found to be, 117 mg of compound A and 89 mg of compound B. Both compounds were individually recrystallized and weighed again. After recrystallization, the mass of compound A was 93 mg and the mass of compound B was 83 mg. Calculate the percent recovery from recrystallization for both compounds
Answer:
See explanation
Explanation:
Mass of impure compound A = 117 mg
Mass of impure compound B = 89 mg
Mass of pure compound A = 93 mg
Mass of pure compound B = 83 mg
Percentage recovery of pure compound A = 93 mg/117 mg * 100 = 79.5 %
Percentage recovery of pure compound B = 83mg/89 mg * 100/1 = 93.3 %
Calculate the volume of a box, in cubic centimeters, which is 423 cm long, 12 cm wide, and 25 cm high. Report your answer with correct significant figures in cubic centimeters.
Answer:
130,000 cubic centimeters
Explanation:
The volume of a box is its length multiplied by its width multiplied by its height (lwh). 423 times 12 times 25 is 126,900. When multiplying, the number of significant figures is the same as the number with the least number of significant figures. The correct number of significant figures in this example is 2, so 126,900 would need to round up to 130,000 in order to have 2 significant figures.
The volume of an object is given by length * width * height
In order to obtain the volume of a box, in cubic centimeters, we need to note the following parameters;
length = 423 cm
width = 12 cm
height = 25 cm
Volume = length * width * height
Volume = 423 cm * 12 cm * 25 cm
Volume = 127000 cubic centimeters.
Learn more: https://brainly.com/question/23526372
A recipe for spaghetti souce requires 2.5 cups of tomato sauce. If only metric measures are available, how many milliliters of tomato sauce are needed?(1qt = 4 cups, 1q = 946 mL)
Answer:
591.25ml
Explanation:
4 cups=946ml
0.5cups=946÷8=118.25ml
2.5cups=118.25ml*5=591.25ml
please i need it Lab: Calorimetry and Specific Heat
Answer:
step3:
aluminum- 11.98
copper-12.14
iron- 12.31
lead- 12.46
step5: 12.46, 52.31, 39.85
step7: 100, 22.4, 27.1, 4.7, 72.9
step5: 12.26, 52.49, 40.13
step7: 100, 22.7, 24.6, 1.9, 75.4
step5: 12.42, 52.66, 40.24
step7: 100, 22.5, 24.9, 2.4,75.1
step5: 12.34, 51.99, 39.65
step7: 100, 22.6, 23.3, 0.7, 76.7
step8: 0.90,0.35,0.44,0.12
All the following process lead to a decrease in salinity of seawater except for A. melting of sea Ice B. Precipitation C. runoff D. evaporation
A cup of water contains 13.9 moles of water. How many molecules of water are in the cup.
Answer:
The density of water is 1 gram per cc, so 1 mole of water takes 18cc of volume. 1 cup is approximately 250ml (i.e. 250cc) - so 1 cup will contain approximately 13.89 moles of water, which will contain approximately 8.36 x 1024 molecules of water.
Explanation:
1 mole of water requires 18cc of volume due to the density of water, which is 1 gram per cc. Since a cup contains roughly 250ml of liquid, it will likely contain 13.89 moles of water, or 8.36 × 10²⁴ molecules.
What is density ?
The mass of a substance per unit of volume is its density. Density is most frequently represented by the symbol, however the Latin letter D may also be used. The formula for density is mass divided by volume:
Because it enables us to predict which compounds will float and which will sink in a liquid, density is a crucial notion. As long as an object's density is lower than the liquid's density, it will often float.
One of an object's most significant and practicable physical characteristics is density. Densities are frequently used to distinguish between pure materials, as well as to describe and infer the composition of various types of mixes.
Thus, 1 mole of water requires 18cc of volume due to the density of water, 8.36 × 10²⁴ molecules of water are in the cup.
To learn more about density, follow the link;
https://brainly.com/question/6107689
#SPJ2
Balance the following equation: AlCl3+Mg-> MgCl2+Al
Answer:
Aluminum Chloride+Magnesium=Magnesium Chloride+Aluminum
How many grams of copper (II) fluoride (CuF2) are needed to make 9.66 liters of a 2.73 M
solution?
Mass of Copper (II) fluoride needed = = 2677.87 g
Further explanationGiven
9.66 L of 2.73 M Copper (II) fluoride
Required
Mass
Solution
Molarity : mol solutes per liters of solution
M = n : V
n = mol solute
V = volume of solution
mol Copper (II) fluoride :
= M x V
= 2.73 M x 9.66 L
= 26.3718 mol
Mass Copper (II) fluoride :
= mol x MW CuF₂
= 26.3718 mol x 101,543 g/mol
= 2677.87 g
Which of the following conclusions can be drawn from the curves in the
energy diagram?
A. The reaction represented by curve B has a larger equilibrium
constant than curve A.
B. The molecules represented in curve A have higher kinetic energy
than curve B.
C. The reaction represented by curve B will go faster than the curve A
reaction.
D. The reaction represented by curve A requires less added energy
than curve B
Answer:
The answer is C
Explanation:
just had this :)
The conclusion that can be drawn from the curves in the energy diagram is the reaction represented by curve B will go faster than curve A reaction. The correct option is C.
What is an energy diagram?An energy diagram is one that shows the transfer of energy or the use of energy. The change in the energy in a chemical reaction is shown by the energy diagram. It is also called a reaction progress curve.
The curve of an energy diagram is shown here, a person is bicycling here, and curve A is higher than curve B. So more amount of energy will be needed for bicycling in curve A, and less amount of energy is needed for curve B.
Thus, the correct option is C, the reaction represented by curve B will go faster than the curve A reaction.
Learn more about the energy diagram, here:
https://brainly.com/question/12867395
#SPJ5
helpo pls rnn only have 5 min
The percent
composition of an
unknown substance is
75.42 % Carbon, 6.63
% Hydrogen, 8.38 %
Nitrogen, and 9.57 %
Oxygen. If its molar
mass is 668.0 g/mole
what is its molecular
formula?
Answer:
mass of the empirical formula is 259.64 g/mol. = 519 g/mol
Explanation:
The molecular formula is Hg2C4H6O4. One of the most deadly poisons, strychnine, has a formula weight of 334 g/mol and the composition 75.42% C, 6.63% H, 8.38% N; the rest is oxygen.
0.93 mol/L*1.85L
0.93 mol/L *0.225L
612.2g/0.36 mL
Answer:
(0.93 (mol / L)) * 1.85 L = 1.7205 moles
(0.93 (mol / L)) * 0.225 L = 0.20925 moles
(612.2 grams) / (0.36 mL) = 1700 555.56 kg / m^3
Explanation:
brainliest plzzzzzzzzz
Please help and try to explain if you can!
Answer: 4.76 * 10^2
476.
you bring the ending decimal to the first number and it takes you two hops to get the first number so that's what you put in the box after the 10
Humans have 46 chromosomes. A human egg cell has.
O 23 chromosomes
O 46 chromosomes
O 92 chromosomes
Explanation:
23 each from parents....total 46..
Which object represents a heterogeneous mixture?
A. Brass key
B. Metal rings
C. Aluminum pans
D. Steel wool
The heterogenous mixture among the following is steel wool because, steel is made of metal iron with the traces of carbon and other metals such as chromium, copper, nickel etc.
What is steel?Steel is an alloy made of iron strengthened with carbon. Steel is an essential alloy in industrial fields as well as in house holds. Most of the potteries and now made of steel. Steel is harder, resistant to chemical and corrosion and microbes.
A mixture is a combination of two or more components. A homogenous mixture is the one where all the components form a single phase without separation. For example salt solution.
Heterogenous mixtures are those, in which the individual components are in separate phases. Steel contains metals along with carbon and steel wool is a combination of cotton and the solid metal. Thus option D is correct.
To find more on steel, refer here:
https://brainly.com/question/29222140
#SPJ1
Which best describes the three general groups of elements?
Answer:
D
Explanation:
