flying against the wind, an airplane travels 7840 kilometers in 8 hours. flying with the wind, the same plane travels 5280 kilometers in 4 hours. what is the rate of the plane in still air and what is the rate of the wind?

Answers

Answer 1
Answer:

The rate of the plane in still air is 1150km/hr and the rate of the plane in the wind is 170km/hr.

Explanations:

The formula for calculating distance is expressed as:

[tex]\begin{gathered} dis\tan ce=\text{speed}\times\text{time} \\ d=st \end{gathered}[/tex]

Let the rate of the plane in still air be "x"

Let the rate of the plane in the wind be "y"

if flying against the wind, an airplane travels 7840 kilometers in 8 hours, then;

8 (x - y) = 7840

x - y = 980 ........................ 1

If flying with the wind, the same plane travels 5280 kilometers in 4 hours

4 (x + y) = 5280

x + y = 1,320 ......................2

Add both equations:

x + x = 980 + 1320

2x = 2,300

x = 2300/2

x = 1150 km/hr

Substract x = 1150km/hr into equation 1.

x - y = 1320

1150 + y = 1320

y = 1320 - 1150

y = 170km/hr

Hence the rate of the plane in still air is 1150km/hr and the rate of the plane in the wind is 170km/hr


Related Questions

Can someone pls help me . Thank you so much .FIRST PROBLEM

Answers

Answer:

Step-by-Step explanation:

We are given the following equation:

Can someone help me with this math question?
pic of question below

Answers

The Cartesian equation of the polar equation r² = 5 represents a circle centered at the origin and with radius √5.

What is the Cartesian form of a polar equation?

In this problem we find a polar equation, that is, f(r, θ) = C, whose Cartesian form must be found by using the following substitutions:

x² + y² = r²                 (1)

x = r · cos θ               (2)

y = r · sin θ                (3)

Then, the Cartesian form of r² = 5 is:

x² + r² = 5

The polar equation represents a circle centered at the origin and with a radius of √5.

To learn more on polar equations: https://brainly.com/question/27341756

#SPJ1

The Cartesian equation of the polar equation r² = 5 represents a circle centered at the origin and with radius √5.

What is Coordinate System?

A coordinate system is a system that uses one or more numbers, or coordinates, to uniquely determine the position of the points.

Given that r²=5

we find a polar equation,

x²+y²=r²

whose Cartesian form is found by substituting

x=rcosθ

y=rsinθ

as r²=5 then r=√5

So x²+y²=5.

This is equation of circle in polar form.

Hence it represents a circle with a radius of √5.

To learn more on Polar Equations click:

https://brainly.com/question/1269731

#SPJ1

The con 3720bertar What can be interpreted from the youtercept of the functionRachel must pay $37 per month to use the gymRachel must pay $20 per month to use the gymRachel must pay a $37 membership fee to join the gymRachel must pay a $20 membership fee to join the samMaria wants to rent a car. She learns that the total daily costcated using the formula C = 5x + 30. hereseS driven that day. What does the constanteseer

Answers

f(x) = 37x + 20

Answer:

Option D, $20 is the membership beause it is a fixed cost, it does not depend on the amount of months

Sioux Falls Christian teacher says that he can drop one of his test score using history to score of 80 185 which one should he drop and white what is his new address

Answers

if he removes his lowest score the average increases, then if we remove 80 the new average is

[tex]\frac{100+85}{2}=92.5[/tex]

new average is 92.5

2. What is the greatestcommon factor of12. 18, and 36?

Answers

The Solution:

Given the numbers below:

12, 18 and 36.

We are asked to find the greatest common factor of the above numbers.

Note:

Greatest Common Factor means Highest Common Factor (HCF).

Recall:

The Greatest common factor of 12, 18 and 36 is the highest number that can divide 12, 18 and 36 without any remainder.

Thus, the correct answer is 6.

Find the coordinates of the other endpoint of the segment, given its midpoint and one endpointand y.)midpoint (-7.-21), endpoint (-13.-15)

Answers

Ok, we are going to use the midpoint formula

M = ( (x1 + x2) / 2 , (y1 + y2) / 2 )

(-7,-21)=((x1-13)/2 , (y1-15)/2 )

Break up this formula into two equations.

(x1-13)/2=-7 and (y1-15)/2=-21

Solve for x1 and y1 from the equations. So:

x1=(-7*2)+13

x1=(-14)+13=-1

y1=(-21*2)+15=(-42)+15=-27

So the other endpoint is (-1, -27).

Use the formula for compound amount:$14,800 at 6% compounded semiannually for 4 years

Answers

SOLUTION

Given the question in the question tab, the following are the solution steps to answer the question.

STEP 1: Write the formula for calculating compound amount

[tex]A=P(1+\frac{r}{n})^{nt}[/tex]

where

A = final compounded amount

P = initial principal balance

r = interest rate

n = number of times interest applied per time period

t = number of time periods elapsed

STEP 2: Write the given data

Semiannually means that n will be 2

[tex]P=14,800,r=\frac{6}{100}=0.06,n=2,t=4[/tex]

STEP 3: Calculate the compound amount

[tex]\begin{gathered} A=14800(1+\frac{0.06}{2})^{2\times4}\Rightarrow A=14800(1+0.03)^{2\times4} \\ A=14800(1.03)^8 \\ A=14800\times1.266770081 \\ A=\text{\$}18,748.1972 \end{gathered}[/tex]

Hence, the compounded amount after 4 years is $18,748.1972

you can make pancakes with just bananas and eggs : serves 4 people with 6 eggs 2 bananas. how many eggs and bananas do u need to serve 6 people?

Answers

Given:

To prepare a pancake that serves 4 people, we need 6 eggs and 2 bananas.

Required:

The number of eggs and bananas that serves 6 people

By comparison,

If we need 6 eggs to prepare a pancake that serves 4 people, the number of people that 1 egg would serve is:

[tex]\begin{gathered} k\text{ = }\frac{4\text{ people}}{6\text{ eggs}} \\ =\text{ }\frac{2}{3}\text{ people/ egg} \end{gathered}[/tex]

Similarly, If we need 2 bananas to prepare a pancake that serves 4 people, the number of people that 1 banana would serve is:

[tex]\begin{gathered} k_2\text{ = }\frac{4\text{ people}}{2\text{ bananas}} \\ =\text{ 2 people/banana} \end{gathered}[/tex]

The number of eggs that serves 6 people:

[tex]\begin{gathered} =\text{ 6 people }\times\frac{3}{2}\text{ egg/people} \\ =\text{ 9 eggs} \end{gathered}[/tex]

The number of bananas that serves 6 people:

[tex]\begin{gathered} =\text{ 6 people }\times\text{ }\frac{1}{2}\text{ banana/ people} \\ =\text{ 3 bananas} \end{gathered}[/tex]

Answer:

9 eggs are needed

3 bananas are needed

10. Calculate the circumference of cylinder that is 34cm tall and has a volume of560cm#9

Answers

The Solution.

By formula, the volume of the planet (sphere) is given as below:

[tex]V=\frac{4}{3}\pi r^3[/tex]

In this case,

[tex]\begin{gathered} V=5.10^{18}km^3 \\ r=\text{?} \end{gathered}[/tex]

Substitting these given values into the formula above, we can solve for r, the radius of the planet.

[tex]\frac{4}{3}\pi r^3=5(10^{18})[/tex]

Dividing both sides by

[tex]\frac{4}{3}\pi[/tex]

We get

[tex]r^3=\frac{5\times10^{18}}{\frac{4}{3}\pi}=\frac{5\times10^{18}}{4.188790205}[/tex]

Taking the cube root of both sides, we have

[tex]\begin{gathered} r=\sqrt[3]{(}\frac{5\times10^{18}}{4.188790205})=(1.060784418\times10^6)km^{} \\ Or \\ r=1060784.418\text{ km} \end{gathered}[/tex]

Thus, the correct answer is 1060784.418km.

what percentage of students scored before 70-90 points on the exam? Round your answer to the nearest tenth of a percent?

Answers

We want to find the percentage of students that scored between 70-90 points on the examn. Also, we know that there are a total of 71 students, so we have to count the number of students who got between 70-90 points.

We see them represented on the histogram as the two largest bars, and we obtain:

[tex]\begin{gathered} 21\text{ students scored between 70-80 points} \\ 22\text{ students scored between 80-90 points} \end{gathered}[/tex]

So, the total of students that scored between 70-90 points is 21+22=43.

For finding the percentage, we make the quotient between the number of students with a score of 70-90 and the total of the students in the class.

[tex]=\frac{43}{71}\cdot100=60.6[/tex]

This means that approximately a 60.6% of the class students scored between 70 and 90 points.

Marcy baked 132 cookies . She is packaging boxes of eight cookies to give as a gift to he friends how many boxes will she make .

Answers

She will make 16 boxes.

To answer this question we simply have to divide the number of cookies (132) by the number of cookies that each box can contain.

Mathematically speaking:

[tex]132/8\text{ }[/tex][tex]16.5[/tex]

Since we can´t have half boxes, we have to round the number to 16.

16 boxes.

The points (-6, -10) and (23, 6) form a line segment.
Write down the midpoint of the line segment.

Answers

Answer:

(8.5, - 2 )

Step-by-step explanation:

given endpoints (x₁, y₁ ) and (x₂, y₂ ) then the midpoint is

( [tex]\frac{x_{1}+x_{2} }{2}[/tex] , [tex]\frac{y_{1}+y_{2} }{2}[/tex] )

here (x₁, y₁ ) = (- 6, - 10 ) and (x₂, y₂ ) = (23, 6 ) , then

midpoint = ( [tex]\frac{-6+23}{2}[/tex] , [tex]\frac{-10+6}{2}[/tex] ) = ( [tex]\frac{17}{2}[/tex] , [tex]\frac{-4}{2}[/tex] ) = (8.5, - 2 )

Can u please help me solve? I'm reviewing for finals.

Answers

Given:

Consider the given graph as a reference of the solution.

To find:

[tex]-3(u\cdot v)[/tex]

Explanation:

By analyzing the graph, we can define the coordinate of vector u and v:

[tex]\[\begin{align} & \vec{u}=(-8,-9)-(0,0)=(-8,-9) \\ & \vec{v}=(3,7)-(0,0)=(3,7)\end{align}\][/tex]

Now, let perform the dot product of two vectors,

[tex]\begin{gathered} u\cdot v=(-8,-9)\cdot(3,7) \\ u\cdot v=(-8)(3)+(-9)(7) \\ u\cdot v=-24-63 \\ u\cdot v=-87 \end{gathered}[/tex]

Now, perform the required operation,

[tex]\begin{gathered} -3(u\cdot v) \\ =-3(-87) \\ =261 \end{gathered}[/tex]

Final answer:

Hence, the required solution is:

[tex]-3(u\cdot v)=261[/tex]

Sparkles the Clown makes balloon animals for children at birthday parties. At Bridget's party, she made 5 balloon poodles and 1 balloon giraffe, which used a total of 15 balloons. For Eduardo's party, she used 7 balloons to make 1 balloon poodle and 1 balloon giraffe. How many balloons does each animal require?

Answers

Let p be the number of balloons required to make one balloon poodle and g the number of balloons required to make one balloon giraffe.

Then we have:

I) 5p + g = 15

II) p + g = 7

Subtracting equation II from equation I, we have:

5p - p + g - g = 15 - 7

4p = 8

p = 8/4

p = 2

Replacing p with 2 in equation II we have:

2 + g = 7

g = 7 - 2

g = 5

Answer: Each poodle requires 2 balloons and each giraffe requires 5 balloons.

An electronic store discounted a tablet computer by 30%. The discounted price of the computer was $486.50. Determine the original price of the tablet

Answers

The discounted price of the computer was $486.50.

An electronic store discounted a tablet computer by 30%.

So, the original price was

[tex]\begin{gathered} C=486.50+(486.50\times30percent) \\ =486.50+(486.50\times\frac{30}{100}) \\ =486.50+145.95 \\ =632.45 \end{gathered}[/tex]

So, the original price of the tablet computer was $632.45.

in chess, the knight (the piece shaped like a horse) moves in an L pattern.

Answers

yes, that is correct.

Answer:

That is true but still remember that playing the knight at the start can be very useful.

Please explain in depth. Thank you in advance for a response.

Answers

We have the function:

[tex]y=f(t)=(-18t-3)\cdot(t-2).[/tex]

a. Zeros of the function

By definition, the zeros are the values of t such that f(t) = 0. In this case, we have:

[tex]f(t)=(-18t-3)\cdot(t-2)=0\text{.}[/tex]

Rewriting the function, we have:

[tex]f(t)=(-18)\cdot(t+\frac{1}{6})\cdot(t-2)=0.[/tex]

So the zeros of the function are:

[tex]\begin{gathered} t=-\frac{1}{6}, \\ t=2. \end{gathered}[/tex]

b. Meaning of the zeros

The function y = f(t) represents the height of the ball at time t.

• So the zeros are the times at which the function reaches a height equal to zero.

,

• We see that one zero is positive and the other negative. Only the positive zero (t = 2) is meaningful because the negative (t = -1/6) represents a negative value of time!

c. Initial height

The ball is thrown at time t = 0. The height of the ball at time t = 0 is:

[tex]y=f(0)=(-18\cdot0-3)\cdot(0-2)=(-3)\cdot(-2)=6.[/tex]

So the ball is thrown from a height of 6 feet.

Answer

• a., The zeros are t = -1/6 and t = 2.

,

• b., The zeros are the values of time at which the height of the ball is zero. Only a positive value of time makes sense, so only the zero t = 2 is meaningful.

,

• c., The ball is thrown from a height of 6 feet.

John starting playing video games as soon as he got home from school. He played videogames for 45 minutes. Then, it took John 30 minutes to finish his homework. When Johnfinished his homework, it was 4:25 P.M. What time did John get home from school?

Answers

Given:

After coming from school to home,

He played video games for 45 minutes.

Then he took 30 minutes to finish his homework.

When John finished his homework, it was 4:25 PM.

To find:

The time at which John got home from school

Explanation:

According to the problem,

Total time to play video games and do homework is,

[tex]\begin{gathered} 45mins+30mins=75mins \\ =1hr15mins \end{gathered}[/tex]

So, the time he got home from school will be,

[tex]4:25P.M.-1hr15mins=3:10P.M.[/tex]

Final answer:

The time he got home from school is 3:10 P.M.

What is The volume of a cylinder 7 in height and 3 radius and a cone of 7 height and 3 radius together? So what is The volume of both together?

Answers

[tex]\begin{gathered} \text{Volume V}_{cy},\text{ of a cylinder with base radius r and height h is given by} \\ V_{cy}=\pi\times r^2\times h \end{gathered}[/tex]

In this case r =3, h= 7

[tex]\Rightarrow V_{cy}=\pi\times3^2\times7=63\pi=197.92unit^3[/tex][tex]\begin{gathered} \text{The Volume V}_{co\text{ }}of\text{ a cone with base radius r and height h is given by:} \\ V_{co}=\frac{1}{3}\times\pi\times r^2\times h \end{gathered}[/tex]

In this case,

r=3, h=7

[tex]V_{co}=\frac{1}{3}\times\pi\times(3)^2\times7=21\pi=65.97unit^3[/tex][tex]\begin{gathered} \text{Therefore} \\ V_{cy}+V_{co}=63\pi+21\pi=84\pi=263.89unit^3 \end{gathered}[/tex]

Hence

volume of cone + volume of cylinder = 263.89 cube units

I need to explain the mistake he made and show my work and I need the answer

Answers

The problem is;

-2(x-1) - 2 > 8 - 5x +4+ x

open the parenthesis

-2x + 2 -2 > 8- 5x + 4+ x

collect the like-term

-2x+5x-x > 8+4

2x > 12

divide both-side of the inequality by 2

x>6

The first mistake that was made is adding of the x-variables

It is 2x and not -6x

You pick a card at random.
1 2 3 4
What is P(factor of 24)?
Write your answer as a percentage rounded to the nearest tenth

Answers

Answer:

100%

Step-by-step explanation:

All of the numbers are factors of 24. So, picking a factor of 24 is guaranteed, so the probability is 1.

This is equal to 100%.

I need help with this Tyler’s mom purchased a saving bond for Tyler. The value of the savings bond increases by 4% each year one year after it was purchased, the value of the savings bond was $156.00 find the value of the bond when Tyler’s mom purchased it. Explain your reason

Answers

Let x = value of the bond when Tyler’s mom purchased it.

After one year, this value increased by 4%. This new value is calculated as follows:

[tex]\text{new value = }x\cdot1.04[/tex]

The new value is $156.00, then

[tex]\begin{gathered} 156.00=x\cdot1.04 \\ \frac{156.00}{1.04}=x \\ 150.00=x \end{gathered}[/tex]

The value of the bond was $150.00 when Tyler’s mom purchased

find the lowest common denominator of - not graded !

Answers

Given:

There are two equation given in the question.

Required:

We have to find the lowest common denominator of both equation.

Explanation:

[tex]\frac{p+3}{p^2+7p+10}and\frac{p+5}{p^2+5p+6}[/tex]

are given equations

first of all we need to factorization both denominator

[tex]\begin{gathered} p^2+7p+10and\text{ }p^2+5p+6 \\ (p+5)(p+2)and\text{ \lparen p+3\rparen\lparen p+2\rparen} \end{gathered}[/tex]

so here (p+2) is common in both so take (p+2) for one time only

so now the lowest common denominator is

[tex](p+5)(p+2)(p+3)[/tex]

Final answer:

The lowest common denominator for given two equations is

[tex](p+5)(p+2)(p+3)[/tex]


(1) Which of the following statements are true? Select all that apply.
A. The data suggest that a linear model would be appropriate.
B. The data increase by a fixed amount each year.
Relative Change
XXXXX
C. The data suggest that an exponential model would be appropriate.
D. The data show a constant growth rate.
E. No model can be inferred from the data provided.

Answers

No model can be inferred from the data provided

A spinner is divided into 5 equally sized segments colored blue, green, black, red, and yellow. Suppose you spin the wheel once and then spin it again. What is the probability of landing on the color red both times? Give your answer as an exact fraction and reduce the fraction as much as possible.

Answers

The probability of landing in any colour is:

[tex]\frac{1}{5}[/tex]

so if we want to get a red, both times, we to multiply 1/5 twice

[tex]\frac{1}{5}\cdot\frac{1}{5}=\frac{1}{25}[/tex]

so, the probability of getting red twice is 1/25

–8.38 as a mixed number.

Answers

Answer:

4 3/4

Step-by-step explanation:

Hello. I think I have the right answer. These types of questions have been giving me problems

Answers

EXPLANATION

Using a composite figure to approximate the area of the figure will give us the needed surface,

The area of the composite is approximately the area of the squares:

Area of square:

A= base * height = 1.0*1.0 = 1 cm^2

Since we have approximately 22 squares inside the figure, the approximate area will be as follows:

[tex]Area_{composite\text{ figure}}=22*1cm^2=22cm^2[/tex]

Therefore, the solution is approximately 22 square units.

QuestionAreli invested a principal of $950 in her bank account with an interest rate of 3%. How much interest did she earn in 5years?

Answers

$ 142.5

Explanation

to solve this we can use the formula:

[tex]i=\text{Prt}[/tex]

where i is the interest, P is the principal, r is the rate ( in decimals) and t is the time

then

Step 1

Let

[tex]\begin{gathered} i=i \\ P=950 \\ r=3\text{ \% =0.03} \\ \text{Time= 5 years} \end{gathered}[/tex]

replace in the formula

[tex]\begin{gathered} i=950\cdot0.03\cdot5 \\ i=142.5 \end{gathered}[/tex]

hence, the answer is

$ 142.5

I hope this helps you

Help 40 points please (show ur work)

Answers

The trail map having a trail length of 7 1/2 in has an actual distance of 3 miles

The amount Kepler paid for the tool not including tax is $120

34% of 850 is 289

How to find the actual length of if 7 1/2 inch in drawing

Given that

5 in ⇒ 2 miles

7 1/2 in ⇒ ?

The question is about scaling a map, the scale is 2miles is represented by 5 inches. This information is used to calculate the actual length when a measure of 7 1/2 inch is taken from the drawing

5 * ? = 7 1/2 * 2

? = 7 1/2 * 2 / 5

? = 3 miles

Hence 7 1/2 inch in the drawing represent an actual distance of 3 miles

How to find the amount Mr Kepler paid for the tool, not including tax

Given that:

with a discount of 40% off the regular price

The regular price was $200

A discount of 40% is given to Mr Kepler. Discount represents amount less the total amount. At a 40% discount Mr Kepler paid 60%  

40% = 0.4

40% discount = 1 - 0.4 = 0.6 (equivalent to 60%)

The amount Kepler paid

= 0.6 * 200

= $120

Knowledge of percentage is used here and the amount Mr Kepler paid is $120 not including tax

34% of 850

The statement 34% of 850 means 34 divided by 100 multiplied by 850. The division by hundred takes care of the percent, then "of" means multiplication

34% = 0.34

0.34 * 850 = 289

Hence, we conclude that the concept of percentage and division is used to solve 34% of 850 to get 289

Read more on percentage : https://brainly.com/question/24304697

#SPJ1

I need help with graph inequalityx < 1 on number lines

Answers

Answer:

The graph for the inequality x < 1 is shown below

Explanation:

The graph is marked on the number line, from the point 1 to the left, 1 is not included in this set, so the point is not shaded

Other Questions
If 1495 J of heat is needed to raise the temperature of a 315 g sample of a metal from 55.0C to 66.0C, what is the specific heat capacity of the metal? Which type of radiation would you consider ionizing radiation?MicrowavesVisible lightSound wavesGamma rays Read the following quote:The average American adult is saddled with two or three colds per year, according to the CDC (kids can get up to ten), and between five andten percent of us get the flu - with tens of thousands of people ending up in the hospital.- Good HousekeepingYou are writing a blog on your favorite home remedies for fighting a cold. Should this quote be paraphrased or directly quoted, and why?It should be directly quoted because government statistics are more persuasive than personal stories.It should be directly quoted because the original language is memorable.It should be paraphrased because statistics are not appropriate for a personal blog.It should be paraphrased because the information can easily be given in your own words. Make a table for the graph labeled hours studies average grade All of the following were typical of the Red Scare EXCEPTanti-conservatismanti-Communismanti-union sentimentanti-immigrant sentiment the circumference of a circle is 18pi ft. what is the area in square feet. tech a says fuel line pressure may be relieved by disabling the fuel pump and running the engine until it stops. tech b says the only safe way to relieve fuel pressure is to open the fuel return line at a fitting away from the engine. who is correct? _____ is the efficient management of the acquisition of raw materials to the factory and the movement of products from the producer to industrial users and consumers. You use a garden hose to fill a wading pool. If the water level rises 17 centimeters every 4 minutes and you record the data point of (12,y), what is the value of y? Use slope to justify your answer A psychology test has personality questions numbered 1, 2, 3, intelligence questions numbered 1, 2, 3, 4, and attitudequestions numbered 1,2. If a single question is picked at random, what is the probability that the question is an intelligence question OR has an odd number? Una clase tiene 42 alumnos. Se puede determinar que 3/9 son nios y 4 6 son nias, Cuntos nios y cuantas nias hay en la clase? Kindly assist in answering these questions the stryker company discovered through marketing research that one of its medical devices was too difficult for doctors to locate for purchase. it redesigned its website information and highlighted the device, trained the sales staff, prominently featured the device in trade magazines, and simplified the purchasing process. what important step in the process did the stryker company forget to do? Please help me with this question. Write a proportional that relates the corresponding sides. You must use all of the sides for both triangles in your statement. $3.44 at the Farmers market at a grocery store the same oranges cost $8.40 for a bag of 20 find the better deal by calculating the unit rate for both locations how much would be saved per orange by purchasing oranges at the locations with the better deal solve the word problemFarmers market unit rate --------------grocery store unit rate ------------------better deal -------------how much is saved ------------A $0.01/ orangeslB $0.41 / orangeC grocery storeD Farmers marketE $0.43 / orangeF $0.40 / OrangeG $0.10 / Orange find the zeros algebraically: f(x)=x^4-8x^3+5x^2+14x How many grams of CO are produced when 33.0 g of C reacts? Fe2O3(s)+3C(s)2Fe(s)+3CO(g) A normal distribution has a mean of 101 and a standard Deviation of 12. find the probability that a value selected at random is in the following interval.at most 13 Geometry Problem - Given: segment AB is congruent to segment AD and segment FC is perpendicular to segment BD. Conclusion: Triangle AEG is isosceles. (Reference diagram in picture)