Am I correct? I need some clarification on this practice problem solving I have attempted this problem but for some reason I feel like I may be wrong

Am I Correct? I Need Some Clarification On This Practice Problem Solving I Have Attempted This Problem

Answers

Answer 1

Solution:

The modulus of a complex number;

[tex]z=a+bi[/tex]

is denoted by;

[tex]|z|=|a+bi|=\sqrt[]{a^2+b^2}[/tex]

Thus, given the complex number;

[tex]2-6i[/tex]

The modulus is;

[tex]\begin{gathered} a=2,b=-6 \\ |2-6i|=\sqrt[]{2^2+(-6)^2} \\ |2-6i|=\sqrt[]{4+36} \\ |2-6i|=\sqrt[]{40} \\ |2-6i|=\sqrt[]{4\times10} \\ |2-6i|=\sqrt[]{4}\times\sqrt[]{10} \\ |2-6i|=2\times\sqrt[]{10} \\ |2-6i|=2\sqrt[]{10} \end{gathered}[/tex]

ANSWER:

[tex]2\sqrt[]{10}[/tex]


Related Questions

ten B В 15 cm А 20 cm С C

Answers

Tangent segment, of a circle

Apply formulas

20^2 - 15^ 2 = AB^2

Also

15^2 = 20•( 20 - AB)

225 = 400 - 20AB

Then

20AB = 400-225= 175

AB = √ 175= 13 + 6/25 =13.24

A random number generator is used to select an integer from 1 to 100 ​(inclusively). What is the probability of selecting the integer 730​?

Answers

If a random number generator is used to select an integer from 1 to 100, then the probability of selecting the integer 730 is zero.

Here a random number generator is used to select an integer from 1 to 100.

Therefore the range of the outcome = 1 to 100

Here we have to find the probability of selecting the integer 730

The probability = Number of favorable outcomes / Total number of outcomes.

Here a random number generator is used to select an integer from 1 to 100, but the given number is 730  which is out of range. Therefore the probability is zero

Hence, if a random number generator is used to select an integer from 1 to 100, then the probability of selecting the integer 730 is zero.

Learn more about probability here

brainly.com/question/11234923

#SPJ1

If the coordinates of a are (3,4) and the coordinates of b are (-3,3) then the length of an is

Answers

The length of the line segment from a to b is 6.08 units or [tex]\sqrt{37}[/tex] units.

What is the length of a line segment and what is the role of coordinates?

The length is described as the distance between the two points in a line. The coordinate usually refers to the dimensions of the point with respect to the two dimension graph.

Relation between the coordinates and length:  [tex]\sqrt{(x_{1} -x_{2}) ^{2} +(y_{1} -y_{2} )^{2} }[/tex]

Now let point a be ([tex]x_{1},y_{1}[/tex]) and point b be ([tex]x_{2},y_{2}[/tex])

Thus putting values,

length = [tex]\sqrt{(3-(-3))^{2}+(4-3)^{2} }[/tex]

length = [tex]\sqrt{36+1}[/tex]    

length = [tex]\sqrt{37}[/tex]

Hence the length of ab is [tex]\sqrt{37}[/tex] or 6.08 units.

To know more about coordinates, visit:

https://brainly.com/question/27749090

#SPJ13

       

Is the graph of the distance a person has driven over time an example of a continuous or discrete graph?

Answers

Let us first understand what are discrete and continuous variables.

Discrete variable:

A discrete variable is countable in a finite amount of time.

For example:

The number of coins in your pocket

The number of trees in the garden

It is not possible to have 2.5 coins or 7.3 trees

Continuous variable:

A continuous variable can take any numeric value.

For example:

The height of the tree

The room temperature

These values can be in decimal like 7.3, 0.23 etc

Now let us come to the question, the distance a person has driven can take any value

for example, it can be 50 miles or 23.4 miles or 120.5 miles

So, decimal values are possible

This means that it must be a continuous graph

The distance a person has driven over time an example of a continuous graph.

A box has 14 candies in it: 3 are taffy, 7 are butterscotch, and 4 are caramel. Juan wants to select two candies to eat for dessert. The first candy will be selectedat random, and then the second candy will be selected at random from the remaining candies. What is the probability that the two candies selected are taffy?Do not round your intermediate computations. Round your final answer to three decimal places.

Answers

Okay, here we have this:

Considering the provided information we are going to calculate what is the probability that the two candies selected are taffy. So, for this, first we are going to calculate the probability that the first is taffy, and then the probability that the second is taffy. Finally we will multiply these two probabilities to find the total probability.

Remember that the simple probability of an event is equal to favorable events, over possible events.

First is taffy:

At the beginning there are 14 sweets, and 3 are taffy, so there are 3 favorable events and 14 possible, then:

First is taffy=3/14

Second is taffy:

Now, in the bag there are 13 sweets left, and of those 2 are taffy, so now there are 2 favorable events out of 13 possible:

Second is taffy=2/13

The first and second are taffy:

First is taffy*Second is taffy=3/14*2/13

First is taffy*Second is taffy=3/91

First is taffy*Second is taffy=0.033

First is taffy*Second is taffy=3.3%

Finally we obtain that the probability that the two candies selected are taffy is aproximately 0.033 or 3.3%.

2. In the xy-plane above, ABCD is a square and point E is the center of the square. The coordinates of points C and E are (7,2) and (1,0), respectively. Write an equation of the line that passes through points A, E, and C. B 1 2 -С E X -6 2 4. 16 A -2

Answers

Ready

Points A = (-5, -2) C = (7, 2) E = (1, 0)

1.- Find the slope

m = (y2 - y1) / (x2 - x1)

m = (2 + 2) / (7 + 5)

m = 4/ 12

m = 1/3

2.- Find the equation of the line

y - y1 = m(x - x1)

y + 2 = 1/3(x + 5)

y + 2 = 1/3x + 5/3

y = 1/3x + 5/3 - 2

y = 1/3 x + 5/3 - 6/3

This is the equation:

y = 1/3 x - 1/3

my pleausre

You have the option of loaning money to one friend who promises to pay simple interest or to another friend who promises to pay the same APR but compound the interest. Which would you choose, and why?

Answers

Answer:

I would loan my money to the one who pays the compound interest.

This is because more money would be generated from the compound interest as it is based on the principal (Amount loaned) and also the interest generated from the loan. Unlike simple interest that is only based on the principal.

The days high temperature in Detroit , Michigan was recorded as 41 degrees F . Use the formula C = 5/9 ( F- 32) to write 41 degrees F as degrees celsius

Answers

Step 1

Given;

Step 2

[tex]\begin{gathered} C=\frac{5}{9}(F-32) \\ F=41 \\ C=\frac{5}{9}(41-32) \\ C=\frac{5}{9}(9) \\ C=5^{\circ}C \end{gathered}[/tex]

Answer;

[tex]5^{\circ}C[/tex]

Solve this system of linear equations. Separatethe x- and y-values with a comma.7x - by = -414x + 5y = 43

Answers

Answer

x = 2, and y = 3

Explanation:

given the following linear equation

7x - 6y = -4------------- equation 1

14x + 5y = 43 ---------- equation 2

This equation can be solve simultaneously by using elimination method

Step 1 : eliminate x

To eliminate x, multiply equation 1 by 2 qnd equation 2 by 1

7x * 2 - 6y * 2 = -4 * 2

14x * 1 + 5y * 1 = 43 * 1

14x - 12y = -8 ----------------- equation 3

14x + 5y = 43------------------ equation 4

Substract equation 4 from3

(14x - 14x) - 12 - 5y = -8 - 43

0 - 17y = -51

-17y = -51

Divide both sides by -17

-17y/-17 = -51/-17

y = 51/17

y = 3

To find x, put the value of y into equation 1

7x - 6y = -4

7x - 6(3) = -4

7x - 18 = -4

Collect the like terms

7x = -4 + 18

7x = 14

Divide both sides by 7

7x/7 = 14/7

x = 2

Therefore, x = 2 and y = 3

How do you solve the y-intercept of y = 9x + 9 and what is it simplified?

Answers

to know y -intercept we only need to replace x by 0. And we get

[tex]y=9\cdot0+9=9[/tex]

so the y-intercept is 9

Given the function f(x)={4x+7 if x<0 6x+4 if x>0 _

Answers

Given:

[tex]f(x)=\begin{cases}4x+7ifx<0{} \\ 6x+4ifx\ge0{}\end{cases}[/tex]

Required:

To find the value of f(-8), f(0), f(4), and f(-100)+f(100).

Explanation:

f(-8) :

Clearly -8<0,

So

[tex]\begin{gathered} f(x)=4x+7 \\ f(-8)=4(-8)+7 \\ =-32+7 \\ =-25 \end{gathered}[/tex]

f(0) :

Clearly 0=0,

[tex]\begin{gathered} f(x)=6x+4 \\ =6(0)+4 \\ =4 \end{gathered}[/tex]

f(4) :

Clearly 4>0,

[tex]\begin{gathered} f(x)=6x+4 \\ f(4)=6(4)+4 \\ =24+4 \\ =28 \end{gathered}[/tex]

f(-100)+f(100) :

-100<0

[tex]\begin{gathered} f(x)=4x+7 \\ f(-100)=4(-100)+7 \\ =-400+7 \\ =-393 \end{gathered}[/tex]

100>0

[tex]\begin{gathered} f(x)=6x+4 \\ f(100)=6(100)+4 \\ =600+4 \\ =604 \end{gathered}[/tex][tex]\begin{gathered} f(-100)+f(100)=-393+604 \\ \\ =211 \end{gathered}[/tex]

Final Answer:

[tex]\begin{gathered} f(-8)=-25 \\ \\ f(0)=4 \\ \\ f(4)=28 \\ \\ f(-100)+f(100)=211 \end{gathered}[/tex]

Help please and thank you

Answers

If f(x) is a linear function and gives f(3) = 3 and f(9) = -2

Part a

The slope of the line = -5/6

Part b

The y-intercept = 11/2

Part c

f(x) = (-5/6)x + 11/2

The values of

f(3) = 3

f(9) = -2

The points are (3,3) and (9,-2)

Part a

The slope of the line is the change in y coordinate with respect to the change in x coordinate.
Slope of the line = [tex]\frac{y_2-y_1}{x_2-x_1}[/tex]

= [tex]\frac{-2-3}{9-3}[/tex]

=-5/6

Part b

The slope intercept form of the line

y = mx+b

b is the y intercept

Substitute the values in the equation

3 = (-5/6)×3 + b

3= -5/2 + b

b = 11/2

Part c

Then the linear function f(x) = (-5/6)x + 11/2

Hence, if f(x) is a linear function and gives f(3) = 3 and f(9) = -2

Part a

The slope of the line = -5/6

Part b

The y-intercept = 11/2

Part c

f(x) = (-5/6)x + 11/2

Learn more about about slope intercept form here

brainly.com/question/9682526

#SPJ1

Which of the following tools did the Greeks limit themselves to in their

Answers

The Greeks limited themselves to using only compass and ruler in their formal geometric constructions.

Answer: Options B and D.

y = (x+3)^3 find the zeros of each function

Answers

Given,

[tex]y=(x+3)^3[/tex]

We have,

[tex]y=0[/tex]

when,

[tex]\begin{gathered} x+3=0 \\ \Rightarrow x=-3 \end{gathered}[/tex]

The zeros of the function are x=-3,-3,-3

Write the slope intercept equation through the point (1,2) and it’s parallel to the line y=1+4x

Answers

Given:

Line equation, y=1+4x

The point, (1,2)

To find the slope intercept form:

The general slope intercept form is, y=mx+b.

First to find m:

From the line equation,

y=4x+1

We have, m=4

Next to find b:

Substitute m=4, and (1,2) in the general intercept form is,

[tex]\begin{gathered} (2)=4(1)+b \\ 2=4+b \\ b=-2 \end{gathered}[/tex]

Now, substitute m=4 and b=-2 in the slope intercept form

Thus, the slope intercept form is,

[tex]y=4x-2[/tex]

4. The relationship between temperature expressed in degrees Fahrenheit(F) and degrees Celsius (C) is given by the formula F= (9/5)C + 32. If the temperature is 5 degrees Fahrenheit, what is it in degrees Celsius ?

Answers

To calculate which value in Celsius the temperature of 5 Fº equates to, we first need to rewrite the expression isolating the "C" variable on the left side.

[tex]\begin{gathered} F=\frac{9}{5}\cdot C+32 \\ \frac{9}{5}\cdot C=F-32 \\ 9\cdot C=5\cdot F-160 \\ C=\frac{5}{9}\cdot F-\frac{160}{9} \\ \end{gathered}[/tex]

We now need to replace F by 5.

[tex]\begin{gathered} C=\frac{5}{9}\cdot5-\frac{160}{9} \\ C=\frac{25}{9}-\frac{160}{9} \\ C=\frac{-135}{9} \\ C=-15 \end{gathered}[/tex]

The temperature is -15 degrees in Celsius.

Hi. I can send a picture. can you help? thank u

Answers

we have the equation

y=x^2-6x+2

this equation represents a vertical parabola open upward (because the leading coefficient is positive)

that means

the vertex is a minimum

Convert to vertex form

y=a(x-h)^2+k

where

(h,k) is the vertex

Complete the square

y=(x^2-6x+9)+2-9

y=(x-3)^2-7

therefore

the vertex is (3,-7)

the answer is the option A

Find the value of b if it is known that the graph of y=-3x+b goes through the point_
M(-2, 4)

Answers

Answer:

b = -2

Step-by-step explanation:

y = mx + b;         (-2, 4)

y = -3x + b          (x₁, y₁)

m = -3

y - y₁ = m(x - x₁)

y - 4 = -3(x -( -2))

y - 4 = -3(x + 2)

y - 4 = -3x - 6

   +4           +4

------------------------

y = -3x - 2

I hope this helps!

Y=-3x-2
I did in paper and this is the answer

Forproblems 5-10, determine what type of symmetry each figure has. If the figure has line symmetry, determine how many lines of symmetry the figure has. If the figure has rotational symmetry, determine the angle of rotational symmetry and if the figure also has point symmetry. (A figure can have both line and rotational symmetries or neither of these symmetries)

Answers

7. The figure has line and rotational symmetries. There are 2 lines of symmetry. The angle of symmetry is 180°

8. The figure has no symmetry

The figure is not drawn to scale. Find the unknown angle.

Answers

ThereforeGiven the image, we can find the missing angle using the sum of angles at a point rule.

The sum of angles at a point is known to be 360 degrees.

Therfore,

[tex]\begin{gathered} a^0+315^0=360^0 \\ a^0=360^0-315^0 \\ a^0=45 \end{gathered}[/tex]

Therefore, the measure of "a" is

Answer:

[tex]45^0^{}[/tex]

To produce g, function f was reflected over the x-axis andFunction g can be defined as

Answers

The graph of the functions f and g are given.

It is required to complete the statement concerning how to produce g.

The graph of the parent function f is shown:

Reflect the graph of f across the x-axis:

Translate the function 5 units vertically upwards:

The given parent function is y=f(x).

Reflect the graph across in the x-axis to get the equation y=-f(x).

Translate the graph 5 units up to get y=-f(x)+5

Answers:

To produce g, the function f was reflected over the x-axis and shifted up 5 units.

Function g is defined as g(x)=-f(x)+5.

Is the number -3.7 a natural number, a whole number, an integer, a rational number, an irrational number or a real number?

Answers

ANSWER

Rational number and Real number

EXPLANATION

We want to identify what type of number -3.7 is.

A natural number is a number that is a positive integer, used in counting things. Examples are 4, 7 and 55.

A whole number is a number that is used in counting, including 0 i.e. natural numbers including 0.

An integer is a whole number but the difference is that an integer can be positive, negative or zero.

A rational number is a number that can be expressed as a fraction of two integers i.e. a/b while an irrational number is one that cannot be expressed as a fraction of two integers.

A real number is any number that can be found as a distance between two points on the number line.

From the definitions above, we see that we can classify -3.7 as a rational number and a real number.

It is not a natural number, whole number, irrational number or an integer.

Refer to your equation for the line that models the association between latitude and temperature of the cities: Yours y = -12 + 120 Computer calculated y = -1.07 + 119 What does the slope mean in the context of this situation?

Answers

The slope in the equations represent the change in temperature by the change in lattitude. This means that for each unit change in the latitude the temperature will decrease by an amount given by the slope.

help meeeee pleaseeeee!!!





thank you

Answers

The values of f(0), f(2) and f(-2) for the polynomial f(x) = [tex]-x^{3} +7x^{2} -2x+12[/tex] are 12, 28 and 52 respectively.

According to the question,

We have the following information:

f(x) = [tex]-x^{3} +7x^{2} -2x+12[/tex]

Now, to find the value of f(0), we will put 0 in place of x.

f(0) = [tex]-0^{3} +7(0)^{2} -2(0)+12[/tex]

f(0) = 0+7*0-0+12

(When a number has some power then it means that in order to solve this we have expand the expression and multiply the number as many times as the power is given. For example, in the case of 3 as power, we will multiply any number 3 times and in case of 2 as power, we will multiply the given number 2 times.)

f(0) = 0+0-0+12

f(0) = 12

Now, to find the value of f(2), we will put 1 in place of x:

f(2) = [tex]-2^{3} +7(2)^{2} -2(2)+12[/tex]

f(2) = -8+7*4-4+12

f(2) = -8+28-4+12

f(2) = 40 -12

f(2) = 28

Now, to find the value of f(2), we will put -2 in place of x:

f(-2) = [tex]-(-2)^{3} +7(-2)^{2} -2(-2)+12[/tex]

f(-2) = -(-8) + 7*4+4+12

f(-2) = 8+28+4+12

f(-2) = 52

Hence, the value of f(0) is 12, f(2) is 28 and f(-2) is 52.

To know more about polynomial here

https://brainly.com/question/11536910

#SPJ1

4. Adam had $200. He spent $75 on clothes and $55 on a video game. Then his Momgave him $20 more dollars. How much money does Adam have now?

Answers

Adam had $200

He spent $75 on clothes and $55 on video game

The total money spent by Adam is

[tex]=75+55=\text{ \$130}[/tex]

The amount left with Adam is

[tex]=200-130=\text{ \$70}[/tex]

Then his mom gave him $20

The total amount of money Adam have now is

[tex]=70+20=\text{ \$90}[/tex]

Hence, the answer is $90

Кр2.345 67 8Identify each angle as acute, obtuse, or right123345678.

Answers

we have the following:

Therefore:

Please get help with us for I am confused as to have should draw the rotation after a 90° clockwise rotation

Answers

In the given figure we can observe a triangle with vertices located at:

(-3,-2)

(-5,-4)

(1,-5).

We need to draw it after a 90° clockwise rotation.

We can apply the rule for 90° clockwise rotation, which is:

Each point of the given figure has to be changed from (x, y) to (y, -x) and then we need to graph the new coordinates.

By applying the rule to the given coordinates we obtain:

[tex]\begin{gathered} (x,y)\to(y,-x) \\ (-3,-2)\to(-2,3) \\ (-5,-4)\to(-4,5) \\ (1,-5)\to(-5,-1) \end{gathered}[/tex]

Now we have to draw the new coordinates:

please determine 8/12 - 3/8 =

Answers

= 7/24
Hope this helps!

8/12 -3/8=16/24-9/24=7/24

You should make like numbers then subtract

If you need to simplify at the end

What is the slope and y-intercept?

y=7x+2

Options:
Blank # 1
Blank # 2

Answers

Answer:

Step-by-step explanation:

18098

Macky Pangan invested ₱2,500 at the end of every 3-month period for 5 years, at 8% interest compounded quarterly. How much is Macky’s investment worth after 5 years?

Answers

Compound interest with addition formula:

[tex]A=P(1+\frac{r}{n})^{nt}+\frac{PMT(1+\frac{r}{n})^{nt}-1}{\frac{r}{n}}[/tex]

where,

A = final amount

P = initial principal balance

r = interest rate

n = number of times interest applied per time period

t = number of time periods elapsed

PMT = Regular contributions (additional money added to investment)

in this example

P = 2500

r = 8% = 0.08

n = 4

t = 5 years

PMT = 2500

[tex]A=2500(1+\frac{0.08}{4})^{4\cdot5}+\frac{2500\cdot(1+\frac{0.08}{4})^{4\cdot5}-1}{\frac{0.08}{4}}[/tex]

solving for A:

[tex]A=189408.29[/tex]

Therefore, his investment after 5 years will be

$189,408.29

Other Questions
Make a table for the graph labeled hours studies average grade All of the following were typical of the Red Scare EXCEPTanti-conservatismanti-Communismanti-union sentimentanti-immigrant sentiment the circumference of a circle is 18pi ft. what is the area in square feet. tech a says fuel line pressure may be relieved by disabling the fuel pump and running the engine until it stops. tech b says the only safe way to relieve fuel pressure is to open the fuel return line at a fitting away from the engine. who is correct? _____ is the efficient management of the acquisition of raw materials to the factory and the movement of products from the producer to industrial users and consumers. You use a garden hose to fill a wading pool. If the water level rises 17 centimeters every 4 minutes and you record the data point of (12,y), what is the value of y? Use slope to justify your answer A psychology test has personality questions numbered 1, 2, 3, intelligence questions numbered 1, 2, 3, 4, and attitudequestions numbered 1,2. If a single question is picked at random, what is the probability that the question is an intelligence question OR has an odd number? Una clase tiene 42 alumnos. Se puede determinar que 3/9 son nios y 4 6 son nias, Cuntos nios y cuantas nias hay en la clase? Kindly assist in answering these questions the stryker company discovered through marketing research that one of its medical devices was too difficult for doctors to locate for purchase. it redesigned its website information and highlighted the device, trained the sales staff, prominently featured the device in trade magazines, and simplified the purchasing process. what important step in the process did the stryker company forget to do? Please help me with this question. Write a proportional that relates the corresponding sides. You must use all of the sides for both triangles in your statement. $3.44 at the Farmers market at a grocery store the same oranges cost $8.40 for a bag of 20 find the better deal by calculating the unit rate for both locations how much would be saved per orange by purchasing oranges at the locations with the better deal solve the word problemFarmers market unit rate --------------grocery store unit rate ------------------better deal -------------how much is saved ------------A $0.01/ orangeslB $0.41 / orangeC grocery storeD Farmers marketE $0.43 / orangeF $0.40 / OrangeG $0.10 / Orange find the zeros algebraically: f(x)=x^4-8x^3+5x^2+14x How many grams of CO are produced when 33.0 g of C reacts? Fe2O3(s)+3C(s)2Fe(s)+3CO(g) A normal distribution has a mean of 101 and a standard Deviation of 12. find the probability that a value selected at random is in the following interval.at most 13 Geometry Problem - Given: segment AB is congruent to segment AD and segment FC is perpendicular to segment BD. Conclusion: Triangle AEG is isosceles. (Reference diagram in picture) Evaluate when n=5 4n Explain how stem cells differ from other kinds of cells. Give an example using plantsor animals. a prospective insured completes and signs an application for health insurance but intentionally conceals information about a pre-existing heart condition. the company issues the policy. two months later, the insured suffers a heart attack and submits a claim. while processing the claim, the company discovers the pre-existing condition. in this situation, the company will: