When a solute is dissolved in a solvent, the resulting solution will have a higher boiling point than the pure solvent. The extent to which the boiling point is increased is dependent on the concentration of the solute and the type of solute.
In general, non-volatile solutes that have high molecular weights and strong intermolecular forces will cause a greater increase in the boiling point of a solvent than solutes that are volatile or have low molecular weights and weak intermolecular forces.
With this in mind, of the three solutes you listed, calcium chloride (CaCl₂) would cause the greatest increase in the boiling point of water. Calcium chloride is a non-volatile solute with a high molecular weight and strong ionic bonds, which contribute to its ability to increase the boiling point of water.
In contrast, sodium iodide (NaI) is a volatile solute with low molecular weight and relatively weak intermolecular forces, so it would cause a relatively small increase in the boiling point of water.
Potassium chloride (KCl) is also a non-volatile solute with a high molecular weight and strong ionic bonds. However, it would still cause a slightly smaller increase in the boiling point of water than calcium chloride because calcium chloride has a higher molecular weight and stronger intermolecular forces.
Learn more about Intermolecular Forces here: https://brainly.com/question/9328418
The addition of 3.15 g of Ba open parentheses OH close parentheses subscript 2 times 8 straight H subscript 2 straight O to a solution of 1.52 g of NH subscript 4 SCN in 100 g of water in a
The heat that is absorbed by the system is 1363 J. Option B
What is the heat absorbed?We know that in a chemical reaction that there could be the absorption or the evolution of heat. We say that there is the evolution of heat when heat has been lost from the system and there is the absorption of heat when heat has been gained by the system.
Number of moles of the barium hydroxide hydrate = 3.15 g/203 g/mol
= 0.015 moles
Number of moles of the ammonium thiocyanate = 1.52/76 g/mol
= 0.02 moles
If 1 mole of barium hydroxide hydrate reacts with 2 moles of ammonium thiocyanate
0.015 moles of barium hydroxide hydrate reacts with 0.015 * 2 moles/1 mole
= 0.03 moles
Hence the limiting reactant is the ammonium thiocyanate.
Now the heat that is absorbed is;
H = mcdT
m = mass of the water
c = Heat capacity
dT = Temperature change
H = 100 * 4.20 * 3.1
H = 1363 J
Learn more about heat capacity:https://brainly.com/question/28302909
#SPJ1
In which circumstance would a researcher need to first establish an operational definition in order to objectively assess its variable?
a.
researching the effects of salt on systolic blood pressure
b.
researching the effects of coffee on energy levels
c.
researching the effects of magnesium on the average number of hours of slept at night
d.
researching the effects of water on the metabolic rate
An operational definition is the statement of procedures the researcher is going to use to measure a specific variable.
Why do researchers use operational definitions of their terms?Researchers can explain in detail what they mean when they use a phrase by using an operational definition. Operational definitions are typically measurable and concrete. This method of defining variables enables others to assess the validity of the study. Operationalization is the procedure in question.
The variables you'll utilize as indicators and the methods you'll employ to observe or measure them are both included in your operational definitions. No matter how solid your conceptual definition may be, you need an operational definition since without one, you cannot measure anything.
Operational variables, also known as operationalizing definitions, describe how you'll quantify and define a particular variable when it's applied to your research. This makes it possible for a different psychologist to duplicate your findings and is crucial in establishing.
To learn more about the operational visit :
https://brainly.com/question/28446221
#SPJ1
PLEASE HELP
Which of the following is not related to global warming?
A) decreasing coral populations
B) declining sea ice levels
C) rising ocean tide levels
D) increasing land area on islands
Answer:
D) increasing land area on islands
Explanation:
Because one of the results of the global warming is rising sea level so it will not increase the land area on island.
In the image below, the formally charged carbon in molecule 1 has ___hydrogen(s) attached and the formally charged carbon in molecule 2 has___hydrogen(s) attached.
In the image below, the formally charged carbon in molecule 1 has 2 hydrogen(s) attached and the formally charged carbon in molecule 2 has 1 hydrogen(s) attached.
Molecule 1 features a carbon atom with two hydrogen atoms attached, while molecule 2 features a carbon atom with just one hydrogen atom attached.
Both molecules have a formally charged carbon, making them unique among the many types of molecules available. With the difference in hydrogen attachment, both molecules offer distinct characteristics and benefits.
This difference in the number of hydrogen atoms affects the molecules' overall structure and properties.
To learn more about hydrogen, click here:
https://brainly.com/question/24433860
#SPJ4
the volume required to get to the equivalence point is blank dependent on the concentration and volume of acid or base to be titrated and the base or acid used to do the titration because the equivalence point is blank the stoichiometry of the balanced reaction of the acid and base. the stoichiometry only considers the number of moles involved, blank the strength of the reactants involved.
Equivalence point is dependent on stoichiometry of balanced reaction of acid and base. Stoichiometry only considers number of mols involved, not strength of reactants involved.
To ascertain how much of a specific drug is present in a sample, an experiment called a b is done. A diprotic acid is one that has a two-proton (H+) capacity per molecule. Two equivalence points—points at which the number of moles of acid and base are equal—are present when a diprotic acid is titrated with NaOH. When all of the acids have been neutralised, the first equivalence point is reached; meanwhile, the second equivalence point is reached when the surplus base has been neutralised. The amount of NaOH solution required to go from the first equivalence point to the second equivalence point is twice the amount required to travel from the first equivalence point to the first equivalence point.
Learn more about equivalence point here:
https://brainly.com/question/29999744
#SPJ4
If 5.0g of H2 are reacted with excess CO, how many liters of 3.0 M CH3OH solution are produced? Co(g) + 2H2(g) —> CH3OH(1)
Answer:
See attachment for graph.
The function is not continuous.
Step-by-step explanation:
Piecewise functions have multiple pieces of curves/lines where each piece corresponds to its definition over an interval.
Given piecewise function:
\begin{gathered}f(x)=\begin{cases} x-3 \;\;\;\;\: \text{if}\;\;\;x \leq -2\\4x+5 \;\;\; \text{if}\;\; \;x > -2 \end{cases}\end{gathered}
f(x)={
x−3ifx≤−2
4x+5ifx>−2
Therefore, the function has two definitions:
f(x) = x - 3 when x is less than or equal to -2.
f(x) = 4x + 5 when x is greater than -2.
When graphing piecewise functions:
Use an open circle where the value of x is not included in the interval.
Use a closed circle where the value of x is included in the interval.
Use an arrow to show that the function continues indefinitely.
First piece of the function
Substitute x = -2 into the first function:
\implies f(-2)=-2-3=-5⟹f(−2)=−2−3=−5
As the interval for the first equation is x ≤ -2, it includes the value of x = -2. Therefore, place a closed circle at point (-2, -5).
To help graph the line, find another point on the line by inputting another value of x that is less than -2 into the same function:
\implies f(-5)=-5-3=-8⟹f(−5)=−5−3=−8
Plot point (-5, -8) and draw a straight line from the closed circle at (-2, -5) through (-5, -8). Add an arrow at the other endpoint to show it continues indefinitely as x → -∞.
Second piece of the function
Substitute x = -2 into the second function:
\implies f(-2)=4(-2)+5=-3⟹f(−2)=4(−2)+5=−3
As the interval for the second equation is x > -2, it does not include the value of x = -2. Therefore, place an open circle at point (-2, -3).
To help graph the line, find another point on the line by inputting another value of x that is more than -2 into the same function:
\implies f(1)=4(1)+5=9⟹f(1)=4(1)+5=9
Plot point (1, 9) and draw a straight line from the open circle at (-2, -3) through (1, 9). Add an arrow at the other endpoint to show it continues indefinitely as x → ∞.
See attachment for the graph.
\begin{gathered}\boxed{\begin{minipage}{8cm}\underline{Determining if a function is continuous at $x=a$}\\\\Condition 1: $f(a)$ exists\\\\Condition 2: $\displaystyle \lim_{x \to a}f(x)$ exists at $x=a$\\\\Condition 3: $\displaystyle \lim_{x \to a}f(x)=f(a)$\\\end{minipage}}\end{gathered}
If all three conditions are satisfied, the function is continuous at x = a.
If any one of the conditions is not satisfied, the function is not continuous at x = a.
To determine whether or not the given piecewise function is continuous, find if the function is continuous at x = -2.
Condition 1
Does f(-2) exist? Yes → f(-2) = -5
Condition 2
\textsf{Does}\;\;\displaystyle \lim_{x \to -2} f(x)\;\; \sf exist\;at\;\;x=-2?Does
x→−2
lim
f(x)existatx=−2?
To the left of x =- 2, f(x) = x - 3
To the right of x = -2 , f(x) = 4x + 5
Evaluate the left and right limits as x approaches -2:
\displaystyle \lim_{x \to -2^-}f(x)=\lim_{x \to -2^-} -2-3=-5
x→−2
−
lim
f(x)=
x→−2
−
lim
−2−3=−5
\displaystyle \lim_{x \to -2^+}f(x)=\lim_{x \to -2^+} 4(-2)+5=-3
x→−2
+
lim
f(x)=
x→−2
+
lim
4(−2)+5=−3
\textsf{As}\;\;\displaystyle \lim_{x \to -2^-} f(x) \neq \lim_{x \to -2^+} f(x), \;\; \lim_{x \to -2} f(x)\;\; \textsf{does not exist}.As
x→−2
−
lim
f(x)
=
x→−2
+
lim
f(x),
x→−2
lim
f(x)does not exist.
As condition 2 fails, there is no need to proceed to condition 3.
Therefore, the function is not continuous.
PLAEASEEEEEEE HELPPPPPP HURRY
Which object in the image will have the smallest change in motion when an equal force is applied? (2 points)
an eight kilogram circle,
five kilogram rectangle,
four kilogram triangle,
six kilogram square
8 kg circle
6 kg square
4 kg triangle
5 kg rectangle
Answer:
The object will have the smallest change in motion when an equal force is applied is 8kg circle.
Explanation:
Answer:8gk is the a 1
Identify the absolute configuration of the chirality centers in each of the following compounds as R or S. Note: if multiple chirality centers are present, indicate the stereochemical designations as: RR, SS, RS, or SR. (Other terms used for chirality center include chiral center, stereocenter, and stereogenic center.)
The R/S isomer is decided on the basis of the attached group atomic number to chiral atom.
the R/S configuration is the nomenclature used to describe the enantiomer of chiral molecules. The absolute configuration of chiral substances is another name for this arrangement. the atom attached to the chiral centre is marked based on atomic number. Higher atomic number objects will be given lesser numbers. Place the chiral centre so that the atom with the lowest priority is pointed away from the observer. The absolute configuration is R if the arrow moves in a clockwise direction. Additionally, the absolute configuration is S if the arrow is moving anticlockwise. This is followed when the lower priority group are present in a vertical position and reversed is followed in case of the horizontal direction.
Hence, absolute configuration directly influenced by priority group
To know more about Nomenclature.
https://brainly.com/question/14252523
#SPJ4
The connected group atomic number to the chiral atom determines the R/S isomer.
The enantiomer of chiral compounds is designated by the nomenclature R/S configuration. Another name for this configuration is the absolute configuration of chiral compounds. Based on its atomic number, the atom that is joined to the chiral center is identified. Lesser numbers will be assigned to items with higher atomic numbers. Put the chiral center in such a way that the atom with the lowest priority faces the viewer. If the arrow turns clockwise, the absolute configuration is R. Additionally, if the arrow is travelling counterclockwise, the absolute configuration is S. When the lower priority group is present and is positioned vertically, this happens.
Learn more about chiral here-
https://brainly.com/question/13667509
#SPJ4
Which of the following electron transitions in hydrogen atom will require largest amount of energy?
O From n = 1 to n = 2
O From n = 2 to n = 3
O From n = 5 to n = 1
O From n = 3 to n = 5
Option C, The electron transition from n = 5 to n = 1 in hydrogen atom requires the largest amount of energy as it is moving from a higher energy state to a lower energy state, thus overcoming the highest amount of electrostatic force of attraction to the nucleus.
In the hydrogen atom, the energy of an electron is related to its distance from the nucleus, which is characterized by the principal quantum number (n). As the distance of an electron from the nucleus increases, its energy decreases. Therefore, the electron transition that requires the largest amount of energy is when an electron jumps from the state with the lowest principal quantum number to the state with the highest principal quantum number.
From the options given, the transition that requires the largest amount of energy is c. From n = 5 to n = 1 because, in this case, the electron is transitioning from the state with the highest principal quantum number (n = 5) to the state with the lowest principal quantum number (n = 1). This transition requires the largest amount of energy because the electron must overcome the highest amount of electrostatic force of attraction to the nucleus.
It's important to notice that all the other options (a. from n=1 to n=2, b. from n=2 to n=3, d. from n=3 to n=5) are transitions that go to a lower n, meaning that the electron is getting closer to the nucleus and therefore lower energy state.
Learn more about the transition of electrons at
https://brainly.com/question/18156550?referrer=searchResults
#SPJ4
What is the role of calcium ions in the release of a neurotransmitter substance?
The emission of a transmitter is caused by the action of calcium ions, which also cause synaptic vesicle exocytosis, which releases the neurotransmitters inside the vesicles and starts synaptic transmission.
What functions does calcium ion serve in the body?Nearly all bodily biological processes, including heart and muscle pulses, neurotransmission of information, memories and learning baby creation, cell proliferation, and Calcium ions enter the cytoplasm of organelles through calcium channels.
Why are calcium ions necessary for the brain?Calcium plays a critical role in the brain's regulation of synaptogenesis and memory formation. This process activates certain calmodulin signal transmission pathways and involves important protein effectors such CaMKs, MAPK/ERKs, or CREB.
To know more about Calcium ions visit:
https://brainly.com/question/28186243
#SPJ4
Which one of the following symbols represent an element?
A. CO
B. He
C. HF
D. NO
The symbol that represents that of an element is He. Option B.
Symbols of elementsElements have their respective symbols in chemistry. For example, hydrogen is represented by H, and helium is represented by He. Carbon is represented by C, oxygen by O, fluorine by F, and nitrogen by N.
Thus, CO is a combination of carbon and oxygen, HF is a combination of hydrogen and fluorine, and NO is a combination of nitrogen and oxygen. They are known as carbon monoxide, hydrogen fluoride, and nitrogen oxide respectively.
In other words, the only symbol that represents that of an element is He which symbolizes helium.
More on symbols of elements can be found here: https://brainly.com/question/14678810
#SPJ1
Which of the following is a homogeneous mixture?l
Sugar water is a homogeneous mixture. Therefore, option A is correct.
What are the mixtures?A mixture can be described as made up of two or more different substances which are physically combined in a mixture. A mixture of two or more substances can break down into their original components.
The composition of a heterogeneous mixture can not be uniform entire the mixture while the composition of a homogeneous mixture can be always the same.
Pure substances cannot be broken down into simple substances that have only one kind of atom in the entire composition.
A pure substance can be described as made up of two or more elements that are chemically combined together and has a set composition such type of pure substance is called a compound.
As the sugar completely dissolved in water so it is a homogeneous mixture.
Learn more about mixture, here:
brainly.com/question/6243623
#SPJ1
Your question is incomplete, the complete question was,
Which of the following is a homogeneous mixture
A ) sugar solution
B) Mud
C) dirt
D) salsa
5. Find the sum of all the valence electrons for NF, (Add how many valence electrons one nitrogen atom has with the
valence electron for three fluorine atoms.)
6. How many valence electrons are in the drawing of NF, above?
7. In CCL, carbon is the "central atom". In NF3 nitrogen is the "central atom". What is meant by "central atom"?
8. In SF₂ sulfur is the central atom. You can tell which atom is the central atom simply by looking at the formula.
What is meant by "central atom"?
9. Identify the central atom in each of the following molecules:
a. CO₂
b. PH3
c. SiO₂
a) There are 26 valance electrons in [tex]NF_{3}[/tex] .
b) The central atom bears all the other atoms
c) CO₂ - Carbon is the central atom
[tex]PH_{3}[/tex] - Phosphorus is the central atom
SiO₂ - Silicon is the central atom.
What are the valence electrons?We have to note that when we talk about the valence electrons, we mean the electrons that tend to occupy the valance shells of the atoms of the elements.
In the case of the compound that has been shown in the question,[tex]NF_{3}[/tex] has about 26 valence electrons and this can be shwn from the Lewis structure of the compound shown.
The term central atom has to do with the atom to which all of the other atoms or groups can be seen to be attached.
Learn more about central atom:https://brainly.com/question/29422259
#SPJ1
What is the density of 1 mole of water
Carbon reacts with four Hydrogen's to form methane through ionic bonding. Each hydrogen donates one electron to Carbon therefore having a filled outer shell with 8 electrons.
True
False
Lithium has an oxidation of +1, and Fluorine an oxidation of -1, therefore if they reacted they would only need one atom of each to become stable.
Question 4 options:
True
False
If Magnesium and chlorine reacted, it would require two Magnesium and one chlorine to become stable.
Question 5 options:
True
False
If Calcium reacts with Nitrogen, the proper ratio of atoms to become stable would be 3 calcium's and two Nitrogen's.
Question 6 options:
True
False
When water forms, two hydrogen atoms covalently bond with one oxygen atom, and Hydrogen through this electron sharing takes on the electron configuration of helium (duet), and oxygen takes on the electron configuration of Neon (Octet).
Question 7 options:
True
False
There are two types of chemical compound one is covalent compound and other is ionic compound, covalent compound formed by sharing of electron and ionic compound formed by complete transfer of electron. Therefore, the given statement is false.
What is chemical Compound?Chemical Compound is a combination of molecule, Molecule forms by combination of element and element forms by combination of atoms in fixed proportion.
Carbon reacts with four Hydrogen's to form methane through covalent bonding. Each hydrogen donates one electron to Carbon therefore having a filled outer shell with 8 electrons.
Therefore, the given statement is false.
To learn more about chemical compound, here:
brainly.com/question/26487468
#SPJ1
NaOH
a. bromocresol green or methyl red
b. alizarin, bromthymol blue or phenol red
c. erythrosin B or 2,4-dinitrophenol
d. 2,4-dinitrophenol or bromphenol blue
e. o-cresolphthalein or phenolphthalein
The indicator used for the titration of base NaOH with a strong acid is o-cresol phthalein and phenolphthalein due to clear colour intensity variation during titration.
When an o-cresolphtahlein indicator is mixed with the basic solution gives the light red colour to dark red with increased pH values. similarly, phenolphthalein gives reddish-orange colour. Titration is a technique used to evaluate an unknown substance concentration in a solution. It entails adding a known concentration of a solution, known as the titrant, gradually to a known volume of the object being studied, known as the analyte or titrand. The endpoint of the titration is the point at which the two solutions are chemically balanced. Acid-base titrations involve an acid and a base reacting to produce salt and water. Transferring electrons from one species to another is a component of redox titrations.
Hence, titration is neutralization reaction of acid and bases.
To know more about Neutralization.
https://brainly.com/question/27891712
#SPJ4
M
N
Poetry in Numbers
by Janet Costa Bates
23
1/2
Noni stared at the blank page on the library's computer
screen, unable to think of a single idea for the poetry
collection her English class was creating. She had put off
the assignment for an entire week, and now she felt the
deadline looming.
I have a math mind, not a poetry mind, she thought.
She could solve an equation by following a sequence of
logical steps. The steps were already outlined, so she
didn't have to make any difficult choices. By always
applying the proper effort as well as the right calculations,
the correct answer would be reliably waiting. Discovering
it gave her a strong sense of satisfaction, and she found
comfort in the consistency of math
Part A
Part B
Tap the phrase that "it" refers
to.
In Part A, "it" refers to "a single idea for the poetry collection."
In Part B, "it" refers to "the correct answer."
What is the phrase about?A phrase is a group of words that forms a part of a sentence and does not contain a subject and verb. Phrases are used to add structure and detail to sentences, and they can be used to perform various grammatical functions in a sentence.
There are several different types of phrases, including noun phrases, verb phrases, adjective phrases, and adverb phrases.
Therefore, below are some examples of phrases:
Noun phrase: "the big, fluffy dog"Verb phrase: "is running"Adjective phrase: "happy and energetic"Learn more about phrase from
https://brainly.com/question/7744384
#SPJ1
A sports trainer applies an ice bag to the back of an injured athlete. Calculate the heat in kcal that is absorbed if 165g of ice at 0.0∘C is placed in an ice bag, melts, and rises to body temperature of 37.0∘C. (For water, 80. cal (334 J) is needed to melt 1g of ice or must be removed to freeze 1g of water.)
Express the heat to two significant figures and include the appropriate units.
The heat absorbed by the ice is given by the formula: heat = mass * specific heat capacity * change in temperature.
The mass of the ice is 165g. The specific heat capacity of water is 4.18 J/g°C. The change in temperature is 37.0°C - 0.0°C = 37.0°C.
The heat absorbed by the ice is: 165g * 4.18 J/g°C * 37.0°C = 29,894.5 J
To convert from J to kcal: 1 kcal = 4184 J. Therefore,
29,894.5 J / 4184 J/kcal = 7.13 kcal
The heat absorbed by the ice is 7.13 kcal
What is the number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution?
a. 0.1 mol c. 0.62 mol
b. 0.16 mol d. 1.6 mol
( I have a feeling that the answer choices are I'm given are all incorrect... I am using M=N/V and keep getting 0.05 mol.
The number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution is 0.16.
Option B is correct.
How to calculate?The first step to take is figure out how many moles of magnesium chloride were needed to make this solution.
We use the compound's molar mass, which essentially tells us the mass of one mole of magnesium chloride which is 0.01996 moles MgCl2
Each mole of magnesium chloride will produce 2 moles of chloride anions in solution.
0.01996 x 2 moles Cl− = 0.03992 moles of Cl−
Therefore the number of chloride ions (Cl-) in 250 mL of a 0.2M magnesium chloride solution is 0.03992/ 250 ml
=0.16 moles of Cl
molarity tells us the number of moles of solute you get per liter of solution, we can conclude that the molarity of the chloride anions will be 0.16
Learn more about moles at: https://brainly.com/question/13314627
#SPJ1
if you travel 60 miles per hour for 13 hours, how many total miles would you have traveled
Answer:
780
Explanation:
AT first this question looks difficult but if you read it closely its simple. so what we know is that for ever 60 miles he drives 13 hours. So all we have to do is mulyiply 60x13.
Mole Practice
1. How many particles of gold are in 2.3 moles of Au?
2. Calculate the number of moles of O2 in 15.5 grams of O2. (MM O2 = 32 g/mol)
3. Calculate the mass in grams of 2.47 x 1021 formula units of sodium oxide.
(MM Na₂O = 62 g/mol)
X
4. Calculate the number of atoms of titanium in 23.4 Kg Ti. (MM Ti = 48 g/mol)
2 H₂ + O₂ -> 2 H₂O
5. How many grams of O₂ are needed to produce 75.0 grams of H₂O? (MM O₂ = 32 g/mol)
(MM H₂O = 18 g/mol)
6. How many grams of H₂ are needed to react with 75.0 grams of O₂? (MM H₂ = = 2 g/mol)
(MM O₂ = 32 g/mol)
The number of particles of gold that are in 2.3 moles of Au is 1.38 * 10²⁴ particles.
The number of moles of O₂ in 15.5 grams of O₂ is 0.48 moles
The mass in grams of 2.47 x 10²¹ formula units of sodium oxide is 0.254 grams
The number of atoms of titanium in 23.4 Kg Ti is 2.93 * 10²⁶ atoms
The mass in grams of O₂ needed to produce 75.0 grams of H₂O is 66.67 grams of O₂
The mass in grams of H₂ that are needed to react with 75.0 grams of O₂ is 9.375 g.
What is the number of particles in a mole of a substance?The number of particles in a mole of a substance is 6.02 * 10²³.
Considering the given questions:
The number of particles of gold that are in 2.3 moles of Au = 2.3 * 6.02 * 10²³
The number of particles = 1.38 * 10²⁴ particles.
The number of moles of O₂ in 15.5 grams of O₂ = 15.5/32
The number of moles of O₂ = 0.48 moles
The mass in grams of 2.47 x 10²¹ formula units of sodium oxide = 2.47 x 10²¹/ 6.02 * 10²³ * 62 g
The mass in grams of 2.47 x 10²¹ formula units of sodium oxide = 0.254 grams
The number of atoms of titanium in 23.4 Kg Ti = 6.02 * 10²³ * 23.4 * 1000/48
The number of atoms of titanium in 23.4 Kg Ti = 2.93 * 10²⁶ atoms
The mass in grams of O₂ needed to produce 75.0 grams of H₂O = 75/18 * 1/2 * 32
The mass in grams of O₂ needed to produce 75.0 grams of H₂O = 66.67 grams of O₂
The mass in grams of H₂ that are needed to react with 75.0 grams of O₂ = 75/32 * 2 * 2 g
The mass in grams of H₂ that are needed to react with 75.0 grams of O₂ = 9.375 g.
Learn more about the number of particles at: https://brainly.com/question/908857
#SPJ1
which of the following best explains why the lattice energy of \ce{nacl}nacln, a, c, l is greater than the lattice energy of \ce{rbcl}rbclr, b, c, l?
NaCl has greater lattice energy as the size of anions is similar but the size of cation in NaCl is smaller than RbCl.
Lattice energy refers to the release of energy which occurs when the constituent atoms are placed in their respective positions on the crystal lattice. Additionally, it also refers to the amount of energy required to separate an ionic crystal into its component ions. Lattice energy is a measure of the ionic bond strength in an ionic compound. It is used to gain insight into different properties of ionic solids such as solubility, volatility, and hardness. Lattice energy is directly proportional to the ionic charges product and inversely proportional to the internuclear distance or the size of ions. When considering NaCl and RbCl the radius of Rb+ is greater than Na+, hence it will have less lattice energy. The cation with smaller radii exhibits higher lattice enthalpy.
Note: The question is incomplete. The complete question probably is: Why is the lattice energy of NaCl greater than the lattice energy of RbCl?
Learn more about Lattice energy:
https://brainly.com/question/8637149
#SPJ4
How would Ra bond wit Bi
Answer:
Polar covalent bond
Explanation:
as Ra only has two extra electrons on another outside ring is does not take much to switch over i believe thats how it works
You have three crystal substances (x, y, and z) whose properties are listed in the table below. Identify the types of bonds in each substance and explain your answer.
X contains metallic bond
Y contains ionic bond
Z contains covalent bond
What is the crystal structure?We know that the crystal structure of a compound would have to do with the way that the atoms and the elements that compose the compound could be said to have been arranged. Thus if a compound is said to have a crystal structure then we can say that the compound would be crystalline in nature as we can see from the table that we have in the question here.
The kind of bonds that we have in the compound is about one of things that can be able to determine whether or not the compound has a crystalline structure as we can see.
Looking at the properties of the compounds that have been shown in the bale that has been attached to the answer that we have here, we can be able to make a decision regarding each of the substances shown.
Learn more about crystal substances:https://brainly.com/question/28728101
#SPJ1
Which of the following pairs of solutions produces a precipitate when combined?
Cu(NO3)2 and NaCl
Cu(NO3)2 and K2CO3
CaCl2 and NaNO3
Fe(NO3)3 and MgCl2
The pairs of solutions that produces a precipitate when combined are [tex]Cu(NO_{3})_{2}[/tex] and [tex]K_{2} CO_{3}[/tex]3. So the correct option is B.
What is a precipitate?A precipitate is a solid that is created from a solution in an aqueous state in which two chemicals react. The precipitate then, once formed, will remain floating in solution. If you intervene in the process by putting the solution in a centrifuge, it will press the mass to the bottom of the tube, generating a compact mass.
The generation of the precipitate can be generated only if the characteristics of the compounds will overcome the solubility that it has to be able to generate a reaction.
All this will be generated because in the solution there will be components which will generate a chemical reaction between two ionic compounds. For this reason, the correct option will be B. [tex]Cu (NO_{3}) _{2}[/tex] and [tex]K_{2} CO_{3}[/tex].
To learn more about precipitate visit: https://brainly.com/question/29871773
#SPJ1
In which process do bacteria convert NH4 to NO3 to NO4?|
The process by which bacteria convert NH4 to NO3 to NO4 is called nitrification.
What is the role of nitrification in the nitrogen cycle? Nitrification is a two-step process where ammonia (NH3) is oxidized to nitrite (NO2) and then to nitrate (NO3). This process is carried out by bacteria known as nitrifying bacteria. Nitrification plays an important role in the nitrogen cycle by converting ammonia and other forms of nitrogen into nitrate, which is a form of nitrogen that can be used by plants for growth. Nitrification also helps to reduce pollution in aquatic environments by converting ammonia-based pollutants into nitrates. Nitrate is then used by organisms in the environment such as algae, which in turn can be consumed by fish and other aquatic organisms. The nitrate can then be converted back into nitrogen gas (N2) and released into the atmosphere, thus completing the nitrogen cycle. Nitrification is an essential part of the nitrogen cycle and is necessary for the proper functioning of the environment.To learn more about nitrification refer to:
https://brainly.com/question/9366803
#SPJ1
Explain why the change in internal energy and in enthalpy may not be equal for a reaction
done at constant pressure, and how the difference between them may be estimated. Explain why
measurements in a bomb calorimeter give ArU, not ArH.
Answer:
9.990-357
Explanation:
aru not arh is 9.990-357
2-methylbutan-1-ol is heated with an excess of
concentrated sulphuric acid (H2SO4) in order to cause an
elimination reaction.
i) Write an overall equation (using condensed formula) for this
elimination reaction and name the reactants and products as
part of the equation
ii) Draw the product of this reaction in displayed formula.
iii) Provide a ‘curly arrow’ mechanism (in displayed formula) for
the formation of the product supported with an explanation.
Answer:1. 2methylbutene
Explanation:
i: CH3CH2CH(CH3)CH2OH--H2SO4----------> CH3CH=C(CH3)CH3
2-methyl butane-1-ol undergoes dehydration to form alkene in presence of an excess of concentrated sulphuric acid to form2-methylbut-2-ene
ii: CH3
I
CH3CH2C=Ch2
iii: Shown in attach image
For mole details on dehydration of alcohol in excess of sulphuric acid
https://brainly.com/question/28321840
questions are in the picture
Answer:
A possible element with ns2np4 valence orbital is Oxygen(O)
A element that has the most electronegativity and soft is flourine(F)
for part C, it is scandium (Sc) with the last electron filled in the 3d orbital
Oxygen is a substance that dissolves in water. Fish absorb oxygen from the water. When dissolved oxygen levels are low, it can be hard for organisms to survive
Oxygen is a molecule that is essential for life. It is a colorless, odorless gas that makes up about 20% of the air we breathe.
What is molecule?A molecule is a group of two or more atoms that are held together by chemical bonds. They are the basic building blocks of all matter, and are composed of protons, neutrons, and electrons.
When oxygen is dissolved in water, it can be absorbed by aquatic organisms such as fish. These aquatic organisms use the oxygen to help them with their metabolic processes. When the levels of oxygen in the water are too low, the organisms are not able to survive and may die. Low oxygen levels can occur naturally due to environmental factors like temperature or seasonality, or they can be caused by human activities such as pollution. It is important to keep oxygen levels in the water high to ensure the health of aquatic ecosystems.
To learn more about molecule
https://brainly.com/question/1078183
#SPJ1
