What is the role of calcium ions in the release of a neurotransmitter substance?

X contains metallic bond

Y contains ionic bond

Z contains covalent bond

We know that the crystal structure of a compound would have to do with the way that the atoms and the elements that compose the compound could be said to have been arranged. Thus if a compound is said to have a crystal structure then we can say that the compound would be crystalline in nature as we can see from the table that we have in the question here.

The kind of bonds that we have in the compound is about one of things that can be able to determine whether or not the compound has a crystalline structure as we can see.

Looking at the properties of the compounds that have been shown in the bale that has been attached to the answer that we have here, we can be able to make a decision regarding each of the substances shown.

Learn more about crystal substances:https://brainly.com/question/28728101

#SPJ1

Answer:

9.990-357

Explanation:

aru not arh is 9.990-357

The process by which bacteria convert NH4 to NO3 to NO4 is called nitrification.

To learn more about nitrification refer to:

https://brainly.com/question/9366803

#SPJ1

Answer:

The object will have the smallest change in motion when an equal force is applied is 8kg circle.

Explanation:

Answer:8gk is the a 1

Option C, The electron transition from n = 5 to n = 1 in hydrogen atom requires the largest amount of energy as it is moving from a higher energy state to a lower energy state, thus overcoming the highest amount of electrostatic force of attraction to the nucleus.

In the hydrogen atom, the energy of an electron is related to its distance from the nucleus, which is characterized by the principal quantum number (n). As the distance of an electron from the nucleus increases, its energy decreases. Therefore, the electron transition that requires the largest amount of energy is when an electron jumps from the state with the lowest principal quantum number to the state with the highest principal quantum number.

From the options given, the transition that requires the largest amount of energy is c. From n = 5 to n = 1 because, in this case, the electron is transitioning from the state with the highest principal quantum number (n = 5) to the state with the lowest principal quantum number (n = 1). This transition requires the largest amount of energy because the electron must overcome the highest amount of electrostatic force of attraction to the nucleus.

It's important to notice that all the other options (a. from n=1 to n=2, b. from n=2 to n=3, d. from n=3 to n=5) are transitions that go to a lower n, meaning that the electron is getting closer to the nucleus and therefore lower energy state.

Learn more about the transition of electrons at

https://brainly.com/question/18156550?referrer=searchResults

#SPJ4

There are two types of chemical compound one is covalent compound and other is ionic compound, covalent compound formed by sharing of electron and ionic compound formed by complete transfer of electron. Therefore, the given statement is false.

Chemical Compound is a combination of molecule, Molecule forms by combination of element and element forms by combination of atoms in fixed proportion.

Carbon reacts with four Hydrogen's to form methane through covalent bonding. Each hydrogen donates one electron to Carbon therefore having a filled outer shell with 8 electrons.

Therefore, the given statement is false.

To learn more about chemical compound, here:

brainly.com/question/26487468

#SPJ1

Answer:1. 2methylbutene

Explanation:

i:  CH3CH2CH(CH3)CH2OH--H2SO4----------> CH3CH=C(CH3)CH3

      2-methyl butane-1-ol undergoes dehydration to form alkene in presence of an excess of concentrated sulphuric acid to form2-methylbut-2-ene

ii:                           CH3                        

                                I

                CH3CH2C=Ch2

iii: Shown in attach image

For mole details on dehydration of alcohol in excess of sulphuric acid

https://brainly.com/question/28321840

Equivalence point is dependent on stoichiometry of balanced reaction of acid and base. Stoichiometry only considers number of mols involved, not strength of reactants involved.

To ascertain how much of a specific drug is present in a sample, an experiment called a b is done. A diprotic acid is one that has a two-proton (H+) capacity per molecule. Two equivalence points—points at which the number of moles of acid and base are equal—are present when a diprotic acid is titrated with NaOH. When all of the acids have been neutralised, the first equivalence point is reached; meanwhile, the second equivalence point is reached when the surplus base has been neutralised. The amount of NaOH solution required to go from the first equivalence point to the second equivalence point is twice the amount required to travel from the first equivalence point to the first equivalence point.

Learn more about equivalence point here:

https://brainly.com/question/29999744

#SPJ4

NaCl has greater lattice energy as the size of anions is similar but the size of cation in NaCl is smaller than RbCl.

Lattice energy refers to the release of energy which occurs when the constituent atoms are placed in their respective positions on the crystal lattice. Additionally, it also refers to the amount of energy required to separate an ionic crystal into its component ions. Lattice energy is a measure of the ionic bond strength in an ionic compound. It is used to gain insight into different properties of ionic solids such as solubility, volatility, and hardness. Lattice energy is directly proportional to the ionic charges product and inversely proportional to the internuclear distance or the size of ions. When considering NaCl and RbCl the radius of Rb+ is greater than Na+, hence it will have less lattice energy. The cation with smaller radii exhibits higher lattice enthalpy.

Note: The question is incomplete. The complete question probably is: Why is the lattice energy of NaCl greater than the lattice energy of RbCl?

Learn more about Lattice energy:

https://brainly.com/question/8637149

#SPJ4

Sugar water is a homogeneous mixture. Therefore, option A is correct.

A mixture can be described as made up of two or more different substances which are physically combined in a mixture. A mixture of two or more substances can break down into their original components.

The composition of a heterogeneous mixture can not be uniform entire the mixture while the composition of a homogeneous mixture can be always the same.

Pure substances cannot be broken down into simple substances that have only one kind of atom in the entire composition.

A pure substance can be described as made up of two or more elements that are chemically combined together and has a set composition such type of pure substance is called a compound.

As the sugar completely dissolved in water so it is a homogeneous mixture.

Learn more about mixture, here:

brainly.com/question/6243623

#SPJ1

Your question is incomplete, the complete question was,

Which of the following is a homogeneous mixture

A ) sugar solution

B) Mud

C) dirt

D) salsa

a) There are 26 valance electrons in [tex]NF_{3}[/tex] .

b) The central atom bears all the other atoms

c)  CO₂ - Carbon is the central atom

[tex]PH_{3}[/tex] - Phosphorus is the central atom

SiO₂ - Silicon is the central atom.

We have to note that when we talk about the valence electrons, we mean the electrons that tend to occupy the valance shells of the atoms of the elements.

In the case of the compound that has been shown in the question,[tex]NF_{3}[/tex] has about 26 valence electrons and this can be shwn from the Lewis structure of the compound shown.

The term central atom has to do with the atom to which all of the other atoms or groups can be seen to be attached.

Learn more about central atom:https://brainly.com/question/29422259

#SPJ1

The heat that is absorbed by the system is  1363 J. Option B

We know that in a chemical reaction that there could be the absorption or the evolution of heat. We say that there is the evolution of heat when heat has been lost from the system and there is the absorption of heat when heat has been gained by the system.

Number of moles of the barium hydroxide hydrate = 3.15 g/203 g/mol

= 0.015 moles

Number of moles of the ammonium thiocyanate = 1.52/76 g/mol

= 0.02 moles

If 1 mole of barium hydroxide hydrate reacts with 2 moles of  ammonium thiocyanate

0.015 moles of barium hydroxide hydrate reacts with 0.015 * 2 moles/1 mole

= 0.03 moles

Hence the limiting reactant is the ammonium thiocyanate.

Now the heat that is absorbed is;

H = mcdT

m = mass of the water

c = Heat capacity

dT = Temperature change

H = 100 * 4.20 * 3.1

H = 1363 J

Learn more about heat capacity:https://brainly.com/question/28302909

#SPJ1

In the image below, the formally charged carbon in molecule 1 has 2 hydrogen(s) attached and the formally charged carbon in molecule 2 has 1 hydrogen(s) attached.

Molecule 1 features a carbon atom with two hydrogen atoms attached, while molecule 2 features a carbon atom with just one hydrogen atom attached.

Both molecules have a formally charged carbon, making them unique among the many types of molecules available. With the difference in hydrogen attachment, both molecules offer distinct characteristics and benefits.

This difference in the number of hydrogen atoms affects the molecules' overall structure and properties.

To learn more about hydrogen, click here:

https://brainly.com/question/24433860

#SPJ4

The indicator used for the titration of base  NaOH with a strong acid is o-cresol phthalein and phenolphthalein due to clear colour intensity variation during titration.

When an o-cresolphtahlein indicator is mixed with the basic solution gives the light red colour to dark red with increased pH values. similarly, phenolphthalein gives reddish-orange colour. Titration is a technique used to evaluate an unknown substance concentration in a solution. It entails adding a known concentration of a solution, known as the titrant, gradually to a known volume of the object being studied, known as the analyte or titrand. The endpoint of the titration is the point at which the two solutions are chemically balanced. Acid-base titrations involve an acid and a base reacting to produce salt and water. Transferring electrons from one species to another is a component of redox titrations.

Hence, titration is neutralization reaction of acid and bases.

To know more about Neutralization.

https://brainly.com/question/27891712

#SPJ4

An operational definition is the statement of procedures the researcher is going to use to measure a specific variable.

Researchers can explain in detail what they mean when they use a phrase by using an operational definition. Operational definitions are typically measurable and concrete. This method of defining variables enables others to assess the validity of the study. Operationalization is the procedure in question.

The variables you'll utilize as indicators and the methods you'll employ to observe or measure them are both included in your operational definitions. No matter how solid your conceptual definition may be, you need an operational definition since without one, you cannot measure anything.

Operational variables, also known as operationalizing definitions, describe how you'll quantify and define a particular variable when it's applied to your research. This makes it possible for a different psychologist to duplicate your findings and is crucial in establishing.

To learn more about the operational visit  :

https://brainly.com/question/28446221

#SPJ1

The mass of [tex]NO_2[/tex], in grams, that would be produced by the reaction will be 118.68 grams.

First, let's write out the balanced equation of the reaction:

[tex]4NH_3 (g) +7O_2 (g) -- > 4NO_2 (g) + 6H_2O(g)[/tex]

From the equation, the mole ratio of [tex]NH_3[/tex] and [tex]NO_2[/tex] is 1:1.

Recall that, mole = mass/molar mass.

43.9 g of [tex]NH_3[/tex] = 43.9/17.03

                        = 2.58 mol

Thus, from the 1:1 mole ratio, the equivalent mole of  [tex]NO_2[/tex] produced from the reaction would be 2.58 mol.

Since, mass = mole x molar mass, the mass of 2.58 mol of  [tex]NO_2[/tex] can be calculated as:

2.58 x 46.0 = 118.68 grams.

In other words, the amount of  [tex]NO_2[/tex] produced by the reaction of 43.9 g of [tex]NH_3[/tex] according to the chemical equation would be 118.68 grams.

More on stoichiometric problems can be found here: https://brainly.com/question/29841194

#SPJ1

The R/S isomer is decided on the basis of the attached group atomic number to chiral atom.

the R/S configuration is the nomenclature used to describe the enantiomer of chiral molecules. The absolute configuration of chiral substances is another name for this arrangement. the atom attached to the chiral centre is marked based on atomic number. Higher atomic number objects will be given lesser numbers. Place the chiral centre so that the atom with the lowest priority is pointed away from the observer. The absolute configuration is R if the arrow moves in a clockwise direction. Additionally, the absolute configuration is S if the arrow is moving anticlockwise. This is followed when the lower priority group are present in a vertical position and reversed is followed in case of the horizontal direction.

Hence, absolute configuration directly influenced by priority group

To know more about Nomenclature.

https://brainly.com/question/14252523

#SPJ4

The connected group atomic number to the chiral atom determines the R/S isomer.

The enantiomer of chiral compounds is designated by the nomenclature R/S configuration. Another name for this configuration is the absolute configuration of chiral compounds. Based on its atomic number, the atom that is joined to the chiral center is identified. Lesser numbers will be assigned to items with higher atomic numbers. Put the chiral center in such a way that the atom with the lowest priority faces the viewer. If the arrow turns clockwise, the absolute configuration is R. Additionally, if the arrow is travelling counterclockwise, the absolute configuration is S. When the lower priority group is present and is positioned vertically, this happens.

Learn more about chiral here-

https://brainly.com/question/13667509

#SPJ4

The heat absorbed by the ice is given by the formula: heat = mass * specific heat capacity * change in temperature.

The mass of the ice is 165g. The specific heat capacity of water is 4.18 J/g°C. The change in temperature is 37.0°C - 0.0°C = 37.0°C.

The heat absorbed by the ice is: 165g * 4.18 J/g°C * 37.0°C = 29,894.5 J

To convert from J to kcal: 1 kcal = 4184 J. Therefore,

29,894.5 J / 4184 J/kcal = 7.13 kcal

The heat absorbed by the ice is 7.13 kcal

The symbol that represents that of an element is He. Option B.

Elements have their respective symbols in chemistry. For example, hydrogen is represented by H, and helium is represented by He. Carbon is represented by C, oxygen by O, fluorine by F, and nitrogen by N.

Thus, CO is a combination of carbon and oxygen, HF is a combination of hydrogen and fluorine, and NO is a combination of nitrogen and oxygen. They are known as carbon monoxide, hydrogen fluoride, and nitrogen oxide respectively.

In other words, the only symbol that represents that of an element is He which symbolizes helium.

More on symbols of elements can be found here: https://brainly.com/question/14678810

#SPJ1

The number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution is 0.16.

Option B is correct.

The first step to take is  figure out how many moles of magnesium chloride were needed to make this solution.

We use the compound's molar mass, which essentially tells us the mass of one mole of magnesium chloride which is 0.01996 moles MgCl2

Each mole of magnesium chloride will produce  2 moles of chloride anions in solution.

0.01996 x 2 moles Cl− = 0.03992 moles of Cl−

Therefore the number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution is 0.03992/ 250 ml

=0.16 moles of Cl

molarity tells us the number of moles of solute you get per liter of solution, we can conclude that the molarity of the chloride anions will be 0.16

Learn more about moles at: https://brainly.com/question/13314627

#SPJ1

Oxygen is a molecule that is essential for life. It is a colorless, odorless gas that makes up about 20% of the air we breathe.

A molecule is a group of two or more atoms that are held together by chemical bonds. They are the basic building blocks of all matter, and are composed of protons, neutrons, and electrons.

When oxygen is dissolved in water, it can be absorbed by aquatic organisms such as fish. These aquatic organisms use the oxygen to help them with their metabolic processes. When the levels of oxygen in the water are too low, the organisms are not able to survive and may die. Low oxygen levels can occur naturally due to environmental factors like temperature or seasonality, or they can be caused by human activities such as pollution. It is important to keep oxygen levels in the water high to ensure the health of aquatic ecosystems.

To learn more about molecule
https://brainly.com/question/1078183
#SPJ1

A reaction has an enthalpy change of +14 kJ mol-¹ entropy change of +37 J K-¹ mol-¹. the temperature is 378105.2284°C.

Generally, To determine the temperature at which an endothermic reaction becomes spontaneous, you need to use the entropy change of the reaction and the enthalpy change of the reaction. This can be done using the equation:

ΔG = ΔH - TΔS

Where

If the ΔG for a reaction is negative, then the reaction is spontaneous. If the ΔG for a reaction is positive, then the reaction is not spontaneous.

In this case, we are given that the enthalpy change for the reaction is +14 kJ/mol and the entropy change for the reaction is +37 J/K*mol.

We can use this information to solve for the temperature at which the reaction becomes spontaneous

ΔG = ΔH - TΔS

0 = +14 kJ/mol - T(+37 J/Kmol)

T = 14000 J/mol / (37 J/Kmol*1/1000)

T = 378378.3784 K

Thus, the temperature at which this endothermic reaction becomes spontaneous is approximately 378378.3784 K, which is approximately 378105.2284°C.

Read more about temperature.

https://brainly.com/question/11464844

#SPJ1

The molarity of the solution is 0.00016 M

To determine the molarity of a solution, you need to know:

From the information you provided, the concentration of the solution is given in parts per million (ppm). To convert from ppm to molarity, you need to know:

The molecular weight of glucose is 180.16 g/mol. If the solvent is water, the density is about 1 g/mL. Here is the conversion calculation:

1 ppm = 1 mg/L = (1/180.16 g/mol) / (1 g/mL) = 5.55 x 10^-6 mol/L

So, the molarity of the solution is: 2.89 ppm * 5.55 x 10^-6 mol/L/ppm = 1.60 x 10^-4 mol/L = 0.00016 M

Learn more about Molarity here:

https://brainly.com/question/14469428

Answer:

Explanation:

Before telling the answer remember some terminology

molarity=No. of moles of solute/Volume of the solution in liters

M=n/V

n=Mass of solute(w)/Molecular mass(M)

V=volume of solution(v)/1000

ppm =(parts per million)

ppm of solute=(mass of solute/mass of solution)*10^{6}

2.89gms of solute in 1000000 of solution

5.22gm of solute

5.22in 1000 gms in litre=5220g[tex]L^{-1}[/tex]

2.89 gms are present in 2.59/5220=5.5363*[tex]10^{-4}[/tex]

Hence the molarity of the solution is 5.5363*[tex]10^{-4}[/tex]mol [tex]L^{-1}[/tex]

Answer:

780

Explanation:

AT first this question looks difficult but if you read it closely its simple. so what we know is that for ever 60 miles he drives 13 hours. So all we have to do is mulyiply 60x13.

The pairs of solutions that produces a precipitate when combined are  [tex]Cu(NO_{3})_{2}[/tex] and [tex]K_{2} CO_{3}[/tex]3. So the correct option is B.

A precipitate is a solid that is created from a solution in an aqueous state in which two chemicals react. The precipitate then, once formed, will remain floating in solution. If you intervene in the process by putting the solution in a centrifuge, it will press the mass to the bottom of the tube, generating a compact mass.

The generation of the precipitate can be generated only if the characteristics of the compounds will overcome the solubility that it has to be able to generate a reaction.

All this will be generated because in the solution there will be components which will generate a chemical reaction between two ionic compounds. For this reason, the correct option will be B. [tex]Cu (NO_{3}) _{2}[/tex] and [tex]K_{2} CO_{3}[/tex].

To learn more about precipitate visit: https://brainly.com/question/29871773

#SPJ1

Answer:

Polar covalent bond

Explanation:

as Ra only has two extra electrons on another outside ring is does not take much to switch over i believe thats how it works

Answer:

See attachment for graph.

The function is not continuous.

Step-by-step explanation:

Piecewise functions have multiple pieces of curves/lines where each piece corresponds to its definition over an interval.

Given piecewise function:

\begin{gathered}f(x)=\begin{cases} x-3 \;\;\;\;\: \text{if}\;\;\;x \leq -2\\4x+5 \;\;\; \text{if}\;\; \;x > -2 \end{cases}\end{gathered}

f(x)={

x−3ifx≤−2

4x+5ifx>−2

Therefore, the function has two definitions:

f(x) = x - 3 when x is less than or equal to -2.

f(x) = 4x + 5 when x is greater than -2.

When graphing piecewise functions:

Use an open circle where the value of x is not included in the interval.

Use a closed circle where the value of x is included in the interval.

Use an arrow to show that the function continues indefinitely.

First piece of the function

Substitute x = -2 into the first function:

\implies f(-2)=-2-3=-5⟹f(−2)=−2−3=−5

As the interval for the first equation is x ≤ -2, it includes the value of x = -2. Therefore, place a closed circle at point (-2, -5).

To help graph the line, find another point on the line by inputting another value of x that is less than -2 into the same function:

\implies f(-5)=-5-3=-8⟹f(−5)=−5−3=−8

Plot point (-5, -8) and draw a straight line from the closed circle at (-2, -5) through (-5, -8). Add an arrow at the other endpoint to show it continues indefinitely as x → -∞.

Second piece of the function

Substitute x = -2 into the second function:

\implies f(-2)=4(-2)+5=-3⟹f(−2)=4(−2)+5=−3

As the interval for the second equation is x > -2, it does not include the value of x = -2. Therefore, place an open circle at point (-2, -3).

To help graph the line, find another point on the line by inputting another value of x that is more than -2 into the same function:

\implies f(1)=4(1)+5=9⟹f(1)=4(1)+5=9

Plot point (1, 9) and draw a straight line from the open circle at (-2, -3) through (1, 9). Add an arrow at the other endpoint to show it continues indefinitely as x → ∞.

See attachment for the graph.

\begin{gathered}\boxed{\begin{minipage}{8cm}\underline{Determining if a function is continuous at $x=a$}\\\\Condition 1: $f(a)$ exists\\\\Condition 2: $\displaystyle \lim_{x \to a}f(x)$ exists at $x=a$\\\\Condition 3: $\displaystyle \lim_{x \to a}f(x)=f(a)$\\\end{minipage}}\end{gathered}

If all three conditions are satisfied, the function is continuous at x = a.

If any one of the conditions is not satisfied, the function is not continuous at x = a.

To determine whether or not the given piecewise function is continuous, find if the function is continuous at x = -2.

Condition 1

Does f(-2) exist? Yes → f(-2) = -5

Condition 2

\textsf{Does}\;\;\displaystyle \lim_{x \to -2} f(x)\;\; \sf exist\;at\;\;x=-2?Does

x→−2

lim

f(x)existatx=−2?

To the left of x =- 2, f(x) = x - 3

To the right of x = -2 , f(x) = 4x + 5

Evaluate the left and right limits as x approaches -2:

\displaystyle \lim_{x \to -2^-}f(x)=\lim_{x \to -2^-} -2-3=-5

x→−2

−

lim

f(x)=

x→−2

−

lim

−2−3=−5

\displaystyle \lim_{x \to -2^+}f(x)=\lim_{x \to -2^+} 4(-2)+5=-3

x→−2

+

lim

f(x)=

x→−2

+

lim

4(−2)+5=−3

\textsf{As}\;\;\displaystyle \lim_{x \to -2^-} f(x) \neq \lim_{x \to -2^+} f(x), \;\; \lim_{x \to -2} f(x)\;\; \textsf{does not exist}.As

x→−2

−

lim

f(x)



=

x→−2

+

lim

f(x),

x→−2

lim

f(x)does not exist.

As condition 2 fails, there is no need to proceed to condition 3.

Therefore, the function is not continuous.

Answer:

A possible element with ns2np4 valence orbital is Oxygen(O)
A element that has the most electronegativity and soft is flourine(F)
for part C, it is scandium (Sc) with the last electron filled in the 3d orbital

S waves have a frequency of 2.5Hz, a wavelength of 600 m, and an average speed of 2.5 × 600 = 1500.

Wave speed is the amount of space a wave covers in a certain length of time, such as how many metres it covers in a second. Speed = Wavelength x Frequency is the formula that links wave speed to wavelength and wave frequency. When wavelength and frequency are known, one may use this equation to determine the wave speed.

Frequency equals 600 Hz. Given that the sound speed in air is 340 m/s, the wavelength is calculated as wavelength = speed/frequency = 340/600 = 0.57 m. P19. The wavelength is two hurts into the frequency. After solving, we will obtain a lambda of 1.5 metres. Three metres per second is a velocity of v. So the water waves here move at a 3 metre per second rate. The equation linking wave speed, frequency, and wavelength is v=f since the frequency, f, is 1/T.

To learn more about wave refer to :

https://brainly.com/question/16610625

#SPJ1